WebId - Social web browser webid
authorDenis Duvauchelle <desduvauchelle@gmail.com>
Tue, 03 Jan 2012 16:58:07 +0100
changeset 165 27ebd9d380b0
parent 164 b920b4d63786
child 171 61270101fa04
WebId - Social web browser
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_css/general.css	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,118 @@
[email protected] "UTF-8";
+/* CSS Document */
+*{ outline:none; font-size:14px; color:#333333; margin:0px; padding:0px;font-family:Arial, Helvetica, sans-serif; }
+body{  }
+a{ display:inline-block; text-decoration:none; }
+.clear{ clear:both; }
+.hide{ display:none; }
+ul{ padding-left:20px; margin:5px 0px; }
+ul li{ padding:4px 0px; }
+h1, h2, h3 {  }
+h3{ color:#666; font-weight:lighter; }
+input, textarea { border:1px solid #333; width:300px; padding:4px; margin-bottom:10px; }
+button{ padding:5px 10px; border:none; background:#F2F2F2; color:#0083E2; cursor:pointer; margin-right:10px;-moz-border-radius: 5px; -webkit-border-radius: 5px; -khtml-border-radius: 5px;border-radius: 5px; }
+button:hover{ border:none; background:#CCC; color:#00396B; }
+select{  }
+a{ color:#0083E2; text-decoration:none; font-size:12px; }   
+a:hover{ text-decoration:none; color:#00396B; } 
+#topbar{ width:100%; height:50px; background:#333; color:#CCC; }
+#topbar img{ position:relative; top:-2px; }
+.wrapper, .wrapper h1{ color:#CCC; }
+.wrapper h1, .wrapper input, .wrapper button{ display:inline-block; }
+.wrapper h1{ font-size:24px; padding:10px 0px; margin-right:40px; cursor:pointer; position:relative; top:3px; }
+.wrapper form{ display:inline-block; width:280px; }
+.wrapper input{ width:240px; background:#666; border:1ps solid #000; position:relative; z-index:1; color:#CCC; }
+.wrapper button{ display:inline-block; position:relative; z-index:2; left:-30px; width:15px; height:15px; padding:0px; margin:0px; border:none; cursor:pointer; background:url(../a_img/search_btn.png) no-repeat; }
+.topbar_links{ text-decoration:none; font-size:16px; padding:4px; margin:0px 3px; color:#CCC; }
+.topbar_links:hover{ color:#999; }
+.wrapper div{ position:absolute; right:0px; text-align:right; top:18px; color:#CCC; }
+.wrapper div a{ color:#CCC; font-size:14px; text-decoration:none; }
+.wrapper div a:hover{ text-decoration:none; color:#999; }
+.wrapper div span{ margin:0px 4px; color:#ccc; }
+#site_wrapper, .wrapper{ width:960px; margin:0 auto; position:relative; }
+#site_wrapper{ margin-top:10px; margin-bottom:20px; min-height:500px; }
+#site_content{ width:100%; position:relative; }
+#left_column{ width:520px; float:left; padding-right:17px; border-right:1px solid #666; height:100%; min-height:900px; }
+#right_column{ width:400px; float:right; height:100%; }
+#footer{ margin-bottom:50px; margin-top:20px; padding-top:10px; border-top:1px solid #CCC; text-align:center; color:#9f9f9f; }
+#status_box{ padding:15px 0px; }
+#status_box h2{ padding:5px; font-size:16px; font-weight:normal; display:block; }
+#status_box textarea{ width:510px; height:20px; display:block; }
+#status_box  button{  }
+#status_box  button:hover{  }
+#status_box span{ font-size:11px; color:#999; font-style:oblique; }
+#load_more{ width:100%; background:#EEFAFF; padding:10px 0px; }
+.story_box{ width:100%; border-bottom:1px solid #CCC; padding:15px 0px 5px 0px; }
+.story_box:hover{ background:#F2F2F2; }
+.story_left_column{ float:left; width:40px; margin-right:18px; margin-bottom:15px; padding-left:3px; }
+.story_left_column img{ width:100%; }
+.story_right_column{float:right; width:875px; }
+.story_right_column input{ display:inline-block; width:15px; height:15px; float:left; margin-top:2px; }
+.text{ font-size:16px; margin-bottom:10px; }
+.story_bottom_row{ width:100%; }
+.story_bottom_left{ float:left; margin-left:3px; }
+.story_bottom_left span{  color:#B3B3B3; font-size:10px; margin-right:5px; }
+.story_bottom_left span a{font-size:10px; }
+.story_bottom_right{ float:right; margin-right:3px; }
+.strikethrough{ text-decoration:line-through; }
+.story_comments{ width:865px; padding:10px 5px; background:#F2F6FE; border-bottom:1px solid #CCC; margin-left:85px; }
+.story_comments_img{ float:left; width:40px; }
+.story_comments_txt{ float:right; width:800px; }
+.story_comments_txt textarea{ height:20px; width:780px !important; }
+.story_comments_txt strong{ color:#999; font-weight:lighter; }
+.story_comments_txt button{  }
+.story_comments_txt button:hover{  }
+#profile_img_holder{ width:80px; height:80px; border:1px solid #333333; background:url(img/ajax-loader.gif) 50% 50%; float:left; margin-right:20px; }
+#profile_img_holder img{ width:100%; height:100%; }
Binary file src/main/resources/a_img/ajax-loader.gif has changed
Binary file src/main/resources/a_img/avatar.png has changed
Binary file src/main/resources/a_img/clip.jpg has changed
Binary file src/main/resources/a_img/clip.png has changed
Binary file src/main/resources/a_img/favicon.ico has changed
Binary file src/main/resources/a_img/icon_right_minimizer.gif has changed
Binary file src/main/resources/a_img/icon_right_minimizer_hover.gif has changed
Binary file src/main/resources/a_img/icon_right_minimizer_reverse.gif has changed
Binary file src/main/resources/a_img/icon_right_minimizer_reverse_hover.gif has changed
Binary file src/main/resources/a_img/search_btn.png has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/ajaxupload.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,673 @@
+ * AJAX Upload ( http://valums.com/ajax-upload/ ) 
+ * Copyright (c) Andris Valums
+ * Licensed under the MIT license ( http://valums.com/mit-license/ )
+ * Thanks to Gary Haran, David Mark, Corey Burns and others for contributions 
+ */
+(function () {
+    /* global window */
+    /* jslint browser: true, devel: true, undef: true, nomen: true, bitwise: true, regexp: true, newcap: true, immed: true */
+    /**
+     * Wrapper for FireBug's console.log
+     */
+    function log(){
+        if (typeof(console) != 'undefined' && typeof(console.log) == 'function'){            
+            Array.prototype.unshift.call(arguments, '[Ajax Upload]');
+            console.log( Array.prototype.join.call(arguments, ' '));
+        }
+    } 
+    /**
+     * Attaches event to a dom element.
+     * @param {Element} el
+     * @param type event name
+     * @param fn callback This refers to the passed element
+     */
+    function addEvent(el, type, fn){
+        if (el.addEventListener) {
+            el.addEventListener(type, fn, false);
+        } else if (el.attachEvent) {
+            el.attachEvent('on' + type, function(){
+                fn.call(el);
+	        });
+	    } else {
+            throw new Error('not supported or DOM not loaded');
+        }
+    }   
+    /**
+     * Attaches resize event to a window, limiting
+     * number of event fired. Fires only when encounteres
+     * delay of 100 after series of events.
+     * 
+     * Some browsers fire event multiple times when resizing
+     * http://www.quirksmode.org/dom/events/resize.html
+     * 
+     * @param fn callback This refers to the passed element
+     */
+    function addResizeEvent(fn){
+        var timeout;
+	    addEvent(window, 'resize', function(){
+            if (timeout){
+                clearTimeout(timeout);
+            }
+            timeout = setTimeout(fn, 100);                        
+        });
+    }    
+    // Needs more testing, will be rewriten for next version        
+    // getOffset function copied from jQuery lib (http://jquery.com/)
+    if (document.documentElement.getBoundingClientRect){
+        // Get Offset using getBoundingClientRect
+        // http://ejohn.org/blog/getboundingclientrect-is-awesome/
+        var getOffset = function(el){
+            var box = el.getBoundingClientRect();
+            var doc = el.ownerDocument;
+            var body = doc.body;
+            var docElem = doc.documentElement; // for ie 
+            var clientTop = docElem.clientTop || body.clientTop || 0;
+            var clientLeft = docElem.clientLeft || body.clientLeft || 0;
+            // In Internet Explorer 7 getBoundingClientRect property is treated as physical,
+            // while others are logical. Make all logical, like in IE8.	
+            var zoom = 1;            
+            if (body.getBoundingClientRect) {
+                var bound = body.getBoundingClientRect();
+                zoom = (bound.right - bound.left) / body.clientWidth;
+            }
+            if (zoom > 1) {
+                clientTop = 0;
+                clientLeft = 0;
+            }
+            var top = box.top / zoom + (window.pageYOffset || docElem && docElem.scrollTop / zoom || body.scrollTop / zoom) - clientTop, left = box.left / zoom + (window.pageXOffset || docElem && docElem.scrollLeft / zoom || body.scrollLeft / zoom) - clientLeft;
+            return {
+                top: top,
+                left: left
+            };
+        };        
+    } else {
+        // Get offset adding all offsets 
+        var getOffset = function(el){
+            var top = 0, left = 0;
+            do {
+                top += el.offsetTop || 0;
+                left += el.offsetLeft || 0;
+                el = el.offsetParent;
+            } while (el);
+            return {
+                left: left,
+                top: top
+            };
+        };
+    }
+    /**
+     * Returns left, top, right and bottom properties describing the border-box,
+     * in pixels, with the top-left relative to the body
+     * @param {Element} el
+     * @return {Object} Contains left, top, right,bottom
+     */
+    function getBox(el){
+        var left, right, top, bottom;
+        var offset = getOffset(el);
+        left = offset.left;
+        top = offset.top;
+        right = left + el.offsetWidth;
+        bottom = top + el.offsetHeight;
+        return {
+            left: left,
+            right: right,
+            top: top,
+            bottom: bottom
+        };
+    }
+    /**
+     * Helper that takes object literal
+     * and add all properties to element.style
+     * @param {Element} el
+     * @param {Object} styles
+     */
+    function addStyles(el, styles){
+        for (var name in styles) {
+            if (styles.hasOwnProperty(name)) {
+                el.style[name] = styles[name];
+            }
+        }
+    }
+    /**
+     * Function places an absolutely positioned
+     * element on top of the specified element
+     * copying position and dimentions.
+     * @param {Element} from
+     * @param {Element} to
+     */    
+    function copyLayout(from, to){
+	    var box = getBox(from);
+        addStyles(to, {
+	        position: 'absolute',                    
+	        left : box.left + 'px',
+	        top : box.top + 'px',
+	        width : from.offsetWidth + 'px',
+	        height : from.offsetHeight + 'px'
+	    });        
+    }
+    /**
+    * Creates and returns element from html chunk
+    * Uses innerHTML to create an element
+    */
+    var toElement = (function(){
+        var div = document.createElement('div');
+        return function(html){
+            div.innerHTML = html;
+            var el = div.firstChild;
+            return div.removeChild(el);
+        };
+    })();
+    /**
+     * Function generates unique id
+     * @return unique id 
+     */
+    var getUID = (function(){
+        var id = 0;
+        return function(){
+            return 'ValumsAjaxUpload' + id++;
+        };
+    })();        
+    /**
+     * Get file name from path
+     * @param {String} file path to file
+     * @return filename
+     */  
+    function fileFromPath(file){
+        return file.replace(/.*(\/|\\)/, "");
+    }
+    /**
+     * Get file extension lowercase
+     * @param {String} file name
+     * @return file extenstion
+     */    
+    function getExt(file){
+        return (-1 !== file.indexOf('.')) ? file.replace(/.*[.]/, '') : '';
+    }
+    function hasClass(el, name){        
+        var re = new RegExp('\\b' + name + '\\b');        
+        return re.test(el.className);
+    }    
+    function addClass(el, name){
+        if ( ! hasClass(el, name)){   
+            el.className += ' ' + name;
+        }
+    }    
+    function removeClass(el, name){
+        var re = new RegExp('\\b' + name + '\\b');                
+        el.className = el.className.replace(re, '');        
+    }
+    function removeNode(el){
+        el.parentNode.removeChild(el);
+    }
+    /**
+     * Easy styling and uploading
+     * @constructor
+     * @param button An element you want convert to 
+     * upload button. Tested dimentions up to 500x500px
+     * @param {Object} options See defaults below.
+     */
+    window.AjaxUpload = function(button, options){
+        this._settings = {
+            // Location of the server-side upload script
+            action: 'upload.php',
+            // File upload name
+            name: 'userfile',
+            // Additional data to send
+            data: {},
+            // Submit file as soon as it's selected
+            autoSubmit: true,
+            // The type of data that you're expecting back from the server.
+            // html and xml are detected automatically.
+            // Only useful when you are using json data as a response.
+            // Set to "json" in that case. 
+            responseType: false,
+            // Class applied to button when mouse is hovered
+            //hoverClass: 'hover',
+            // Class applied to button when AU is disabled
+            disabledClass: 'disabled',            
+            // When user selects a file, useful with autoSubmit disabled
+            // You can return false to cancel upload			
+            onChange: function(file, extension){
+            },
+            // Callback to fire before file is uploaded
+            // You can return false to cancel upload
+            onSubmit: function(file, extension){
+            },
+            // Fired when file upload is completed
+            onComplete: function(file, response){
+            }
+        };
+        // Merge the users options with our defaults
+        for (var i in options) {
+            if (options.hasOwnProperty(i)){
+                this._settings[i] = options[i];
+            }
+        }
+        // button isn't necessary a dom element
+        if (button.jquery){
+            // jQuery object was passed
+            button = button[0];
+        } else if (typeof button == "string") {
+            if (/^#.*/.test(button)){
+                // If jQuery user passes #elementId don't break it					
+                button = button.slice(1);                
+            }
+            button = document.getElementById(button);
+        }
+        if ( ! button || button.nodeType !== 1){
+            throw new Error("Please make sure that you're passing a valid element"); 
+        }
+        if ( button.nodeName.toUpperCase() == 'A'){
+            // disable link                       
+            addEvent(button, 'click', function(e){
+                if (e && e.preventDefault){
+                    e.preventDefault();
+                } else if (window.event){
+                    window.event.returnValue = false;
+                }
+            });
+        }
+        // DOM element
+        this._button = button;        
+        // DOM element                 
+        this._input = null;
+        // If disabled clicking on button won't do anything
+        this._disabled = false;
+        // if the button was disabled before refresh if will remain
+        // disabled in FireFox, let's fix it
+        this.enable();        
+        this._rerouteClicks();
+    };
+    // assigning methods to our class
+    AjaxUpload.prototype = {
+        setData: function(data){
+            this._settings.data = data;
+        },
+        disable: function(){            
+            addClass(this._button, this._settings.disabledClass);
+            this._disabled = true;
+            var nodeName = this._button.nodeName.toUpperCase();            
+            if (nodeName == 'INPUT' || nodeName == 'BUTTON'){
+                this._button.setAttribute('disabled', 'disabled');
+            }            
+            // hide input
+            if (this._input){
+                // We use visibility instead of display to fix problem with Safari 4
+                // The problem is that the value of input doesn't change if it 
+                // has display none when user selects a file           
+                this._input.parentNode.style.visibility = 'hidden';
+            }
+        },
+        enable: function(){
+            removeClass(this._button, this._settings.disabledClass);
+            this._button.removeAttribute('disabled');
+            this._disabled = false;
+        },
+        /**
+         * Creates invisible file input 
+         * that will hover above the button
+         * <div><input type='file' /></div>
+         */
+        _createInput: function(){ 
+            var self = this;
+            var input = document.createElement("input");
+            input.setAttribute('type', 'file');
+            input.setAttribute('name', this._settings.name);
+            addStyles(input, {
+                'position' : 'absolute',
+                // in Opera only 'browse' button
+                // is clickable and it is located at
+                // the right side of the input
+                'right' : 0,
+                'margin' : 0,
+                'padding' : 0,
+                'fontSize' : '480px',                
+                'cursor' : 'pointer'
+            });            
+            var div = document.createElement("div");                        
+            addStyles(div, {
+                'display' : 'block',
+                'position' : 'absolute',
+                'overflow' : 'hidden',
+                'margin' : 0,
+                'padding' : 0,                
+                'opacity' : 0,
+                // Make sure browse button is in the right side
+                // in Internet Explorer
+                'direction' : 'ltr',
+                //Max zIndex supported by Opera 9.0-9.2
+                'zIndex': 2147483583
+            });
+            // Make sure that element opacity exists.
+            // Otherwise use IE filter            
+            if ( div.style.opacity !== "0") {
+                if (typeof(div.filters) == 'undefined'){
+                    throw new Error('Opacity not supported by the browser');
+                }
+                div.style.filter = "alpha(opacity=0)";
+            }            
+            addEvent(input, 'change', function(){
+                if ( ! input || input.value === ''){                
+                    return;                
+                }
+                // Get filename from input, required                
+                // as some browsers have path instead of it          
+                var file = fileFromPath(input.value);
+                if (false === self._settings.onChange.call(self, file, getExt(file))){
+                    self._clearInput();                
+                    return;
+                }
+                // Submit form when value is changed
+                if (self._settings.autoSubmit) {
+                    self.submit();
+                }
+            });            
+            addEvent(input, 'mouseover', function(){
+                addClass(self._button, self._settings.hoverClass);
+            });
+            addEvent(input, 'mouseout', function(){
+                removeClass(self._button, self._settings.hoverClass);
+                // We use visibility instead of display to fix problem with Safari 4
+                // The problem is that the value of input doesn't change if it 
+                // has display none when user selects a file           
+                input.parentNode.style.visibility = 'hidden';
+            });   
+	        div.appendChild(input);
+            document.body.appendChild(div);
+            this._input = input;
+        },
+        _clearInput : function(){
+            if (!this._input){
+                return;
+            }            
+            // this._input.value = ''; Doesn't work in IE6                               
+            removeNode(this._input.parentNode);
+            this._input = null;                                                                   
+            this._createInput();
+            removeClass(this._button, this._settings.hoverClass);
+        },
+        /**
+         * Function makes sure that when user clicks upload button,
+         * the this._input is clicked instead
+         */
+        _rerouteClicks: function(){
+            var self = this;
+            // IE will later display 'access denied' error
+            // if you use using self._input.click()
+            // other browsers just ignore click()
+            addEvent(self._button, 'mouseover', function(){
+                if (self._disabled){
+                    return;
+                }
+                if ( ! self._input){
+	                self._createInput();
+                }
+                var div = self._input.parentNode;                            
+                copyLayout(self._button, div);
+                div.style.visibility = 'visible';
+            });
+            // commented because we now hide input on mouseleave
+            /**
+             * When the window is resized the elements 
+             * can be misaligned if button position depends
+             * on window size
+             */
+            //addResizeEvent(function(){
+            //    if (self._input){
+            //        copyLayout(self._button, self._input.parentNode);
+            //    }
+            //});            
+        },
+        /**
+         * Creates iframe with unique name
+         * @return {Element} iframe
+         */
+        _createIframe: function(){
+            // We can't use getTime, because it sometimes return
+            // same value in safari :(
+            var id = getUID();            
+            // We can't use following code as the name attribute
+            // won't be properly registered in IE6, and new window
+            // on form submit will open
+            // var iframe = document.createElement('iframe');
+            // iframe.setAttribute('name', id);                        
+            var iframe = toElement('<iframe src="javascript:false;" name="' + id + '" />');
+            // src="javascript:false; was added
+            // because it possibly removes ie6 prompt 
+            // "This page contains both secure and nonsecure items"
+            // Anyway, it doesn't do any harm.            
+            iframe.setAttribute('id', id);
+            iframe.style.display = 'none';
+            document.body.appendChild(iframe);
+            return iframe;
+        },
+        /**
+         * Creates form, that will be submitted to iframe
+         * @param {Element} iframe Where to submit
+         * @return {Element} form
+         */
+        _createForm: function(iframe){
+            var settings = this._settings;
+            // We can't use the following code in IE6
+            // var form = document.createElement('form');
+            // form.setAttribute('method', 'post');
+            // form.setAttribute('enctype', 'multipart/form-data');
+            // Because in this case file won't be attached to request                    
+            var form = toElement('<form method="post" enctype="multipart/form-data"></form>');
+            form.setAttribute('action', settings.action);
+            form.setAttribute('target', iframe.name);                                   
+            form.style.display = 'none';
+            document.body.appendChild(form);
+            // Create hidden input element for each data key
+            for (var prop in settings.data) {
+                if (settings.data.hasOwnProperty(prop)){
+                    var el = document.createElement("input");
+                    el.setAttribute('type', 'hidden');
+                    el.setAttribute('name', prop);
+                    el.setAttribute('value', settings.data[prop]);
+                    form.appendChild(el);
+                }
+            }
+            return form;
+        },
+        /**
+         * Gets response from iframe and fires onComplete event when ready
+         * @param iframe
+         * @param file Filename to use in onComplete callback 
+         */
+        _getResponse : function(iframe, file){            
+            // getting response
+            var toDeleteFlag = false, self = this, settings = this._settings;   
+            addEvent(iframe, 'load', function(){                
+                if (// For Safari 
+                    iframe.src == "javascript:'%3Chtml%3E%3C/html%3E';" ||
+                    // For FF, IE
+                    iframe.src == "javascript:'<html></html>';"){                                                                        
+                        // First time around, do not delete.
+                        // We reload to blank page, so that reloading main page
+                        // does not re-submit the post.
+                        if (toDeleteFlag) {
+                            // Fix busy state in FF3
+                            setTimeout(function(){
+                                removeNode(iframe);
+                            }, 0);
+                        }
+                        return;
+                }
+                var doc = iframe.contentDocument ? iframe.contentDocument : window.frames[iframe.id].document;
+                // fixing Opera 9.26,10.00
+                if (doc.readyState && doc.readyState != 'complete') {
+                   // Opera fires load event multiple times
+                   // Even when the DOM is not ready yet
+                   // this fix should not affect other browsers
+                   return;
+                }
+                // fixing Opera 9.64
+                if (doc.body && doc.body.innerHTML == "false") {
+                    // In Opera 9.64 event was fired second time
+                    // when body.innerHTML changed from false 
+                    // to server response approx. after 1 sec
+                    return;
+                }
+                var response;
+                if (doc.XMLDocument) {
+                    // response is a xml document Internet Explorer property
+                    response = doc.XMLDocument;
+                } else if (doc.body){
+                    // response is html document or plain text
+                    response = doc.body.innerHTML;
+                    if (settings.responseType && settings.responseType.toLowerCase() == 'json') {
+                        // If the document was sent as 'application/javascript' or
+                        // 'text/javascript', then the browser wraps the text in a <pre>
+                        // tag and performs html encoding on the contents.  In this case,
+                        // we need to pull the original text content from the text node's
+                        // nodeValue property to retrieve the unmangled content.
+                        // Note that IE6 only understands text/html
+                        if (doc.body.firstChild && doc.body.firstChild.nodeName.toUpperCase() == 'PRE') {
+                            response = doc.body.firstChild.firstChild.nodeValue;
+                        }
+                        if (response) {
+                            response = eval("(" + response + ")");
+                        } else {
+                            response = {};
+                        }
+                    }
+                } else {
+                    // response is a xml document
+                    response = doc;
+                }
+                settings.onComplete.call(self, file, response);
+                // Reload blank page, so that reloading main page
+                // does not re-submit the post. Also, remember to
+                // delete the frame
+                toDeleteFlag = true;
+                // Fix IE mixed content issue
+                iframe.src = "javascript:'<html></html>';";
+            });            
+        },        
+        /**
+         * Upload file contained in this._input
+         */
+        submit: function(){                        
+            var self = this, settings = this._settings;
+            if ( ! this._input || this._input.value === ''){                
+                return;                
+            }
+            var file = fileFromPath(this._input.value);
+            // user returned false to cancel upload
+            if (false === settings.onSubmit.call(this, file, getExt(file))){
+                this._clearInput();                
+                return;
+            }
+            // sending request    
+            var iframe = this._createIframe();
+            var form = this._createForm(iframe);
+            // assuming following structure
+            // div -> input type='file'
+            removeNode(this._input.parentNode);            
+            removeClass(self._button, self._settings.hoverClass);
+            form.appendChild(this._input);
+            form.submit();
+            // request set, clean up                
+            removeNode(form); form = null;                          
+            removeNode(this._input); this._input = null;
+            // Get response from iframe and fire onComplete event when ready
+            this._getResponse(iframe, file);            
+            // get ready for next request            
+            this._createInput();
+        }
+    };
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/cycle.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,218 @@
+ * jQuery Cycle Lite Plugin
+ * http://malsup.com/jquery/cycle/lite/
+ * Copyright (c) 2008-2011 M. Alsup
+ * Version: 1.3 (01-JUN-2011)
+ * Dual licensed under the MIT and GPL licenses:
+ * http://www.opensource.org/licenses/mit-license.php
+ * http://www.gnu.org/licenses/gpl.html
+ * Requires: jQuery v1.3.2 or later
+ */
+;(function($) {
+var ver = 'Lite-1.3';
+$.fn.cycle = function(options) {
+    return this.each(function() {
+        options = options || {};
+        if (this.cycleTimeout) clearTimeout(this.cycleTimeout);
+        this.cycleTimeout = 0;
+        this.cyclePause = 0;
+        var $cont = $(this);
+        var $slides = options.slideExpr ? $(options.slideExpr, this) : $cont.children();
+        var els = $slides.get();
+        if (els.length < 2) {
+            window.console && console.log('terminating; too few slides: ' + els.length);
+            return; // don't bother
+        }
+        // support metadata plugin (v1.0 and v2.0)
+        var opts = $.extend({}, $.fn.cycle.defaults, options || {}, $.metadata ? $cont.metadata() : $.meta ? $cont.data() : {});
+		var meta = $.isFunction($cont.data) ? $cont.data(opts.metaAttr) : null;
+		if (meta)
+			opts = $.extend(opts, meta);
+        opts.before = opts.before ? [opts.before] : [];
+        opts.after = opts.after ? [opts.after] : [];
+        opts.after.unshift(function(){ opts.busy=0; });
+        // allow shorthand overrides of width, height and timeout
+        var cls = this.className;
+        opts.width = parseInt((cls.match(/w:(\d+)/)||[])[1]) || opts.width;
+        opts.height = parseInt((cls.match(/h:(\d+)/)||[])[1]) || opts.height;
+        opts.timeout = parseInt((cls.match(/t:(\d+)/)||[])[1]) || opts.timeout;
+        if ($cont.css('position') == 'static') 
+            $cont.css('position', 'relative');
+        if (opts.width) 
+            $cont.width(opts.width);
+        if (opts.height && opts.height != 'auto') 
+            $cont.height(opts.height);
+        var first = 0;
+        $slides.css({position: 'absolute', top:0, left:0}).each(function(i) { 
+            $(this).css('z-index', els.length-i) 
+        });
+        $(els[first]).css('opacity',1).show(); // opacity bit needed to handle reinit case
+        if ($.browser.msie) els[first].style.removeAttribute('filter');
+        if (opts.fit && opts.width) 
+            $slides.width(opts.width);
+        if (opts.fit && opts.height && opts.height != 'auto') 
+            $slides.height(opts.height);
+        if (opts.pause) 
+            $cont.hover(function(){this.cyclePause=1;}, function(){this.cyclePause=0;});
+        var txFn = $.fn.cycle.transitions[opts.fx];
+		txFn && txFn($cont, $slides, opts);
+        $slides.each(function() {
+            var $el = $(this);
+            this.cycleH = (opts.fit && opts.height) ? opts.height : $el.height();
+            this.cycleW = (opts.fit && opts.width) ? opts.width : $el.width();
+        });
+        if (opts.cssFirst)
+            $($slides[first]).css(opts.cssFirst);
+        if (opts.timeout) {
+            // ensure that timeout and speed settings are sane
+            if (opts.speed.constructor == String)
+                opts.speed = {slow: 600, fast: 200}[opts.speed] || 400;
+            if (!opts.sync)
+                opts.speed = opts.speed / 2;
+            while((opts.timeout - opts.speed) < 250)
+                opts.timeout += opts.speed;
+        }
+        opts.speedIn = opts.speed;
+        opts.speedOut = opts.speed;
+ 		opts.slideCount = els.length;
+        opts.currSlide = first;
+        opts.nextSlide = 1;
+        // fire artificial events
+        var e0 = $slides[first];
+        if (opts.before.length)
+            opts.before[0].apply(e0, [e0, e0, opts, true]);
+        if (opts.after.length > 1)
+            opts.after[1].apply(e0, [e0, e0, opts, true]);
+        if (opts.click && !opts.next)
+            opts.next = opts.click;
+        if (opts.next)
+            $(opts.next).bind('click', function(){return advance(els,opts,opts.rev?-1:1)});
+        if (opts.prev)
+            $(opts.prev).bind('click', function(){return advance(els,opts,opts.rev?1:-1)});
+        if (opts.timeout)
+            this.cycleTimeout = setTimeout(function() {
+                go(els,opts,0,!opts.rev)
+            }, opts.timeout + (opts.delay||0));
+    });
+function go(els, opts, manual, fwd) {
+    if (opts.busy) return;
+    var p = els[0].parentNode, curr = els[opts.currSlide], next = els[opts.nextSlide];
+    if (p.cycleTimeout === 0 && !manual) 
+        return;
+    if (manual || !p.cyclePause) {
+        if (opts.before.length)
+            $.each(opts.before, function(i,o) { o.apply(next, [curr, next, opts, fwd]); });
+        var after = function() {
+            if ($.browser.msie)
+                this.style.removeAttribute('filter');
+            $.each(opts.after, function(i,o) { o.apply(next, [curr, next, opts, fwd]); });
+        };
+        if (opts.nextSlide != opts.currSlide) {
+            opts.busy = 1;
+            $.fn.cycle.custom(curr, next, opts, after);
+        }
+        var roll = (opts.nextSlide + 1) == els.length;
+        opts.nextSlide = roll ? 0 : opts.nextSlide+1;
+        opts.currSlide = roll ? els.length-1 : opts.nextSlide-1;
+    }
+    if (opts.timeout)
+        p.cycleTimeout = setTimeout(function() { go(els,opts,0,!opts.rev) }, opts.timeout);
+// advance slide forward or back
+function advance(els, opts, val) {
+    var p = els[0].parentNode, timeout = p.cycleTimeout;
+    if (timeout) {
+        clearTimeout(timeout);
+        p.cycleTimeout = 0;
+    }
+    opts.nextSlide = opts.currSlide + val;
+    if (opts.nextSlide < 0) {
+        opts.nextSlide = els.length - 1;
+    }
+    else if (opts.nextSlide >= els.length) {
+        opts.nextSlide = 0;
+    }
+    go(els, opts, 1, val>=0);
+    return false;
+$.fn.cycle.custom = function(curr, next, opts, cb) {
+    var $l = $(curr), $n = $(next);
+    $n.css(opts.cssBefore);
+    var fn = function() {$n.animate(opts.animIn, opts.speedIn, opts.easeIn, cb)};
+    $l.animate(opts.animOut, opts.speedOut, opts.easeOut, function() {
+        $l.css(opts.cssAfter);
+        if (!opts.sync) fn();
+    });
+    if (opts.sync) fn();
+$.fn.cycle.transitions = {
+    fade: function($cont, $slides, opts) {
+		$slides.not(':eq(0)').hide();
+		opts.cssBefore = { opacity: 0, display: 'block' };
+		opts.cssAfter  = { display: 'none' };
+		opts.animOut = { opacity: 0 };
+		opts.animIn = { opacity: 1 };
+    },
+    fadeout: function($cont, $slides, opts) {
+		opts.before.push(function(curr,next,opts,fwd) {
+			$(curr).css('zIndex',opts.slideCount + (fwd === true ? 1 : 0));
+			$(next).css('zIndex',opts.slideCount + (fwd === true ? 0 : 1));
+		});
+		$slides.not(':eq(0)').hide();
+		opts.cssBefore = { opacity: 1, display: 'block', zIndex: 1 };
+		opts.cssAfter  = { display: 'none', zIndex: 0 };
+		opts.animOut = { opacity: 0 };
+    }
+$.fn.cycle.ver = function() { return ver; };
+// @see: http://malsup.com/jquery/cycle/lite/
+$.fn.cycle.defaults = {
+	animIn:        {},
+	animOut:       {},
+	fx:           'fade',
+    after:         null, 
+    before:        null, 
+	cssBefore:     {},
+	cssAfter:      {},
+    delay:         0,    
+    fit:           0,    
+    height:       'auto',
+	metaAttr:     'cycle',
+    next:          null, 
+    pause:         0,    
+    prev:          null, 
+    speed:         1000, 
+    slideExpr:     null,
+    sync:          1,    
+    timeout:       4000 
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/general.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,664 @@
+// JavaScript Document
+						 /*
+	var button1 = $('#status_upload_file'), interval;
+		new AjaxUpload(button1, {
+			onSubmit : function(file , ext){
+               	 if (! (ext && /^(jpg)$/i.test(ext))){
+                        // extension is not allowed
+                        alert('Error: invalid file extension (only jpg for the moment)');
+                        // cancel upload
+                        return false;
+               	 }
+       		 },
+			action: 'LINKTOFILE.php', 
+			name: 'status_file',
+			onSubmit : function(file, ext){ 
+				// Disable the send status button until it is sent
+				$('#status_btn_submit').attr('disabled', 'disabled');
+				// change button text, when user selects file			
+				button1.text('Uploading');
+				// If you want to allow uploading only 1 file at time,
+				// you can disable upload button
+				this.disable();
+				// Uploding -> Uploading. -> Uploading...
+				interval = window.setInterval(function(){
+					var text = button1.text();
+					if (text.length < 13){
+						button1.text(text + '.');					
+					} else {
+						button1.text('Uploading');				
+					}
+				}, 200);
+			},
+			onComplete: function(file, response){ 
+				button1.text('Uploaded');
+				window.clearInterval(interval);
+				// enable upload button
+				this.enable();
+				//Re enable the button to submit the post
+				$('#status_btn_submit').removeAttr('disabled');
+				// add file to the list
+				$('#status_file_name').html(response);
+				$('#status_file_name').fadeIn('fast');
+				$('#status_file_temp_name').val(response);
+			}
+		});
+		*/
+	// Column minimizer
+	$('#min_right_column').click(function(){
+		$('#right_column').animate({width: 'toggle'});
+		if($(this).hasClass('min_right_column_normal')){
+			// for the button
+			$(this).removeClass('min_right_column_normal');
+			$(this).addClass('min_right_column_reverse');
+			// for the left column
+			$('#left_column').addClass('left_column_full');
+			$('.text').addClass('text_full');
+			$('.story_right_column').addClass('text_full');
+		} else {
+			// for the button
+			$(this).removeClass('min_right_column_reverse');
+			$(this).addClass('min_right_column_normal');	
+			// for the left column
+			$('#left_column').removeClass('left_column_full');
+			$('.text').removeClass('text_full');
+			$('.story_right_column').removeClass('text_full');
+		}
+	});
+	var searching_results = new Array();
+	$("#status_input").autocomplete( searching_results , {
+		multiple: true,
+		multipleSeparator: " ",
+		scroll: true
+	});	
+	$("#main_search").autocomplete( searching_results , {
+		multiple: true,
+		multipleSeparator: " ",
+		scroll: true
+	});		
+	$('#status_input').focus(function(){ 
+		if($(this).val() === ''){
+			$(this).animate({
+					height: '70'
+				}, 800, function() {
+					// Animation complete.
+			});
+		}	
+		$('#status_options_file').slideToggle('fast');
+	});
+	$('#status_input').blur(function(){ 
+		/*if($(this).val() === ''){
+			$(this).animate({
+					height: '20'
+				}, 800, function() {
+					// Animation complete.
+			});
+		}
+		$('#status_options_file').slideToggle('fast');
+		*/
+	});	
+	$('.story_comment_textarea').live('focus',function(){ 
+		if($(this).val() === ''){
+			$(this).animate({
+					height: '50'
+				}, 800, function() {
+					// Animation complete.
+			});
+		}							  
+	});
+	$('.story_comment_textarea').live('blur',function(){ 
+		if($(this).val() === ''){
+			$(this).animate({
+					height: '20'
+				}, 800, function() {
+					// Animation complete.
+			});
+		}
+	});	
+	$('.show_comment').live('click',function(){
+		var feed = $(this).attr('title');
+		$('#comment_area_'+feed).slideToggle('fast');
+		return false;
+	});
+	$('#logo').click(function(){
+		window.location.href = "";
+		return false;
+	});
+	$('#form_status').submit(function(){
+		$.ajax({
+			type: 'GET',
+			url: 'LINKTOFILE.php',
+			data: $(this).serialize(),
+			dataType : 'json',
+			beforeSend:function(){
+				//$('#update span').html(befpreMsg);
+				$('#status_input').blur();
+			},
+			success:function(data){
+				if( data.error === false){
+					//Success
+					$('#listing').prepend(data.toprint);
+					// Check if it is full screen
+					if( $('#left_column').hasClass('left_column_full') ){
+						$('.text').addClass('text_full');
+						$('.story_right_column').addClass('text_full');	
+					}
+					$('#status_input').val('');
+					$('#status_file_name').html('');
+					$('#status_file_temp_name').val('');
+					$('#status_input').focus();
+				}
+				if(data.error === true){
+					//$('#update span').html(errorMsg);
+					//results = false;
+					alert("Message has not been added");
+				}
+			},
+			error:function(data){
+				//$('#update span').html(errorMsg);
+				//results = false;
+			}
+		});	
+		return false
+	});
+	$('.comments_form').submit(function(){
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: $(this).serialize(),
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			//Success
+			//$('#update span').html(successMsg);
+			//results = true;
+			$('#comment_field_'+data.id_feed).val(''); 
+			$('#placing_'+data.id_feed).append(data.toprint);
+			$('#comment_field_'+data.id_feed).animate({
+					height: '20'
+				}, 400, function() {
+					// Animation complete.
+			});
+		}
+		if(data.error === true){
+			//$('#update span').html(errorMsg);
+			//results = false;
+			alert("Message has not been added");
+		}
+	},
+	error:function(data){
+		//$('#update span').html(errorMsg);
+		//results = false;
+	}
+		return false
+	});	
+	$('.add_network').live('click',function(){
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: { 'actions' : 'add_network' , 'new_id_user' : $(this).attr('title') },
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			//Success
+			//$('#update span').html(successMsg);
+			//results = true;
+			alert('Friend has been added to your network');
+		}
+		if(data.error === true){
+			//$('#update span').html(errorMsg);
+			//results = false;
+			alert("Message has not been added");
+		}
+	},
+	error:function(data){
+		//$('#update span').html(errorMsg);
+		//results = false;
+	}
+		return false
+	});	
+	$('.remove_network').live('click',function(){
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: { 'actions' : 'remove_network' , 'new_id_user' : $(this).attr('title') },
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			window.location.href = "";
+		}
+		if(data.error === true){
+			alert("Message has not been added");
+		}
+	},
+	error:function(data){
+	}
+		return false
+	});	
+	$('#main_search').focus(function(){
+			var value = $(this).val();
+			var title = 'Search';
+			if( value === title ){
+				$(this).val('');
+			}
+	});
+	$('#form_register').submit(function(){
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: $(this).serialize(),
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			//Success
+			//$('#update span').html(successMsg);
+			//results = true;
+			window.location.href = "";
+		}
+		if(data.error === true){
+			//$('#update span').html(errorMsg);
+			//results = false;
+			alert("You have not been registered");
+		}
+	},
+	error:function(data){
+		//$('#update span').html(errorMsg);
+		//results = false;
+	}
+	return false;
+	});  // END OF THE LOGIN 
+	$('#profile_update').submit(function(){
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: $(this).serialize(),
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			//Success
+			//$('#update span').html(successMsg);
+			//results = true;
+			window.location.href = "";
+		}
+		if(data.error === true){
+			//$('#update span').html(errorMsg);
+			//results = false;
+			alert("You have not been registered");
+		}
+	},
+	error:function(data){
+		//$('#update span').html(errorMsg);
+		//results = false;
+	}
+	return false;
+	});  // END OF THE LOGIN    
+	$('#profile_update_pwd').submit(function(){
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: $(this).serialize(),
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			//Success
+			$('#field_pwd').val('');
+			$('#field_cpwd').val('');
+		}
+		if(data.error === true){
+			//$('#update span').html(errorMsg);
+			//results = false;
+			alert("Password has not been changed");
+		}
+	},
+	error:function(data){
+		//$('#update span').html(errorMsg);
+		//results = false;
+	}
+	return false;
+	});  // END OF THE LOGIN    profile_update_pwd
+	$('#share_email').submit(function(){
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: $(this).serialize(),
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			$('#share_email').fadeOut('fast');
+			$('#share_email_response').fadeIn('fast');
+		}
+		if(data.error === true){
+			//$('#update span').html(errorMsg);
+			//results = false;
+			alert("There was an error.  No email has been sent.");
+		}
+	},
+	error:function(data){
+		//$('#update span').html(errorMsg);
+		//results = false;
+	}
+	return false;
+	});  // END OF THE LOGIN 
+	$('.todo_status').live('click',function(){
+		var value = $(this).is(':checked'); 
+		if(value === true ){ value = 1; } else { value = 2; }
+		var id_feed = $(this).val(); 
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: { 'actions' : 'update_todo_status' , 'id_feed' : id_feed , 'value' : value },
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			if(value == 1){
+				$('#text_'+id_feed).addClass('strikethrough');
+			}
+			if(value == 2){
+				$('#text_'+id_feed).removeClass('strikethrough');
+			}
+		}
+		if(data.error === true){
+			//$('#update span').html(errorMsg);
+			//results = false;
+			alert("Update has not been completed");
+		}
+	},
+	error:function(data){
+		//$('#update span').html(errorMsg);
+		//results = false;
+	}
+	});  // END OF THE LOGIN 	
+	$('.todo_status_module').live('click',function(){
+		var value = $(this).is(':checked'); 
+		if(value === true ){ value = 1; } else { value = 2; }
+		var id_feed = $(this).val(); 
+		var thing = $(this).parent('li');
+	type: 'GET',
+	url: 'LINKTOFILE.php',
+	data: { 'actions' : 'update_todo_status' , 'id_feed' : id_feed , 'value' : value },
+	dataType : 'json',
+	beforeSend:function(){
+		//$('#update span').html(befpreMsg);
+	},
+	success:function(data){
+		if( data.error === false){
+			if(value == 1){
+				$(thing).addClass('strikethrough');
+			}
+			if(value == 2){
+				$(thing).removeClass('strikethrough');
+			}
+		}
+		if(data.error === true){
+			//$('#update span').html(errorMsg);
+			//results = false;
+			alert("Update has not been completed");
+		}
+	},
+	error:function(data){
+		//$('#update span').html(errorMsg);
+		//results = false;
+	}
+	});  // END OF THE LOGIN 	
+	$('.remove_feed').live('click',function(){
+		var id_feed = $(this).attr('id');
+		var confirm_delete = confirm("Are you sure you want to delete this post?");
+		if(!confirm_delete){ return false; }
+		$.ajax({
+			type: 'GET',
+			url: 'LINKTOFILE.php',
+			data: { 'actions' : 'remove_status' , 'id_feed' : id_feed },
+			dataType : 'json',
+			beforeSend:function(){
+				//$('#update span').html(befpreMsg);
+			},
+			success:function(data){
+				if( data.error === false){
+					$('#story_box_'+id_feed).fadeOut('fast');
+				}
+				if(data.error === true){
+					//$('#update span').html(errorMsg);
+					//results = false;
+					alert("Update has not been removed");
+				}
+			},
+			error:function(data){
+				//$('#update span').html(errorMsg);
+				//results = false;
+			}
+		});	
+		return false;
+	});  // END OF THE LOGIN 		
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/changelog.txt	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,27 @@
+* Added matchContains: "word" option, match only the start of words instead of everywhere
+* Fixed mustMatch to trigger result event when no match was found
+* Fixed the issue where an autocomplete was applied after the field had focus
+* Extended multiple complete to enable editing words not at the end of the field (doesn't work in Opera)
+* Fixed missing semicolon
+* Fixed element creation (<ul> to <ul/> and <li> to </li>)
+* Fixed ac_even class (was ac_event)
+* Fixed bgiframe usage: now its really optional
+* Removed the blur-on-return workaround, added a less obtrusive one only for Opera
+* Fixed hold cursor keys: Opera needs keypress, everyone else keydown to scroll through result list when holding cursor key
+* Updated package to jQuery 1.2.5, removing dimensions
+* Fixed multiple-mustMatch: Remove only the last term when no match is found
+* Fixed multiple without mustMatch: Don't select the last active when no match is found (on tab/return)
+* Fixed multiple cursor position: Put cursor at end of input after selecting a value
+* First release.
\ No newline at end of file
Binary file src/main/resources/a_js/jquery-autocomplete/demo/bg.gif has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/emails.php	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,27 @@
+$q = strtolower($_GET["q"]);
+if (!$q) return;
+$items = array(
+	"Peter Pan"=>"[email protected]",
+	"Molly"=>"[email protected]",
+	"Forneria Marconi"=>"[email protected]",
+	"Master Sync"=>"[email protected]",
+	"Dr. Tech de Log"=>"[email protected]",
+	"Don Corleone"=>"[email protected]",
+	"Mc Chick"=>"[email protected]",
+	"Donnie Darko"=>"[email protected]",
+	"Quake The Net"=>"[email protected]",
+	"Dr. Write"=>"[email protected]"
+$result = array();
+foreach ($items as $key=>$value) {
+	if (strpos(strtolower($key), $q) !== false) {
+		array_push($result, array(
+			"name" => $key,
+			"to" => $value
+		));
+	}
+echo json_encode($result);
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/emails.phps	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,27 @@
+$q = strtolower($_GET["q"]);
+if (!$q) return;
+$items = array(
+	"Peter Pan"=>"[email protected]",
+	"Molly"=>"[email protected]",
+	"Forneria Marconi"=>"[email protected]",
+	"Master Sync"=>"[email protected]",
+	"Dr. Tech de Log"=>"[email protected]",
+	"Don Corleone"=>"[email protected]",
+	"Mc Chick"=>"[email protected]",
+	"Donnie Darko"=>"[email protected]ift.info",
+	"Quake The Net"=>"[email protected]",
+	"Dr. Write"=>"[email protected]"
+$result = array();
+foreach ($items as $key=>$value) {
+	if (strpos(strtolower($key), $q) !== false) {
+		array_push($result, array(
+			"name" => $key,
+			"to" => $value
+		));
+	}
+echo json_encode($result);
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/images.php	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,9 @@
+$term = $_REQUEST['q'];
+$images = array_slice(scandir("images"), 2);
+foreach($images as $value) {
+	if( strpos(strtolower($value), $term) === 0 ) {
+		echo $value . "\n";
+	}
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/index.html	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,272 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN" "http://www.w3.org/TR/html4/strict.dtd">
+<title>jQuery Autocomplete Plugin</title>
+<script type="text/javascript" src="../lib/jquery.js"></script>
+<script type='text/javascript' src='../lib/jquery.bgiframe.min.js'></script>
+<script type='text/javascript' src='../lib/jquery.ajaxQueue.js'></script>
+<script type='text/javascript' src='../lib/thickbox-compressed.js'></script>
+<script type='text/javascript' src='../jquery.autocomplete.js'></script>
+<script type='text/javascript' src='localdata.js'></script>
+<link rel="stylesheet" type="text/css" href="main.css" />
+<link rel="stylesheet" type="text/css" href="../jquery.autocomplete.css" />
+<link rel="stylesheet" type="text/css" href="../lib/thickbox.css" />
+<script type="text/javascript">
+$().ready(function() {
+	function log(event, data, formatted) {
+		$("<li>").html( !data ? "No match!" : "Selected: " + formatted).appendTo("#result");
+	}
+	function formatItem(row) {
+		return row[0] + " (<strong>id: " + row[1] + "</strong>)";
+	}
+	function formatResult(row) {
+		return row[0].replace(/(<.+?>)/gi, '');
+	}
+	$("#suggest1").focus().autocomplete(cities);
+	$("#month").autocomplete(months, {
+		minChars: 0,
+		max: 12,
+		autoFill: true,
+		mustMatch: true,
+		matchContains: false,
+		scrollHeight: 220,
+		formatItem: function(data, i, total) {
+			// don't show the current month in the list of values (for whatever reason)
+			if ( data[0] == months[new Date().getMonth()] ) 
+				return false;
+			return data[0];
+		}
+	});
+	$("#suggest13").autocomplete(emails, {
+		minChars: 0,
+		width: 310,
+		matchContains: "word",
+		autoFill: false,
+		formatItem: function(row, i, max) {
+			return i + "/" + max + ": \"" + row.name + "\" [" + row.to + "]";
+		},
+		formatMatch: function(row, i, max) {
+			return row.name + " " + row.to;
+		},
+		formatResult: function(row) {
+			return row.to;
+		}
+	});
+	$("#singleBirdRemote").autocomplete("search.php", {
+		width: 260,
+		selectFirst: false
+	});
+	$("#suggest14").autocomplete(cities, {
+		matchContains: true,
+		minChars: 0
+	});
+	$("#suggest3").autocomplete(cities, {
+		multiple: true,
+		mustMatch: true,
+		autoFill: true
+	});
+	$("#suggest4").autocomplete('search.php', {
+		width: 300,
+		multiple: true,
+		matchContains: true,
+		formatItem: formatItem,
+		formatResult: formatResult
+	});
+	$("#imageSearch").autocomplete("images.php", {
+		width: 320,
+		max: 4,
+		highlight: false,
+		scroll: true,
+		scrollHeight: 300,
+		formatItem: function(data, i, n, value) {
+			return "<img src='images/" + value + "'/> " + value.split(".")[0];
+		},
+		formatResult: function(data, value) {
+			return value.split(".")[0];
+		}
+	});
+	$("#tags").autocomplete(["c++", "java", "php", "coldfusion", "javascript", "asp", "ruby", "python", "c", "scala", "groovy", "haskell", "pearl"], {
+		width: 320,
+		max: 4,
+		highlight: false,
+		multiple: true,
+		multipleSeparator: " ",
+		scroll: true,
+		scrollHeight: 300
+	});
+	$(":text, textarea").result(log).next().click(function() {
+		$(this).prev().search();
+	});
+	$("#singleBirdRemote").result(function(event, data, formatted) {
+		if (data)
+			$(this).parent().next().find("input").val(data[1]);
+	});
+	$("#suggest4").result(function(event, data, formatted) {
+		var hidden = $(this).parent().next().find(">:input");
+		hidden.val( (hidden.val() ? hidden.val() + ";" : hidden.val()) + data[1]);
+	});
+    $("#suggest15").autocomplete(cities, { scroll: true } );
+	$("#scrollChange").click(changeScrollHeight);
+	$("#thickboxEmail").autocomplete(emails, {
+		minChars: 0,
+		width: 310,
+		matchContains: true,
+		highlightItem: false,
+		formatItem: function(row, i, max, term) {
+			return row.name.replace(new RegExp("(" + term + ")", "gi"), "<strong>$1</strong>") + "<br><span style='font-size: 80%;'>Email: &lt;" + row.to + "&gt;</span>";
+		},
+		formatResult: function(row) {
+			return row.to;
+		}
+	});
+	$("#clear").click(function() {
+		$(":input").unautocomplete();
+	});
+function changeOptions(){
+	var max = parseInt(window.prompt('Please type number of items to display:', jQuery.Autocompleter.defaults.max));
+	if (max > 0) {
+		$("#suggest1").setOptions({
+			max: max
+		});
+	}
+function changeScrollHeight() {
+    var h = parseInt(window.prompt('Please type new scroll height (number in pixels):', jQuery.Autocompleter.defaults.scrollHeight));
+    if(h > 0) {
+        $("#suggest1").setOptions({
+			scrollHeight: h
+		});
+    }
+function changeToMonths(){
+	$("#suggest1")
+		// clear existing data
+		.val("")
+		// change the local data to months
+		.setOptions({data: months})
+		// get the label tag
+		.prev()
+		// update the label tag
+		.text("Month (local):");
+<h1 id="banner"><a href="http://bassistance.de/jquery-plugins/jquery-plugin-autocomplete/">jQuery Autocomplete Plugin</a> Demo</h1>
+<div id="content">
+	<form autocomplete="off">
+		<p>
+			<label>Single City (local):</label>
+			<input type="text" id="suggest1" />
+			<input type="button" value="Get Value" />
+			<input type="button" value="Change Max Items" onclick="changeOptions();" />
+			<input type="button" value="Change to Month Data" onclick="changeToMonths();" />
+			<input type="button" value="Change scroll height" id="scrollChange" />
+		</p>
+		<p>
+			<label>Month (local):</label>
+			<input type="text" id="month" />
+			<input type="button" value="Get Value" />
+			(Current month is excluded from list)
+		</p>
+		<p>
+			<label>E-Mail (local):</label>
+			<input type="text" id="suggest13" />
+			<input type="button" value="Get Value" />
+		</p>
+		<p>
+			<label>Single Bird (remote):</label>
+			<input type="text" id="singleBirdRemote" />
+			<input type="button" value="Get Value" />
+		</p>
+		<p>
+			<label>Hidden input</label>
+			<input />
+		</p>
+		<p>
+			<label>Single City (contains):</label>
+			<input type="text" id="suggest14" />
+			<input type="button" value="Get Value" />
+		</p>
+		<p>
+			<label>Multiple Cities (local):</label>
+			<textarea id='suggest3' cols='40' rows='3'></textarea>
+			<input type="button" value="Get Value" />
+		</p>
+		<p>
+			<label>Multiple Birds (remote):</label>
+			<textarea id='suggest4'></textarea>
+			<input type="button" value="Get Value" />
+		</p>
+		<p>
+			<label>Hidden input</label>
+			<textarea></textarea>
+		</p>
+    <p>
+			<label>Image search (remote):</label>
+			<input type="text" id='imageSearch' />
+			<input type="button" value="Get Value" />
+		</p>
+    <p>
+			<label>Tags (local):</label>
+			<input type="text" id='tags' />
+			<input type="button" value="Get Value" />
+		</p>
+		<p>
+			<label>Some dropdown (&lt;3 IE):</label>
+			<select>
+				<option value="">Item 12334455</option>
+				<option value="2">Item 2</option>
+				<option value="3">Item 3</option>
+				<option value="4">Item 4</option>
+			</select>
+		</p>
+		<input type="submit" value="Submit" />
+	</form>
+	<p>
+		<a href="#TB_inline?height=155&width=400&inlineId=modalWindow" class="thickbox">Click here for an autocomplete inside a thickbox window.</a> (this should work even if it is beyond the fold)
+	</p>		
+	<div id="modalWindow" style="display: none;">
+                <p>
+                        <label>E-Mail (local):</label>
+                        <input type="text" id="thickboxEmail" />
+                        <input type="button" value="Get Value" />
+                </p>
+		</div>
+	<button id="clear">Remove all autocompletes</button>
+	<a href="search.phps">PHP script used to for remote autocomplete</a>
+	<h3>Result:</h3> <ol id="result"></ol>
+<script src="http://www.google-analytics.com/urchin.js" type="text/javascript">
+<script type="text/javascript">
+_uacct = "UA-2623402-1";
Binary file src/main/resources/a_js/jquery-autocomplete/demo/indicator.gif has changed
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/json.html	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,69 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN" "http://www.w3.org/TR/html4/strict.dtd">
+<title>jQuery Autocomplete Plugin</title>
+<script type="text/javascript" src="../lib/jquery.js"></script>
+<script type='text/javascript' src='../lib/jquery.bgiframe.min.js'></script>
+<script type='text/javascript' src='../lib/jquery.ajaxQueue.js'></script>
+<script type='text/javascript' src='../lib/thickbox-compressed.js'></script>
+<script type='text/javascript' src='../jquery.autocomplete.js'></script>
+<script type='text/javascript' src='localdata.js'></script>
+<link rel="stylesheet" type="text/css" href="main.css" />
+<link rel="stylesheet" type="text/css" href="../jquery.autocomplete.css" />
+<link rel="stylesheet" type="text/css" href="../lib/thickbox.css" />
+<script type="text/javascript">
+$(function() {
+	function format(mail) {
+		return mail.name + " &lt;" + mail.to + "&gt";
+	}
+	$("#email").autocomplete('emails.php', {
+		multiple: true,
+		dataType: "json",
+		parse: function(data) {
+			return $.map(data, function(row) {
+				return {
+					data: row,
+					value: row.name,
+					result: row.name + " <" + row.to + ">"
+				}
+			});
+		},
+		formatItem: function(item) {
+			return format(item);
+		}
+	}).result(function(e, item) {
+		$("#content").append("<p>selected " + format(item) + "</p>");
+	});
+<h1 id="banner"><a href="http://bassistance.de/jquery-plugins/jquery-plugin-autocomplete/">jQuery Autocomplete Plugin</a> Demo</h1>
+<div id="content">
+	<form autocomplete="off">
+		<p>
+			<label>E-Mail (remote json):</label>
+			<textarea cols="120" id="email"></textarea>
+		</p>
+		<input type="submit" value="Submit" />
+	</form>
+	<a href="emails.phps">Server-side script creating the JSON data</a>
+<script src="http://www.google-analytics.com/urchin.js" type="text/javascript">
+<script type="text/javascript">
+_uacct = "UA-2623402-1";
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/localdata.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,216 @@
+var months = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'];
+var emails = [
+	{ name: "Peter Pan", to: "[email protected]" },
+	{ name: "Molly", to: "[email protected]" },
+	{ name: "Forneria Marconi", to: "[email protected]" },
+	{ name: "Master <em>Sync</em>", to: "[email protected]" },
+	{ name: "Dr. <strong>Tech</strong> de Log", to: "[email protected]" },
+	{ name: "Don Corleone", to: "[email protected]" },
+	{ name: "Mc Chick", to: "[email protected]" },
+	{ name: "Donnie Darko", to: "[email protected]" },
+	{ name: "Quake The Net", to: "[email protected]" },
+	{ name: "Dr. Write", to: "[email protected]" }
+var cities = [
+	"Aberdeen", "Ada", "Adamsville", "Addyston", "Adelphi", "Adena", "Adrian", "Akron",
+	"Albany", "Alexandria", "Alger", "Alledonia", "Alliance", "Alpha", "Alvada",
+	"Alvordton", "Amanda", "Amelia", "Amesville", "Amherst", "Amlin", "Amsden",
+	"Amsterdam", "Andover", "Anna", "Ansonia", "Antwerp", "Apple Creek", "Arcadia",
+	"Arcanum", "Archbold", "Arlington", "Ashland", "Ashley", "Ashtabula", "Ashville",
+	"Athens", "Attica", "Atwater", "Augusta", "Aurora", "Austinburg", "Ava", "Avon",
+	"Avon Lake", "Bainbridge", "Bakersville", "Baltic", "Baltimore", "Bannock",
+	"Barberton", "Barlow", "Barnesville", "Bartlett", "Barton", "Bascom", "Batavia",
+	"Bath", "Bay Village", "Beach City", "Beachwood", "Beallsville", "Beaver",
+	"Beaverdam", "Bedford", "Bellaire", "Bellbrook", "Belle Center", "Belle Valley",
+	"Bellefontaine", "Bellevue", "Bellville", "Belmont", "Belmore", "Beloit", "Belpre",
+	"Benton Ridge", "Bentonville", "Berea", "Bergholz", "Berkey", "Berlin",
+	"Berlin Center", "Berlin Heights", "Bethel", "Bethesda", "Bettsville", "Beverly",
+	"Bidwell", "Big Prairie", "Birmingham", "Blacklick", "Bladensburg", "Blaine",
+	"Blakeslee", "Blanchester", "Blissfield", "Bloomdale", "Bloomingburg",
+	"Bloomingdale", "Bloomville", "Blue Creek", "Blue Rock", "Bluffton",
+	"Bolivar", "Botkins", "Bourneville", "Bowerston", "Bowersville",
+	"Bowling Green", "Bradford", "Bradner", "Brady Lake", "Brecksville",
+	"Bremen", "Brewster", "Brice", "Bridgeport", "Brilliant", "Brinkhaven",
+	"Bristolville", "Broadview Heights", "Broadway", "Brookfield", "Brookpark",
+	"Brookville", "Brownsville", "Brunswick", "Bryan", "Buchtel", "Buckeye Lake",
+	"Buckland", "Bucyrus", "Buffalo", "Buford", "Burbank", "Burghill", "Burgoon",
+	"Burkettsville", "Burton", "Butler", "Byesville", "Cable", "Cadiz", "Cairo",
+	"Caldwell", "Caledonia", "Cambridge", "Camden", "Cameron", "Camp Dennison",
+	"Campbell", "Canal Fulton", "Canal Winchester", "Canfield", "Canton", "Carbon Hill",
+	"Carbondale", "Cardington", "Carey", "Carroll", "Carrollton", "Casstown",
+	"Castalia", "Catawba", "Cecil", "Cedarville", "Celina", "Centerburg",
+	"Chagrin Falls", "Chandlersville", "Chardon", "Charm", "Chatfield", "Chauncey",
+	"Cherry Fork", "Chesapeake", "Cheshire", "Chester", "Chesterhill", "Chesterland",
+	"Chesterville", "Chickasaw", "Chillicothe", "Chilo", "Chippewa Lake",
+	"Christiansburg", "Cincinnati", "Circleville", "Clarington", "Clarksburg",
+	"Clarksville", "Clay Center", "Clayton", "Cleveland", "Cleves", "Clifton",
+	"Clinton", "Cloverdale", "Clyde", "Coal Run", "Coalton", "Coldwater", "Colerain",
+	"College Corner", "Collins", "Collinsville", "Colton", "Columbia Station",
+	"Columbiana", "Columbus", "Columbus Grove", "Commercial Point", "Conesville",
+	"Conneaut", "Conover", "Continental", "Convoy", "Coolville", "Corning", "Cortland",
+	"Coshocton", "Covington", "Creola", "Crestline", "Creston", "Crooksville",
+	"Croton", "Crown City", "Cuba", "Cumberland", "Curtice", "Custar", "Cutler",
+	"Cuyahoga Falls", "Cygnet", "Cynthiana", "Dalton", "Damascus", "Danville",
+	"Dayton", "De Graff", "Decatur", "Deerfield", "Deersville", "Defiance",
+	"Delaware", "Dellroy", "Delphos", "Delta", "Dennison", "Derby", "Derwent",
+	"Deshler", "Dexter City", "Diamond", "Dillonvale", "Dola", "Donnelsville",
+	"Dorset", "Dover", "Doylestown", "Dresden", "Dublin", "Dunbridge", "Duncan Falls",
+	"Dundee", "Dunkirk", "Dupont", "East Claridon", "East Fultonham",
+	"East Liberty", "East Liverpool", "East Palestine", "East Rochester",
+	"East Sparta", "East Springfield", "Eastlake", "Eaton", "Edgerton", "Edison",
+	"Edon", "Eldorado", "Elgin", "Elkton", "Ellsworth", "Elmore", "Elyria",
+	"Empire", "Englewood", "Enon", "Etna", "Euclid", "Evansport", "Fairborn",
+	"Fairfield", "Fairpoint", "Fairview", "Farmdale", "Farmer", "Farmersville",
+	"Fayette", "Fayetteville", "Feesburg", "Felicity", "Findlay", "Flat Rock",
+	"Fleming", "Fletcher", "Flushing", "Forest", "Fort Jennings", "Fort Loramie",
+	"Fort Recovery", "Fostoria", "Fowler", "Frankfort", "Franklin",
+	"Franklin Furnace", "Frazeysburg", "Fredericksburg", "Fredericktown",
+	"Freeport", "Fremont", "Fresno", "Friendship", "Fulton", "Fultonham",
+	"Galena", "Galion", "Gallipolis", "Galloway", "Gambier", "Garrettsville",
+	"Gates Mills", "Geneva", "Genoa", "Georgetown", "Germantown", "Gettysburg",
+	"Gibsonburg", "Girard", "Glandorf", "Glencoe", "Glenford", "Glenmont",
+	"Glouster", "Gnadenhutten", "Gomer", "Goshen", "Grafton", "Grand Rapids",
+	"Grand River", "Granville", "Gratiot", "Gratis", "Graysville", "Graytown",
+	"Green", "Green Camp", "Green Springs", "Greenfield", "Greenford",
+	"Greentown", "Greenville", "Greenwich", "Grelton", "Grove City",
+	"Groveport", "Grover Hill", "Guysville", "Gypsum", "Hallsville",
+	"Hamden", "Hamersville", "Hamilton", "Hamler", "Hammondsville",
+	"Hannibal", "Hanoverton", "Harbor View", "Harlem Springs", "Harpster",
+	"Harrisburg", "Harrison", "Harrisville", "Harrod", "Hartford", "Hartville",
+	"Harveysburg", "Haskins", "Haverhill", "Haviland", "Haydenville", "Hayesville",
+	"Heath", "Hebron", "Helena", "Hicksville", "Higginsport", "Highland", "Hilliard",
+	"Hillsboro", "Hinckley", "Hiram", "Hockingport", "Holgate", "Holland",
+	"Hollansburg", "Holloway", "Holmesville", "Homer", "Homerville", "Homeworth",
+	"Hooven", "Hopedale", "Hopewell", "Houston", "Howard", "Hoytville", "Hubbard",
+	"Hudson", "Huntsburg", "Huntsville", "Huron", "Iberia", "Independence",
+	"Irondale", "Ironton", "Irwin", "Isle Saint George", "Jackson", "Jackson Center",
+	"Jacksontown", "Jacksonville", "Jacobsburg", "Jamestown", "Jasper",
+	"Jefferson", "Jeffersonville", "Jenera", "Jeromesville", "Jerry City",
+	"Jerusalem", "Jewell", "Jewett", "Johnstown", "Junction City", "Kalida",
+	"Kansas", "Keene", "Kelleys Island", "Kensington", "Kent", "Kenton",
+	"Kerr", "Kettlersville", "Kidron", "Kilbourne", "Killbuck", "Kimbolton",
+	"Kings Mills", "Kingston", "Kingsville", "Kinsman", "Kipling", "Kipton",
+	"Kirby", "Kirkersville", "Kitts Hill", "Kunkle", "La Rue", "Lacarne",
+	"Lafayette", "Lafferty", "Lagrange", "Laings", "Lake Milton", "Lakemore",
+	"Lakeside Marblehead", "Lakeview", "Lakeville", "Lakewood", "Lancaster",
+	"Langsville", "Lansing", "Latham", "Latty", "Laura", "Laurelville",
+	"Leavittsburg", "Lebanon", "Lees Creek", "Leesburg", "Leesville",
+	"Leetonia", "Leipsic", "Lemoyne", "Lewis Center", "Lewisburg",
+	"Lewistown", "Lewisville", "Liberty Center", "Lima", "Limaville",
+	"Lindsey", "Lisbon", "Litchfield", "Lithopolis", "Little Hocking",
+	"Lockbourne", "Lodi", "Logan", "London", "Londonderry",
+	"Long Bottom", "Lorain", "Lore City", "Loudonville", "Louisville",
+	"Loveland", "Lowell", "Lowellville", "Lower Salem", "Lucas",
+	"Lucasville", "Luckey", "Ludlow Falls", "Lynchburg", "Lynx",
+	"Lyons", "Macedonia", "Macksburg", "Madison", "Magnetic Springs",
+	"Magnolia", "Maineville", "Malaga", "Malinta", "Malta", "Malvern",
+	"Manchester", "Mansfield", "Mantua", "Maple Heights", "Maplewood",
+	"Marathon", "Marengo", "Maria Stein", "Marietta", "Marion",
+	"Mark Center", "Marshallville", "Martel", "Martin", "Martins Ferry",
+	"Martinsburg", "Martinsville", "Marysville", "Mason", "Massillon",
+	"Masury", "Maumee", "Maximo", "Maynard", "Mc Arthur", "Mc Clure",
+	"Mc Comb", "Mc Connelsville", "Mc Cutchenville", "Mc Dermott",
+	"Mc Donald", "Mc Guffey", "Mechanicsburg", "Mechanicstown",
+	"Medina", "Medway", "Melmore", "Melrose", "Mendon", "Mentor",
+	"Mesopotamia", "Metamora", "Miamisburg", "Miamitown", "Miamiville",
+	"Middle Bass", "Middle Point", "Middlebranch", "Middleburg",
+	"Middlefield", "Middleport", "Middletown", "Midland", "Midvale",
+	"Milan", "Milford", "Milford Center", "Millbury", "Milledgeville",
+	"Miller City", "Millersburg", "Millersport", "Millfield",
+	"Milton Center", "Mineral City", "Mineral Ridge", "Minerva",
+	"Minford", "Mingo", "Mingo Junction", "Minster", "Mogadore",
+	"Monclova", "Monroe", "Monroeville", "Montezuma", "Montpelier",
+	"Montville", "Morral", "Morristown", "Morrow", "Moscow",
+	"Mount Blanchard", "Mount Cory", "Mount Eaton", "Mount Gilead",
+	"Mount Hope", "Mount Liberty", "Mount Orab", "Mount Perry",
+	"Mount Pleasant", "Mount Saint Joseph", "Mount Sterling",
+	"Mount Vernon", "Mount Victory", "Mowrystown", "Moxahala",
+	"Munroe Falls", "Murray City", "Nankin", "Napoleon", "Nashport",
+	"Nashville", "Navarre", "Neapolis", "Neffs", "Negley",
+	"Nelsonville", "Nevada", "Neville", "New Albany", "New Athens",
+	"New Bavaria", "New Bloomington", "New Bremen", "New Carlisle",
+	"New Concord", "New Hampshire", "New Haven", "New Holland",
+	"New Knoxville", "New Lebanon", "New Lexington", "New London",
+	"New Madison", "New Marshfield", "New Matamoras", "New Middletown",
+	"New Paris", "New Philadelphia", "New Plymouth", "New Richmond",
+	"New Riegel", "New Rumley", "New Springfield", "New Straitsville",
+	"New Vienna", "New Washington", "New Waterford", "New Weston",
+	"Newark", "Newbury", "Newcomerstown", "Newport", "Newton Falls",
+	"Newtonsville", "Ney", "Niles", "North Baltimore", "North Bend",
+	"North Benton", "North Bloomfield", "North Fairfield",
+	"North Georgetown", "North Hampton", "North Jackson",
+	"North Kingsville", "North Lawrence", "North Lewisburg",
+	"North Lima", "North Olmsted", "North Ridgeville", "North Robinson",
+	"North Royalton", "North Star", "Northfield", "Northwood", "Norwalk",
+	"Norwich", "Nova", "Novelty", "Oak Harbor", "Oak Hill", "Oakwood",
+	"Oberlin", "Oceola", "Ohio City", "Okeana", "Okolona", "Old Fort",
+	"Old Washington", "Olmsted Falls", "Ontario", "Orangeville",
+	"Oregon", "Oregonia", "Orient", "Orrville", "Orwell", "Osgood",
+	"Ostrander", "Ottawa", "Ottoville", "Otway", "Overpeck",
+	"Owensville", "Oxford", "Painesville", "Palestine", "Pandora",
+	"Paris", "Parkman", "Pataskala", "Patriot", "Paulding", "Payne",
+	"Pedro", "Peebles", "Pemberton", "Pemberville", "Peninsula",
+	"Perry", "Perrysburg", "Perrysville", "Petersburg", "Pettisville",
+	"Phillipsburg", "Philo", "Pickerington", "Piedmont", "Pierpont",
+	"Piketon", "Piney Fork", "Pioneer", "Piqua", "Pitsburg",
+	"Plain City", "Plainfield", "Pleasant City", "Pleasant Hill",
+	"Pleasant Plain", "Pleasantville", "Plymouth", "Polk",
+	"Pomeroy", "Port Clinton", "Port Jefferson", "Port Washington",
+	"Port William", "Portage", "Portland", "Portsmouth", "Potsdam",
+	"Powell", "Powhatan Point", "Proctorville", "Prospect", "Put in Bay",
+	"Quaker City", "Quincy", "Racine", "Radnor", "Randolph", "Rarden",
+	"Ravenna", "Rawson", "Ray", "Rayland", "Raymond", "Reedsville",
+	"Reesville", "Reno", "Republic", "Reynoldsburg", "Richfield",
+	"Richmond", "Richmond Dale", "Richwood", "Ridgeville Corners",
+	"Ridgeway", "Rio Grande", "Ripley", "Risingsun", "Rittman",
+	"Robertsville", "Rock Camp", "Rock Creek", "Rockbridge", "Rockford",
+	"Rocky Ridge", "Rocky River", "Rogers", "Rome", "Rootstown", "Roseville",
+	"Rosewood", "Ross", "Rossburg", "Rossford", "Roundhead", "Rudolph",
+	"Rushsylvania", "Rushville", "Russells Point", "Russellville", "Russia",
+	"Rutland", "Sabina", "Saint Clairsville", "Saint Henry", "Saint Johns",
+	"Saint Louisville", "Saint Marys", "Saint Paris", "Salem", "Salesville",
+	"Salineville", "Sandusky", "Sandyville", "Sarahsville", "Sardinia",
+	"Sardis", "Savannah", "Scio", "Scioto Furnace", "Scott", "Scottown",
+	"Seaman", "Sebring", "Sedalia", "Senecaville", "Seven Mile", "Seville",
+	"Shade", "Shadyside", "Shandon", "Sharon Center", "Sharpsburg",
+	"Shauck", "Shawnee", "Sheffield Lake", "Shelby", "Sherrodsville",
+	"Sherwood", "Shiloh", "Short Creek", "Shreve", "Sidney", "Sinking Spring",
+	"Smithfield", "Smithville", "Solon", "Somerdale", "Somerset",
+	"Somerville", "South Bloomingville", "South Charleston", "South Lebanon",
+	"South Point", "South Salem", "South Solon", "South Vienna",
+	"South Webster", "Southington", "Sparta", "Spencer", "Spencerville",
+	"Spring Valley", "Springboro", "Springfield", "Stafford", "Sterling",
+	"Steubenville", "Stewart", "Stillwater", "Stockdale", "Stockport",
+	"Stone Creek", "Stony Ridge", "Stout", "Stoutsville", "Stow", "Strasburg",
+	"Stratton", "Streetsboro", "Strongsville", "Struthers", "Stryker",
+	"Sugar Grove", "Sugarcreek", "Sullivan", "Sulphur Springs", "Summerfield",
+	"Summit Station", "Summitville", "Sunbury", "Swanton", "Sycamore",
+	"Sycamore Valley", "Sylvania", "Syracuse", "Tallmadge", "Tarlton",
+	"Terrace Park", "The Plains", "Thompson", "Thornville", "Thurman",
+	"Thurston", "Tiffin", "Tiltonsville", "Tipp City", "Tippecanoe", "Tiro",
+	"Toledo", "Tontogany", "Torch", "Toronto", "Tremont City", "Trenton",
+	"Trimble", "Trinway", "Troy", "Tuppers Plains", "Tuscarawas", "Twinsburg",
+	"Uhrichsville", "Union City", "Union Furnace", "Unionport", "Uniontown",
+	"Unionville", "Unionville Center", "Uniopolis", "Upper Sandusky", "Urbana",
+	"Utica", "Valley City", "Van Buren", "Van Wert", "Vandalia", "Vanlue",
+	"Vaughnsville", "Venedocia", "Vermilion", "Verona", "Versailles",
+	"Vickery", "Vienna", "Vincent", "Vinton", "Wadsworth", "Wakefield",
+	"Wakeman", "Walbridge", "Waldo", "Walhonding", "Walnut Creek", "Wapakoneta",
+	"Warnock", "Warren", "Warsaw", "Washington Court House",
+	"Washingtonville", "Waterford", "Waterloo", "Watertown", "Waterville",
+	"Wauseon", "Waverly", "Wayland", "Wayne", "Waynesburg", "Waynesfield",
+	"Waynesville", "Wellington", "Wellston", "Wellsville", "West Alexandria",
+	"West Chester", "West Elkton", "West Farmington", "West Jefferson",
+	"West Lafayette", "West Liberty", "West Manchester", "West Mansfield",
+	"West Millgrove", "West Milton", "West Point", "West Portsmouth",
+	"West Rushville", "West Salem", "West Union", "West Unity", "Westerville",
+	"Westfield Center", "Westlake", "Weston", "Westville", "Wharton",
+	"Wheelersburg", "Whipple", "White Cottage", "Whitehouse", "Wickliffe",
+	"Wilberforce", "Wilkesville", "Willard", "Williamsburg", "Williamsfield",
+	"Williamsport", "Williamstown", "Williston", "Willoughby", "Willow Wood",
+	"Willshire", "Wilmington", "Wilmot", "Winchester", "Windham", "Windsor",
+	"Winesburg", "Wingett Run", "Winona", "Wolf Run", "Woodsfield",
+	"Woodstock", "Woodville", "Wooster", "Wren", "Xenia", "Yellow Springs",
+	"Yorkshire", "Yorkville", "Youngstown", "Zaleski", "Zanesfield", "Zanesville",
+	"Zoar"
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/main.css	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,53 @@
+body{font:13px arial,helvetica,clean,sans-serif;font-size:small;}
+select,input,textarea{font:99% arial,helvetica,clean,sans-serif}
+pre,code{font:115% monospace;font-size:100%}
+body * {line-height:1.22em}
+body {
+	color: #202020;
+h1 {
+	color: #fff;
+	background: #06b;
+	padding: 10px;
+	font-size: 200%;
+h2 {
+	color: #000;
+	font-size: 150%;
+	padding: 10px 0;
+h3 {
+	color: #000;
+	font-size: 120%;
+	padding: 10px 0;
+ul {
+	list-style: disc inside;
+	margin-left: 1em;
+#content {
+	padding: 10px;
+label {
+	float: left;
+	width: 12em;
+input[type=text] { width: 15em; }
+#banner { padding: 15px; background-color: #06b; color: white; font-size: large; border-bottom: 1px solid #ccc;
+    background: url(bg.gif) repeat-x; text-align: center }
+#banner a { color: white; }
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/search.php	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,578 @@
+$q = strtolower($_GET["q"]);
+if (!$q) return;
+$items = array(
+"Great <em>Bittern</em>"=>"Botaurus stellaris",
+"Little <em>Grebe</em>"=>"Tachybaptus ruficollis",
+"Black-necked Grebe"=>"Podiceps nigricollis",
+"Little Bittern"=>"Ixobrychus minutus",
+"Black-crowned Night Heron"=>"Nycticorax nycticorax",
+"Purple Heron"=>"Ardea purpurea",
+"White Stork"=>"Ciconia ciconia",
+"Spoonbill"=>"Platalea leucorodia",
+"Red-crested Pochard"=>"Netta rufina",
+"Common Eider"=>"Somateria mollissima",
+"Red Kite"=>"Milvus milvus",
+"Hen Harrier"=>"Circus cyaneus",
+"Montagu`s Harrier"=>"Circus pygargus",
+"Black Grouse"=>"Tetrao tetrix",
+"Grey Partridge"=>"Perdix perdix",
+"Spotted Crake"=>"Porzana porzana",
+"Corncrake"=>"Crex crex",
+"Common Crane"=>"Grus grus",
+"Avocet"=>"Recurvirostra avosetta",
+"Stone Curlew"=>"Burhinus oedicnemus",
+"Common Ringed Plover"=>"Charadrius hiaticula",
+"Kentish Plover"=>"Charadrius alexandrinus",
+"Ruff"=>"Philomachus pugnax",
+"Common Snipe"=>"Gallinago gallinago",
+"Black-tailed Godwit"=>"Limosa limosa",
+"Common Redshank"=>"Tringa totanus",
+"Sandwich Tern"=>"Sterna sandvicensis",
+"Common Tern"=>"Sterna hirundo",
+"Arctic Tern"=>"Sterna paradisaea",
+"Little Tern"=>"Sternula albifrons",
+"Black Tern"=>"Chlidonias niger",
+"Barn Owl"=>"Tyto alba",
+"Little Owl"=>"Athene noctua",
+"Short-eared Owl"=>"Asio flammeus",
+"European Nightjar"=>"Caprimulgus europaeus",
+"Common Kingfisher"=>"Alcedo atthis",
+"Eurasian Hoopoe"=>"Upupa epops",
+"Eurasian Wryneck"=>"Jynx torquilla",
+"European Green Woodpecker"=>"Picus viridis",
+"Crested Lark"=>"Galerida cristata",
+"White-headed Duck"=>"Oxyura leucocephala",
+"Pale-bellied Brent Goose"=>"Branta hrota",
+"Tawny Pipit"=>"Anthus campestris",
+"Whinchat"=>"Saxicola rubetra",
+"European Stonechat"=>"Saxicola rubicola",
+"Northern Wheatear"=>"Oenanthe oenanthe",
+"Savi`s Warbler"=>"Locustella luscinioides",
+"Sedge Warbler"=>"Acrocephalus schoenobaenus",
+"Great Reed Warbler"=>"Acrocephalus arundinaceus",
+"Bearded Reedling"=>"Panurus biarmicus",
+"Red-backed Shrike"=>"Lanius collurio",
+"Great Grey Shrike"=>"Lanius excubitor",
+"Woodchat Shrike"=>"Lanius senator",
+"Common Raven"=>"Corvus corax",
+"Yellowhammer"=>"Emberiza citrinella",
+"Ortolan Bunting"=>"Emberiza hortulana",
+"Corn Bunting"=>"Emberiza calandra",
+"Great Cormorant"=>"Phalacrocorax carbo",
+"Hawfinch"=>"Coccothraustes coccothraustes",
+"Common Shelduck"=>"Tadorna tadorna",
+"Bluethroat"=>"Luscinia svecica",
+"Grey Heron"=>"Ardea cinerea",
+"Barn Swallow"=>"Hirundo rustica",
+"Hooded Crow"=>"Corvus cornix",
+"Dunlin"=>"Calidris alpina",
+"Eurasian Pied Flycatcher"=>"Ficedula hypoleuca",
+"Eurasian Nuthatch"=>"Sitta europaea",
+"Short-toed Tree Creeper"=>"Certhia brachydactyla",
+"Wood Lark"=>"Lullula arborea",
+"Tree Pipit"=>"Anthus trivialis",
+"Eurasian Hobby"=>"Falco subbuteo",
+"Marsh Warbler"=>"Acrocephalus palustris",
+"Wood Sandpiper"=>"Tringa glareola",
+"Tawny Owl"=>"Strix aluco",
+"Lesser Whitethroat"=>"Sylvia curruca",
+"Barnacle Goose"=>"Branta leucopsis",
+"Common Goldeneye"=>"Bucephala clangula",
+"Western Marsh Harrier"=>"Circus aeruginosus",
+"Common Buzzard"=>"Buteo buteo",
+"Sanderling"=>"Calidris alba",
+"Little Gull"=>"Larus minutus",
+"Eurasian Magpie"=>"Pica pica",
+"Willow Warbler"=>"Phylloscopus trochilus",
+"Wood Warbler"=>"Phylloscopus sibilatrix",
+"Great Crested Grebe"=>"Podiceps cristatus",
+"Eurasian Jay"=>"Garrulus glandarius",
+"Common Redstart"=>"Phoenicurus phoenicurus",
+"Blue-headed Wagtail"=>"Motacilla flava",
+"Common Swift"=>"Apus apus",
+"Marsh Tit"=>"Poecile palustris",
+"Goldcrest"=>"Regulus regulus",
+"European Golden Plover"=>"Pluvialis apricaria",
+"Eurasian Bullfinch"=>"Pyrrhula pyrrhula",
+"Common Whitethroat"=>"Sylvia communis",
+"Meadow Pipit"=>"Anthus pratensis",
+"Greylag Goose"=>"Anser anser",
+"Spotted Flycatcher"=>"Muscicapa striata",
+"European Greenfinch"=>"Carduelis chloris",
+"Common Greenshank"=>"Tringa nebularia",
+"Great Spotted Woodpecker"=>"Dendrocopos major",
+"Greater Canada Goose"=>"Branta canadensis",
+"Mistle Thrush"=>"Turdus viscivorus",
+"Great Black-backed Gull"=>"Larus marinus",
+"Goosander"=>"Mergus merganser",
+"Great Egret"=>"Casmerodius albus",
+"Northern Goshawk"=>"Accipiter gentilis",
+"Dunnock"=>"Prunella modularis",
+"Stock Dove"=>"Columba oenas",
+"Common Wood Pigeon"=>"Columba palumbus",
+"Eurasian Woodcock"=>"Scolopax rusticola",
+"House Sparrow"=>"Passer domesticus",
+"Common House Martin"=>"Delichon urbicum",
+"Red Knot"=>"Calidris canutus",
+"Western Jackdaw"=>"Corvus monedula",
+"Brambling"=>"Fringilla montifringilla",
+"Northern Lapwing"=>"Vanellus vanellus",
+"European Reed Warbler"=>"Acrocephalus scirpaceus",
+"Lesser Black-backed Gull"=>"Larus fuscus",
+"Little Egret"=>"Egretta garzetta",
+"Little Stint"=>"Calidris minuta",
+"Common Linnet"=>"Carduelis cannabina",
+"Mute Swan"=>"Cygnus olor",
+"Common Cuckoo"=>"Cuculus canorus",
+"Black-headed Gull"=>"Larus ridibundus",
+"Greater White-fronted Goose"=>"Anser albifrons",
+"Great Tit"=>"Parus major",
+"Redwing"=>"Turdus iliacus",
+"Gadwall"=>"Anas strepera",
+"Fieldfare"=>"Turdus pilaris",
+"Tufted Duck"=>"Aythya fuligula",
+"Crested Tit"=>"Lophophanes cristatus",
+"Willow Tit"=>"Poecile montanus",
+"Eurasian Coot"=>"Fulica atra",
+"Common Blackbird"=>"Turdus merula",
+"Smew"=>"Mergus albellus",
+"Common Sandpiper"=>"Actitis hypoleucos",
+"Sand Martin"=>"Riparia riparia",
+"Purple Sandpiper"=>"Calidris maritima",
+"Northern Pintail"=>"Anas acuta",
+"Blue Tit"=>"Cyanistes caeruleus",
+"European Goldfinch"=>"Carduelis carduelis",
+"Eurasian Whimbrel"=>"Numenius phaeopus",
+"Common Reed Bunting"=>"Emberiza schoeniclus",
+"Eurasian Tree Sparrow"=>"Passer montanus",
+"Rook"=>"Corvus frugilegus",
+"European Robin"=>"Erithacus rubecula",
+"Bar-tailed Godwit"=>"Limosa lapponica",
+"Dark-bellied Brent Goose"=>"Branta bernicla",
+"Eurasian Oystercatcher"=>"Haematopus ostralegus",
+"Eurasian Siskin"=>"Carduelis spinus",
+"Northern Shoveler"=>"Anas clypeata",
+"Eurasian Wigeon"=>"Anas penelope",
+"Eurasian Sparrow Hawk"=>"Accipiter nisus",
+"Icterine Warbler"=>"Hippolais icterina",
+"Common Starling"=>"Sturnus vulgaris",
+"Long-tailed Tit"=>"Aegithalos caudatus",
+"Ruddy Turnstone"=>"Arenaria interpres",
+"Mew Gull"=>"Larus canus",
+"Common Pochard"=>"Aythya ferina",
+"Common Chiffchaff"=>"Phylloscopus collybita",
+"Greater Scaup"=>"Aythya marila",
+"Common Kestrel"=>"Falco tinnunculus",
+"Garden Warbler"=>"Sylvia borin",
+"Eurasian Collared Dove"=>"Streptopelia decaocto",
+"Eurasian Skylark"=>"Alauda arvensis",
+"Common Chaffinch"=>"Fringilla coelebs",
+"Common Moorhen"=>"Gallinula chloropus",
+"Water Pipit"=>"Anthus spinoletta",
+"Mallard"=>"Anas platyrhynchos",
+"Winter Wren"=>"Troglodytes troglodytes",
+"Common Teal"=>"Anas crecca",
+"Green Sandpiper"=>"Tringa ochropus",
+"White Wagtail"=>"Motacilla alba",
+"Eurasian Curlew"=>"Numenius arquata",
+"Song Thrush"=>"Turdus philomelos",
+"European Herring Gull"=>"Larus argentatus",
+"Grey Plover"=>"Pluvialis squatarola",
+"Carrion Crow"=>"Corvus corone",
+"Coal Tit"=>"Periparus ater",
+"Spotted Redshank"=>"Tringa erythropus",
+"Blackcap"=>"Sylvia atricapilla",
+"Egyptian Vulture"=>"Neophron percnopterus",
+"Razorbill"=>"Alca torda",
+"Alpine Swift"=>"Apus melba",
+"Long-legged Buzzard"=>"Buteo rufinus",
+"Audouin`s Gull"=>"Larus audouinii",
+"Balearic Shearwater"=>"Puffinus mauretanicus",
+"Upland Sandpiper"=>"Bartramia longicauda",
+"Greater Spotted Eagle"=>"Aquila clanga",
+"Ring Ouzel"=>"Turdus torquatus",
+"Yellow-browed Warbler"=>"Phylloscopus inornatus",
+"Blue Rock Thrush"=>"Monticola solitarius",
+"Buff-breasted Sandpiper"=>"Tryngites subruficollis",
+"Jack Snipe"=>"Lymnocryptes minimus",
+"White-rumped Sandpiper"=>"Calidris fuscicollis",
+"Ruddy Shelduck"=>"Tadorna ferruginea",
+"Cetti's Warbler"=>"Cettia cetti",
+"Citrine Wagtail"=>"Motacilla citreola",
+"Roseate Tern"=>"Sterna dougallii",
+"Black-legged Kittiwake"=>"Rissa tridactyla",
+"Pygmy Cormorant"=>"Phalacrocorax pygmeus",
+"Booted Eagle"=>"Aquila pennata",
+"Lesser White-fronted Goose"=>"Anser erythropus",
+"Little Bunting"=>"Emberiza pusilla",
+"Eleonora's Falcon"=>"Falco eleonorae",
+"European Serin"=>"Serinus serinus",
+"Twite"=>"Carduelis flavirostris",
+"Yellow-legged Gull"=>"Larus michahellis",
+"Gyr Falcon"=>"Falco rusticolus",
+"Greenish Warbler"=>"Phylloscopus trochiloides",
+"Red-necked Phalarope"=>"Phalaropus lobatus",
+"Mealy Redpoll"=>"Carduelis flammea",
+"Glaucous Gull"=>"Larus hyperboreus",
+"Great Skua"=>"Stercorarius skua",
+"Great Bustard"=>"Otis tarda",
+"Velvet Scoter"=>"Melanitta fusca",
+"Pine Grosbeak"=>"Pinicola enucleator",
+"House Crow"=>"Corvus splendens",
+"Hume`s Leaf Warbler"=>"Phylloscopus humei",
+"Great Northern Loon"=>"Gavia immer",
+"Long-tailed Duck"=>"Clangula hyemalis",
+"Lapland Longspur"=>"Calcarius lapponicus",
+"Northern Gannet"=>"Morus bassanus",
+"Eastern Imperial Eagle"=>"Aquila heliaca",
+"Little Auk"=>"Alle alle",
+"Lesser Spotted Woodpecker"=>"Dendrocopos minor",
+"Iceland Gull"=>"Larus glaucoides",
+"Parasitic Jaeger"=>"Stercorarius parasiticus",
+"Bewick`s Swan"=>"Cygnus bewickii",
+"Little Bustard"=>"Tetrax tetrax",
+"Little Crake"=>"Porzana parva",
+"Baillon`s Crake"=>"Porzana pusilla",
+"Long-tailed Jaeger"=>"Stercorarius longicaudus",
+"King Eider"=>"Somateria spectabilis",
+"Greater Short-toed Lark"=>"Calandrella brachydactyla",
+"Houbara Bustard"=>"Chlamydotis undulata",
+"Curlew Sandpiper"=>"Calidris ferruginea",
+"Common Crossbill"=>"Loxia curvirostra",
+"European Shag"=>"Phalacrocorax aristotelis",
+"Horned Grebe"=>"Podiceps auritus",
+"Common Quail"=>"Coturnix coturnix",
+"Bearded Vulture"=>"Gypaetus barbatus",
+"Lanner Falcon"=>"Falco biarmicus",
+"Middle Spotted Woodpecker"=>"Dendrocopos medius",
+"Pomarine Jaeger"=>"Stercorarius pomarinus",
+"Red-breasted Merganser"=>"Mergus serrator",
+"Eurasian Black Vulture"=>"Aegypius monachus",
+"Eurasian Dotterel"=>"Charadrius morinellus",
+"Common Nightingale"=>"Luscinia megarhynchos",
+"Northern willow warbler"=>"Phylloscopus trochilus acredula",
+"Manx Shearwater"=>"Puffinus puffinus",
+"Northern Fulmar"=>"Fulmarus glacialis",
+"Eurasian Eagle Owl"=>"Bubo bubo",
+"Orphean Warbler"=>"Sylvia hortensis",
+"Melodious Warbler"=>"Hippolais polyglotta",
+"Pallas's Leaf Warbler"=>"Phylloscopus proregulus",
+"Atlantic Puffin"=>"Fratercula arctica",
+"Black-throated Loon"=>"Gavia arctica",
+"Bohemian Waxwing"=>"Bombycilla garrulus",
+"Marsh Sandpiper"=>"Tringa stagnatilis",
+"Great Snipe"=>"Gallinago media",
+"Squacco Heron"=>"Ardeola ralloides",
+"Long-eared Owl"=>"Asio otus",
+"Caspian Tern"=>"Hydroprogne caspia",
+"Red-breasted Goose"=>"Branta ruficollis",
+"Red-throated Loon"=>"Gavia stellata",
+"Common Rosefinch"=>"Carpodacus erythrinus",
+"Red-footed Falcon"=>"Falco vespertinus",
+"Ross's Goose"=>"Anser rossii",
+"Red Phalarope"=>"Phalaropus fulicarius",
+"Pied Wagtail"=>"Motacilla yarrellii",
+"Rose-coloured Starling"=>"Sturnus roseus",
+"Rough-legged Buzzard"=>"Buteo lagopus",
+"Saker Falcon"=>"Falco cherrug",
+"European Roller"=>"Coracias garrulus",
+"Short-toed Eagle"=>"Circaetus gallicus",
+"Peregrine Falcon"=>"Falco peregrinus",
+"Merlin"=>"Falco columbarius",
+"Snow Goose"=>"Anser caerulescens",
+"Snowy Owl"=>"Bubo scandiacus",
+"Snow Bunting"=>"Plectrophenax nivalis",
+"Common Grasshopper Warbler"=>"Locustella naevia",
+"Golden Eagle"=>"Aquila chrysaetos",
+"Black-winged Stilt"=>"Himantopus himantopus",
+"Steppe Eagle"=>"Aquila nipalensis",
+"Pallid Harrier"=>"Circus macrourus",
+"European Storm-petrel"=>"Hydrobates pelagicus",
+"Horned Lark"=>"Eremophila alpestris",
+"Eurasian Treecreeper"=>"Certhia familiaris",
+"Taiga Bean Goose"=>"Anser fabalis",
+"Temminck`s Stint"=>"Calidris temminckii",
+"Terek Sandpiper"=>"Xenus cinereus",
+"Tundra Bean Goose"=>"Anser serrirostris",
+"European Turtle Dove"=>"Streptopelia turtur",
+"Leach`s Storm-petrel"=>"Oceanodroma leucorhoa",
+"Eurasian Griffon Vulture"=>"Gyps fulvus",
+"Paddyfield Warbler"=>"Acrocephalus agricola",
+"Osprey"=>"Pandion haliaetus",
+"Firecrest"=>"Regulus ignicapilla",
+"Water Rail"=>"Rallus aquaticus",
+"European Honey Buzzard"=>"Pernis apivorus",
+"Eurasian Golden Oriole"=>"Oriolus oriolus",
+"Whooper Swan"=>"Cygnus cygnus",
+"Two-barred Crossbill"=>"Loxia leucoptera",
+"White-tailed Eagle"=>"Haliaeetus albicilla",
+"Atlantic Murre"=>"Uria aalge",
+"Garganey"=>"Anas querquedula",
+"Black Redstart"=>"Phoenicurus ochruros",
+"Common Scoter"=>"Melanitta nigra",
+"Rock Pipit"=>"Anthus petrosus",
+"Lesser Spotted Eagle"=>"Aquila pomarina",
+"Cattle Egret"=>"Bubulcus ibis",
+"White-winged Black Tern"=>"Chlidonias leucopterus",
+"Black Stork"=>"Ciconia nigra",
+"Mediterranean Gull"=>"Larus melanocephalus",
+"Black Kite"=>"Milvus migrans",
+"Yellow Wagtail"=>"Motacilla flavissima",
+"Red-necked Grebe"=>"Podiceps grisegena",
+"Gull-billed Tern"=>"Gelochelidon nilotica",
+"Pectoral Sandpiper"=>"Calidris melanotos",
+"Barred Warbler"=>"Sylvia nisoria",
+"Red-throated Pipit"=>"Anthus cervinus",
+"Grey Wagtail"=>"Motacilla cinerea",
+"Richard`s Pipit"=>"Anthus richardi",
+"Black Woodpecker"=>"Dryocopus martius",
+"Little Ringed Plover"=>"Charadrius dubius",
+"Whiskered Tern"=>"Chlidonias hybrida",
+"Lesser Redpoll"=>"Carduelis cabaret",
+"Pallas' Bunting"=>"Emberiza pallasi",
+"Ferruginous Duck"=>"Aythya nyroca",
+"Whistling Swan"=>"Cygnus columbianus",
+"Black Brant"=>"Branta nigricans",
+"Marbled Teal"=>"Marmaronetta angustirostris",
+"Canvasback"=>"Aythya valisineria",
+"Redhead"=>"Aythya americana",
+"Lesser Scaup"=>"Aythya affinis",
+"Steller`s Eider"=>"Polysticta stelleri",
+"Spectacled Eider"=>"Somateria fischeri",
+"Harlequin Duck"=>"Histronicus histrionicus",
+"Black Scoter"=>"Melanitta americana",
+"Surf Scoter"=>"Melanitta perspicillata",
+"Barrow`s Goldeneye"=>"Bucephala islandica",
+"Falcated Duck"=>"Anas falcata",
+"American Wigeon"=>"Anas americana",
+"Blue-winged Teal"=>"Anas discors",
+"American Black Duck"=>"Anas rubripes",
+"Baikal Teal"=>"Anas formosa",
+"Green-Winged Teal"=>"Anas carolinensis",
+"Hazel Grouse"=>"Bonasa bonasia",
+"Rock Partridge"=>"Alectoris graeca",
+"Red-legged Partridge"=>"Alectoris rufa",
+"Yellow-billed Loon"=>"Gavia adamsii",
+"Cory`s Shearwater"=>"Calonectris borealis",
+"Madeiran Storm-Petrel"=>"Oceanodroma castro",
+"Great White Pelican"=>"Pelecanus onocrotalus",
+"Dalmatian Pelican"=>"Pelecanus crispus",
+"American Bittern"=>"Botaurus lentiginosus",
+"Glossy Ibis"=>"Plegadis falcinellus",
+"Spanish Imperial Eagle"=>"Aquila adalberti",
+"Lesser Kestrel"=>"Falco naumanni",
+"Houbara Bustard"=>"Chlamydotis undulata",
+"Crab-Plover"=>"Dromas ardeola",
+"Cream-coloured Courser"=>"Cursorius cursor",
+"Collared Pratincole"=>"Glareola pratincola",
+"Black-winged Pratincole"=>"Glareola nordmanni",
+"Killdeer"=>"Charadrius vociferus",
+"Lesser Sand Plover"=>"Charadrius mongolus",
+"Greater Sand Plover"=>"Charadrius leschenaultii",
+"Caspian Plover"=>"Charadrius asiaticus",
+"American Golden Plover"=>"Pluvialis dominica",
+"Pacific Golden Plover"=>"Pluvialis fulva",
+"Sharp-tailed Sandpiper"=>"Calidris acuminata",
+"Broad-billed Sandpiper"=>"Limicola falcinellus",
+"Spoon-Billed Sandpiper"=>"Eurynorhynchus pygmaeus",
+"Short-Billed Dowitcher"=>"Limnodromus griseus",
+"Long-billed Dowitcher"=>"Limnodromus scolopaceus",
+"Hudsonian Godwit"=>"Limosa haemastica",
+"Little Curlew"=>"Numenius minutus",
+"Lesser Yellowlegs"=>"Tringa flavipes",
+"Wilson`s Phalarope"=>"Phalaropus tricolor",
+"Pallas`s Gull"=>"Larus ichthyaetus",
+"Laughing Gull"=>"Larus atricilla",
+"Franklin`s Gull"=>"Larus pipixcan",
+"Bonaparte`s Gull"=>"Larus philadelphia",
+"Ring-billed Gull"=>"Larus delawarensis",
+"American Herring Gull"=>"Larus smithsonianus",
+"Caspian Gull"=>"Larus cachinnans",
+"Ivory Gull"=>"Pagophila eburnea",
+"Royal Tern"=>"Sterna maxima",
+"Brünnich`s Murre"=>"Uria lomvia",
+"Crested Auklet"=>"Aethia cristatella",
+"Parakeet Auklet"=>"Cyclorrhynchus psittacula",
+"Tufted Puffin"=>"Lunda cirrhata",
+"Laughing Dove"=>"Streptopelia senegalensis",
+"Great Spotted Cuckoo"=>"Clamator glandarius",
+"Great Grey Owl"=>"Strix nebulosa",
+"Tengmalm`s Owl"=>"Aegolius funereus",
+"Red-Necked Nightjar"=>"Caprimulgus ruficollis",
+"Chimney Swift"=>"Chaetura pelagica",
+"Green Bea-Eater"=>"Merops orientalis",
+"Grey-headed Woodpecker"=>"Picus canus",
+"Lesser Short-Toed Lark"=>"Calandrella rufescens",
+"Eurasian Crag Martin"=>"Hirundo rupestris",
+"Red-rumped Swallow"=>"Cecropis daurica",
+"Blyth`s Pipit"=>"Anthus godlewskii",
+"Pechora Pipit"=>"Anthus gustavi",
+"Grey-headed Wagtail"=>"Motacilla thunbergi",
+"Yellow-Headed Wagtail"=>"Motacilla lutea",
+"White-throated Dipper"=>"Cinclus cinclus",
+"Rufous-Tailed Scrub Robin"=>"Cercotrichas galactotes",
+"Thrush Nightingale"=>"Luscinia luscinia",
+"White-throated Robin"=>"Irania gutturalis",
+"Caspian Stonechat"=>"Saxicola maura variegata",
+"Western Black-eared Wheatear"=>"Oenanthe hispanica",
+"Rufous-tailed Rock Thrush"=>"Monticola saxatilis",
+"Red-throated Thrush/Black-throated"=>"Turdus ruficollis",
+"American Robin"=>"Turdus migratorius",
+"Zitting Cisticola"=>"Cisticola juncidis",
+"Lanceolated Warbler"=>"Locustella lanceolata",
+"River Warbler"=>"Locustella fluviatilis",
+"Blyth`s Reed Warbler"=>"Acrocephalus dumetorum",
+"Caspian Reed Warbler"=>"Acrocephalus fuscus",
+"Aquatic Warbler"=>"Acrocephalus paludicola",
+"Booted Warbler"=>"Acrocephalus caligatus",
+"Marmora's Warbler"=>"Sylvia sarda",
+"Dartford Warbler"=>"Sylvia undata",
+"Subalpine Warbler"=>"Sylvia cantillans",
+"Ménétries's Warbler"=>"Sylvia mystacea",
+"Rüppel's Warbler"=>"Sylvia rueppelli",
+"Asian Desert Warbler"=>"Sylvia nana",
+"Western Orphean Warbler"=>"Sylvia hortensis hortensis",
+"Arctic Warbler"=>"Phylloscopus borealis",
+"Radde`s Warbler"=>"Phylloscopus schwarzi",
+"Western Bonelli`s Warbler"=>"Phylloscopus bonelli",
+"Red-breasted Flycatcher"=>"Ficedula parva",
+"Eurasian Penduline Tit"=>"Remiz pendulinus",
+"Daurian Shrike"=>"Lanius isabellinus",
+"Long-Tailed Shrike"=>"Lanius schach",
+"Lesser Grey Shrike"=>"Lanius minor",
+"Southern Grey Shrike"=>"Lanius meridionalis",
+"Masked Shrike"=>"Lanius nubicus",
+"Spotted Nutcracker"=>"Nucifraga caryocatactes",
+"Daurian Jackdaw"=>"Corvus dauuricus",
+"Purple-Backed Starling"=>"Sturnus sturninus",
+"Red-Fronted Serin"=>"Serinus pusillus",
+"Arctic Redpoll"=>"Carduelis hornemanni",
+"Scottish Crossbill"=>"Loxia scotica",
+"Parrot Crossbill"=>"Loxia pytyopsittacus",
+"Black-faced Bunting"=>"Emberiza spodocephala",
+"Pink-footed Goose"=>"Anser brachyrhynchus",
+"Black-winged Kite"=>"Elanus caeruleus",
+"European Bee-eater"=>"Merops apiaster",
+"Sabine`s Gull"=>"Larus sabini",
+"Sooty Shearwater"=>"Puffinus griseus",
+"Lesser Canada Goose"=>"Branta hutchinsii",
+"Ring-necked Duck"=>"Aythya collaris",
+"Greater Flamingo"=>"Phoenicopterus roseus",
+"Iberian Chiffchaff"=>"Phylloscopus ibericus",
+"Ashy-headed Wagtail"=>"Motacilla cinereocapilla",
+"Stilt Sandpiper"=>"Calidris himantopus",
+"Siberian Stonechat"=>"Saxicola maurus",
+"Greater Yellowlegs"=>"Tringa melanoleuca",
+"Forster`s Tern"=>"Sterna forsteri",
+"Dusky Warbler"=>"Phylloscopus fuscatus",
+"Cirl Bunting"=>"Emberiza cirlus",
+"Olive-backed Pipit"=>"Anthus hodgsoni",
+"Sociable Lapwing"=>"Vanellus gregarius",
+"Spotted Sandpiper"=>"Actitis macularius",
+"Baird`s Sandpiper"=>"Calidris bairdii",
+"Rustic Bunting"=>"Emberiza rustica",
+"Yellow-browed Bunting"=>"Emberiza chrysophrys",
+"Great Shearwater"=>"Puffinus gravis",
+"Bonelli`s Eagle"=>"Aquila fasciata",
+"Calandra Lark"=>"Melanocorypha calandra",
+"Sardinian Warbler"=>"Sylvia melanocephala",
+"Ross's Gull"=>"Larus roseus",
+"Yellow-Breasted Bunting"=>"Emberiza aureola",
+"Pine Bunting"=>"Emberiza leucocephalos",
+"Black Guillemot"=>"Cepphus grylle",
+"Pied-billed Grebe"=>"Podilymbus podiceps",
+"Soft-plumaged Petrel"=>"Pterodroma mollis",
+"Bulwer's Petrel"=>"Bulweria bulwerii",
+"White-Faced Storm-Petrel"=>"Pelagodroma marina",
+"Pallas’s Fish Eagle"=>"Haliaeetus leucoryphus",
+"Sandhill Crane"=>"Grus canadensis",
+"Macqueen’s Bustard"=>"Chlamydotis macqueenii",
+"White-tailed Lapwing"=>"Vanellus leucurus",
+"Great Knot"=>"Calidris tenuirostris",
+"Semipalmated Sandpiper"=>"Calidris pusilla",
+"Red-necked Stint"=>"Calidris ruficollis",
+"Slender-billed Curlew"=>"Numenius tenuirostris",
+"Bridled Tern"=>"Onychoprion anaethetus",
+"Pallas’s Sandgrouse"=>"Syrrhaptes paradoxus",
+"European Scops Owl"=>"Otus scops",
+"Northern Hawk Owl"=>"Surnia ulula",
+"White-Throated Needletail"=>"Hirundapus caudacutus",
+"Belted Kingfisher"=>"Ceryle alcyon",
+"Blue-cheeked Bee-eater"=>"Merops persicus",
+"Black-headed Wagtail"=>"Motacilla feldegg",
+"Northern Mockingbird"=>"Mimus polyglottos",
+"Alpine Accentor"=>"Prunella collaris",
+"Red-flanked Bluetail"=>"Tarsiger cyanurus",
+"Isabelline Wheatear"=>"Oenanthe isabellina",
+"Pied Wheatear"=>"Oenanthe pleschanka",
+"Eastern Black-eared Wheatear"=>"Oenanthe melanoleuca",
+"Desert Wheatear"=>"Oenanthe deserti",
+"White`s Thrush"=>"Zoothera aurea",
+"Siberian Thrush"=>"Zoothera sibirica",
+"Eyebrowed Thrush"=>"Turdus obscurus",
+"Dusky Thrush"=>"Turdus eunomus",
+"Black-throated Thrush"=>"Turdus atrogularis",
+"Pallas`s Grasshopper Warbler"=>"Locustella certhiola",
+"Spectacled Warbler"=>"Sylvia conspicillata",
+"Two-barred Warbler"=>"Phylloscopus plumbeitarsus",
+"Eastern Bonelli’s Warbler"=>"Phylloscopus orientalis",
+"Collared Flycatcher"=>"Ficedula albicollis",
+"Wallcreeper"=>"Tichodroma muraria",
+"Turkestan Shrike"=>"Lanius phoenicuroides",
+"Steppe Grey Shrike"=>"Lanius pallidirostris",
+"Spanish Sparrow"=>"Passer hispaniolensis",
+"Red-eyed Vireo"=>"Vireo olivaceus",
+"Myrtle Warbler"=>"Dendroica coronata",
+"White-crowned Sparrow"=>"Zonotrichia leucophrys",
+"White-throated Sparrow"=>"Zonotrichia albicollis",
+"Cretzschmar`s Bunting"=>"Emberiza caesia",
+"Chestnut Bunting"=>"Emberiza rutila",
+"Red-headed Bunting"=>"Emberiza bruniceps",
+"Black-headed Bunting"=>"Emberiza melanocephala",
+"Indigo Bunting"=>"Passerina cyanea",
+"Balearic Woodchat Shrike"=>"Lanius senator badius",
+"Demoiselle Crane"=>"Grus virgo",
+"Chough"=>"Pyrrhocorax pyrrhocorax",
+"Red-Billed Chough"=>"Pyrrhocorax graculus",
+"Elegant Tern"=>"Sterna elegans",
+"Chukar"=>"Alectoris chukar",
+"Yellow-Billed Cuckoo"=>"Coccyzus americanus",
+"American Sandwich Tern"=>"Sterna sandvicensis acuflavida",
+"Olive-Tree Warbler"=>"Hippolais olivetorum",
+"Eastern Olivaceous Warbler"=>"Acrocephalus pallidus",
+"Indian Cormorant"=>"Phalacrocorax fuscicollis",
+"Spur-Winged Lapwing"=>"Vanellus spinosus",
+"Yelkouan Shearwater"=>"Puffinus yelkouan",
+"Trumpeter Finch"=>"Bucanetes githagineus",
+"Red Grouse"=>"Lagopus scoticus",
+"Rock Ptarmigan"=>"Lagopus mutus",
+"Long-Tailed Cormorant"=>"Phalacrocorax africanus",
+"Double-crested Cormorant"=>"Phalacrocorax auritus",
+"Magnificent Frigatebird"=>"Fregata magnificens",
+"Naumann's Thrush"=>"Turdus naumanni",
+"Oriental Pratincole"=>"Glareola maldivarum",
+"Bufflehead"=>"Bucephala albeola",
+"Snowfinch"=>"Montifrigilla nivalis",
+"Ural owl"=>"Strix uralensis",
+"Spanish Wagtail"=>"Motacilla iberiae",
+"Song Sparrow"=>"Melospiza melodia",
+"Rock Bunting"=>"Emberiza cia",
+"Siberian Rubythroat"=>"Luscinia calliope",
+"Pallid Swift"=>"Apus pallidus",
+"Eurasian Pygmy Owl"=>"Glaucidium passerinum",
+"Madeira Little Shearwater"=>"Puffinus baroli",
+"House Finch"=>"Carpodacus mexicanus",
+"Green Heron"=>"Butorides virescens",
+"Solitary Sandpiper"=>"Tringa solitaria",
+"Heuglin's Gull"=>"Larus heuglini"
+foreach ($items as $key=>$value) {
+	if (strpos(strtolower($key), $q) !== false) {
+		echo "$key|$value\n";
+	}
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/demo/search.phps	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,578 @@
+$q = strtolower($_GET["q"]);
+if (!$q) return;
+$items = array(
+"Great <em>Bittern</em>"=>"Botaurus stellaris",
+"Little <em>Grebe</em>"=>"Tachybaptus ruficollis",
+"Black-necked Grebe"=>"Podiceps nigricollis",
+"Little Bittern"=>"Ixobrychus minutus",
+"Black-crowned Night Heron"=>"Nycticorax nycticorax",
+"Purple Heron"=>"Ardea purpurea",
+"White Stork"=>"Ciconia ciconia",
+"Spoonbill"=>"Platalea leucorodia",
+"Red-crested Pochard"=>"Netta rufina",
+"Common Eider"=>"Somateria mollissima",
+"Red Kite"=>"Milvus milvus",
+"Hen Harrier"=>"Circus cyaneus",
+"Montagu`s Harrier"=>"Circus pygargus",
+"Black Grouse"=>"Tetrao tetrix",
+"Grey Partridge"=>"Perdix perdix",
+"Spotted Crake"=>"Porzana porzana",
+"Corncrake"=>"Crex crex",
+"Common Crane"=>"Grus grus",
+"Avocet"=>"Recurvirostra avosetta",
+"Stone Curlew"=>"Burhinus oedicnemus",
+"Common Ringed Plover"=>"Charadrius hiaticula",
+"Kentish Plover"=>"Charadrius alexandrinus",
+"Ruff"=>"Philomachus pugnax",
+"Common Snipe"=>"Gallinago gallinago",
+"Black-tailed Godwit"=>"Limosa limosa",
+"Common Redshank"=>"Tringa totanus",
+"Sandwich Tern"=>"Sterna sandvicensis",
+"Common Tern"=>"Sterna hirundo",
+"Arctic Tern"=>"Sterna paradisaea",
+"Little Tern"=>"Sternula albifrons",
+"Black Tern"=>"Chlidonias niger",
+"Barn Owl"=>"Tyto alba",
+"Little Owl"=>"Athene noctua",
+"Short-eared Owl"=>"Asio flammeus",
+"European Nightjar"=>"Caprimulgus europaeus",
+"Common Kingfisher"=>"Alcedo atthis",
+"Eurasian Hoopoe"=>"Upupa epops",
+"Eurasian Wryneck"=>"Jynx torquilla",
+"European Green Woodpecker"=>"Picus viridis",
+"Crested Lark"=>"Galerida cristata",
+"White-headed Duck"=>"Oxyura leucocephala",
+"Pale-bellied Brent Goose"=>"Branta hrota",
+"Tawny Pipit"=>"Anthus campestris",
+"Whinchat"=>"Saxicola rubetra",
+"European Stonechat"=>"Saxicola rubicola",
+"Northern Wheatear"=>"Oenanthe oenanthe",
+"Savi`s Warbler"=>"Locustella luscinioides",
+"Sedge Warbler"=>"Acrocephalus schoenobaenus",
+"Great Reed Warbler"=>"Acrocephalus arundinaceus",
+"Bearded Reedling"=>"Panurus biarmicus",
+"Red-backed Shrike"=>"Lanius collurio",
+"Great Grey Shrike"=>"Lanius excubitor",
+"Woodchat Shrike"=>"Lanius senator",
+"Common Raven"=>"Corvus corax",
+"Yellowhammer"=>"Emberiza citrinella",
+"Ortolan Bunting"=>"Emberiza hortulana",
+"Corn Bunting"=>"Emberiza calandra",
+"Great Cormorant"=>"Phalacrocorax carbo",
+"Hawfinch"=>"Coccothraustes coccothraustes",
+"Common Shelduck"=>"Tadorna tadorna",
+"Bluethroat"=>"Luscinia svecica",
+"Grey Heron"=>"Ardea cinerea",
+"Barn Swallow"=>"Hirundo rustica",
+"Hooded Crow"=>"Corvus cornix",
+"Dunlin"=>"Calidris alpina",
+"Eurasian Pied Flycatcher"=>"Ficedula hypoleuca",
+"Eurasian Nuthatch"=>"Sitta europaea",
+"Short-toed Tree Creeper"=>"Certhia brachydactyla",
+"Wood Lark"=>"Lullula arborea",
+"Tree Pipit"=>"Anthus trivialis",
+"Eurasian Hobby"=>"Falco subbuteo",
+"Marsh Warbler"=>"Acrocephalus palustris",
+"Wood Sandpiper"=>"Tringa glareola",
+"Tawny Owl"=>"Strix aluco",
+"Lesser Whitethroat"=>"Sylvia curruca",
+"Barnacle Goose"=>"Branta leucopsis",
+"Common Goldeneye"=>"Bucephala clangula",
+"Western Marsh Harrier"=>"Circus aeruginosus",
+"Common Buzzard"=>"Buteo buteo",
+"Sanderling"=>"Calidris alba",
+"Little Gull"=>"Larus minutus",
+"Eurasian Magpie"=>"Pica pica",
+"Willow Warbler"=>"Phylloscopus trochilus",
+"Wood Warbler"=>"Phylloscopus sibilatrix",
+"Great Crested Grebe"=>"Podiceps cristatus",
+"Eurasian Jay"=>"Garrulus glandarius",
+"Common Redstart"=>"Phoenicurus phoenicurus",
+"Blue-headed Wagtail"=>"Motacilla flava",
+"Common Swift"=>"Apus apus",
+"Marsh Tit"=>"Poecile palustris",
+"Goldcrest"=>"Regulus regulus",
+"European Golden Plover"=>"Pluvialis apricaria",
+"Eurasian Bullfinch"=>"Pyrrhula pyrrhula",
+"Common Whitethroat"=>"Sylvia communis",
+"Meadow Pipit"=>"Anthus pratensis",
+"Greylag Goose"=>"Anser anser",
+"Spotted Flycatcher"=>"Muscicapa striata",
+"European Greenfinch"=>"Carduelis chloris",
+"Common Greenshank"=>"Tringa nebularia",
+"Great Spotted Woodpecker"=>"Dendrocopos major",
+"Greater Canada Goose"=>"Branta canadensis",
+"Mistle Thrush"=>"Turdus viscivorus",
+"Great Black-backed Gull"=>"Larus marinus",
+"Goosander"=>"Mergus merganser",
+"Great Egret"=>"Casmerodius albus",
+"Northern Goshawk"=>"Accipiter gentilis",
+"Dunnock"=>"Prunella modularis",
+"Stock Dove"=>"Columba oenas",
+"Common Wood Pigeon"=>"Columba palumbus",
+"Eurasian Woodcock"=>"Scolopax rusticola",
+"House Sparrow"=>"Passer domesticus",
+"Common House Martin"=>"Delichon urbicum",
+"Red Knot"=>"Calidris canutus",
+"Western Jackdaw"=>"Corvus monedula",
+"Brambling"=>"Fringilla montifringilla",
+"Northern Lapwing"=>"Vanellus vanellus",
+"European Reed Warbler"=>"Acrocephalus scirpaceus",
+"Lesser Black-backed Gull"=>"Larus fuscus",
+"Little Egret"=>"Egretta garzetta",
+"Little Stint"=>"Calidris minuta",
+"Common Linnet"=>"Carduelis cannabina",
+"Mute Swan"=>"Cygnus olor",
+"Common Cuckoo"=>"Cuculus canorus",
+"Black-headed Gull"=>"Larus ridibundus",
+"Greater White-fronted Goose"=>"Anser albifrons",
+"Great Tit"=>"Parus major",
+"Redwing"=>"Turdus iliacus",
+"Gadwall"=>"Anas strepera",
+"Fieldfare"=>"Turdus pilaris",
+"Tufted Duck"=>"Aythya fuligula",
+"Crested Tit"=>"Lophophanes cristatus",
+"Willow Tit"=>"Poecile montanus",
+"Eurasian Coot"=>"Fulica atra",
+"Common Blackbird"=>"Turdus merula",
+"Smew"=>"Mergus albellus",
+"Common Sandpiper"=>"Actitis hypoleucos",
+"Sand Martin"=>"Riparia riparia",
+"Purple Sandpiper"=>"Calidris maritima",
+"Northern Pintail"=>"Anas acuta",
+"Blue Tit"=>"Cyanistes caeruleus",
+"European Goldfinch"=>"Carduelis carduelis",
+"Eurasian Whimbrel"=>"Numenius phaeopus",
+"Common Reed Bunting"=>"Emberiza schoeniclus",
+"Eurasian Tree Sparrow"=>"Passer montanus",
+"Rook"=>"Corvus frugilegus",
+"European Robin"=>"Erithacus rubecula",
+"Bar-tailed Godwit"=>"Limosa lapponica",
+"Dark-bellied Brent Goose"=>"Branta bernicla",
+"Eurasian Oystercatcher"=>"Haematopus ostralegus",
+"Eurasian Siskin"=>"Carduelis spinus",
+"Northern Shoveler"=>"Anas clypeata",
+"Eurasian Wigeon"=>"Anas penelope",
+"Eurasian Sparrow Hawk"=>"Accipiter nisus",
+"Icterine Warbler"=>"Hippolais icterina",
+"Common Starling"=>"Sturnus vulgaris",
+"Long-tailed Tit"=>"Aegithalos caudatus",
+"Ruddy Turnstone"=>"Arenaria interpres",
+"Mew Gull"=>"Larus canus",
+"Common Pochard"=>"Aythya ferina",
+"Common Chiffchaff"=>"Phylloscopus collybita",
+"Greater Scaup"=>"Aythya marila",
+"Common Kestrel"=>"Falco tinnunculus",
+"Garden Warbler"=>"Sylvia borin",
+"Eurasian Collared Dove"=>"Streptopelia decaocto",
+"Eurasian Skylark"=>"Alauda arvensis",
+"Common Chaffinch"=>"Fringilla coelebs",
+"Common Moorhen"=>"Gallinula chloropus",
+"Water Pipit"=>"Anthus spinoletta",
+"Mallard"=>"Anas platyrhynchos",
+"Winter Wren"=>"Troglodytes troglodytes",
+"Common Teal"=>"Anas crecca",
+"Green Sandpiper"=>"Tringa ochropus",
+"White Wagtail"=>"Motacilla alba",
+"Eurasian Curlew"=>"Numenius arquata",
+"Song Thrush"=>"Turdus philomelos",
+"European Herring Gull"=>"Larus argentatus",
+"Grey Plover"=>"Pluvialis squatarola",
+"Carrion Crow"=>"Corvus corone",
+"Coal Tit"=>"Periparus ater",
+"Spotted Redshank"=>"Tringa erythropus",
+"Blackcap"=>"Sylvia atricapilla",
+"Egyptian Vulture"=>"Neophron percnopterus",
+"Razorbill"=>"Alca torda",
+"Alpine Swift"=>"Apus melba",
+"Long-legged Buzzard"=>"Buteo rufinus",
+"Audouin`s Gull"=>"Larus audouinii",
+"Balearic Shearwater"=>"Puffinus mauretanicus",
+"Upland Sandpiper"=>"Bartramia longicauda",
+"Greater Spotted Eagle"=>"Aquila clanga",
+"Ring Ouzel"=>"Turdus torquatus",
+"Yellow-browed Warbler"=>"Phylloscopus inornatus",
+"Blue Rock Thrush"=>"Monticola solitarius",
+"Buff-breasted Sandpiper"=>"Tryngites subruficollis",
+"Jack Snipe"=>"Lymnocryptes minimus",
+"White-rumped Sandpiper"=>"Calidris fuscicollis",
+"Ruddy Shelduck"=>"Tadorna ferruginea",
+"Cetti's Warbler"=>"Cettia cetti",
+"Citrine Wagtail"=>"Motacilla citreola",
+"Roseate Tern"=>"Sterna dougallii",
+"Black-legged Kittiwake"=>"Rissa tridactyla",
+"Pygmy Cormorant"=>"Phalacrocorax pygmeus",
+"Booted Eagle"=>"Aquila pennata",
+"Lesser White-fronted Goose"=>"Anser erythropus",
+"Little Bunting"=>"Emberiza pusilla",
+"Eleonora's Falcon"=>"Falco eleonorae",
+"European Serin"=>"Serinus serinus",
+"Twite"=>"Carduelis flavirostris",
+"Yellow-legged Gull"=>"Larus michahellis",
+"Gyr Falcon"=>"Falco rusticolus",
+"Greenish Warbler"=>"Phylloscopus trochiloides",
+"Red-necked Phalarope"=>"Phalaropus lobatus",
+"Mealy Redpoll"=>"Carduelis flammea",
+"Glaucous Gull"=>"Larus hyperboreus",
+"Great Skua"=>"Stercorarius skua",
+"Great Bustard"=>"Otis tarda",
+"Velvet Scoter"=>"Melanitta fusca",
+"Pine Grosbeak"=>"Pinicola enucleator",
+"House Crow"=>"Corvus splendens",
+"Hume`s Leaf Warbler"=>"Phylloscopus humei",
+"Great Northern Loon"=>"Gavia immer",
+"Long-tailed Duck"=>"Clangula hyemalis",
+"Lapland Longspur"=>"Calcarius lapponicus",
+"Northern Gannet"=>"Morus bassanus",
+"Eastern Imperial Eagle"=>"Aquila heliaca",
+"Little Auk"=>"Alle alle",
+"Lesser Spotted Woodpecker"=>"Dendrocopos minor",
+"Iceland Gull"=>"Larus glaucoides",
+"Parasitic Jaeger"=>"Stercorarius parasiticus",
+"Bewick`s Swan"=>"Cygnus bewickii",
+"Little Bustard"=>"Tetrax tetrax",
+"Little Crake"=>"Porzana parva",
+"Baillon`s Crake"=>"Porzana pusilla",
+"Long-tailed Jaeger"=>"Stercorarius longicaudus",
+"King Eider"=>"Somateria spectabilis",
+"Greater Short-toed Lark"=>"Calandrella brachydactyla",
+"Houbara Bustard"=>"Chlamydotis undulata",
+"Curlew Sandpiper"=>"Calidris ferruginea",
+"Common Crossbill"=>"Loxia curvirostra",
+"European Shag"=>"Phalacrocorax aristotelis",
+"Horned Grebe"=>"Podiceps auritus",
+"Common Quail"=>"Coturnix coturnix",
+"Bearded Vulture"=>"Gypaetus barbatus",
+"Lanner Falcon"=>"Falco biarmicus",
+"Middle Spotted Woodpecker"=>"Dendrocopos medius",
+"Pomarine Jaeger"=>"Stercorarius pomarinus",
+"Red-breasted Merganser"=>"Mergus serrator",
+"Eurasian Black Vulture"=>"Aegypius monachus",
+"Eurasian Dotterel"=>"Charadrius morinellus",
+"Common Nightingale"=>"Luscinia megarhynchos",
+"Northern willow warbler"=>"Phylloscopus trochilus acredula",
+"Manx Shearwater"=>"Puffinus puffinus",
+"Northern Fulmar"=>"Fulmarus glacialis",
+"Eurasian Eagle Owl"=>"Bubo bubo",
+"Orphean Warbler"=>"Sylvia hortensis",
+"Melodious Warbler"=>"Hippolais polyglotta",
+"Pallas's Leaf Warbler"=>"Phylloscopus proregulus",
+"Atlantic Puffin"=>"Fratercula arctica",
+"Black-throated Loon"=>"Gavia arctica",
+"Bohemian Waxwing"=>"Bombycilla garrulus",
+"Marsh Sandpiper"=>"Tringa stagnatilis",
+"Great Snipe"=>"Gallinago media",
+"Squacco Heron"=>"Ardeola ralloides",
+"Long-eared Owl"=>"Asio otus",
+"Caspian Tern"=>"Hydroprogne caspia",
+"Red-breasted Goose"=>"Branta ruficollis",
+"Red-throated Loon"=>"Gavia stellata",
+"Common Rosefinch"=>"Carpodacus erythrinus",
+"Red-footed Falcon"=>"Falco vespertinus",
+"Ross's Goose"=>"Anser rossii",
+"Red Phalarope"=>"Phalaropus fulicarius",
+"Pied Wagtail"=>"Motacilla yarrellii",
+"Rose-coloured Starling"=>"Sturnus roseus",
+"Rough-legged Buzzard"=>"Buteo lagopus",
+"Saker Falcon"=>"Falco cherrug",
+"European Roller"=>"Coracias garrulus",
+"Short-toed Eagle"=>"Circaetus gallicus",
+"Peregrine Falcon"=>"Falco peregrinus",
+"Merlin"=>"Falco columbarius",
+"Snow Goose"=>"Anser caerulescens",
+"Snowy Owl"=>"Bubo scandiacus",
+"Snow Bunting"=>"Plectrophenax nivalis",
+"Common Grasshopper Warbler"=>"Locustella naevia",
+"Golden Eagle"=>"Aquila chrysaetos",
+"Black-winged Stilt"=>"Himantopus himantopus",
+"Steppe Eagle"=>"Aquila nipalensis",
+"Pallid Harrier"=>"Circus macrourus",
+"European Storm-petrel"=>"Hydrobates pelagicus",
+"Horned Lark"=>"Eremophila alpestris",
+"Eurasian Treecreeper"=>"Certhia familiaris",
+"Taiga Bean Goose"=>"Anser fabalis",
+"Temminck`s Stint"=>"Calidris temminckii",
+"Terek Sandpiper"=>"Xenus cinereus",
+"Tundra Bean Goose"=>"Anser serrirostris",
+"European Turtle Dove"=>"Streptopelia turtur",
+"Leach`s Storm-petrel"=>"Oceanodroma leucorhoa",
+"Eurasian Griffon Vulture"=>"Gyps fulvus",
+"Paddyfield Warbler"=>"Acrocephalus agricola",
+"Osprey"=>"Pandion haliaetus",
+"Firecrest"=>"Regulus ignicapilla",
+"Water Rail"=>"Rallus aquaticus",
+"European Honey Buzzard"=>"Pernis apivorus",
+"Eurasian Golden Oriole"=>"Oriolus oriolus",
+"Whooper Swan"=>"Cygnus cygnus",
+"Two-barred Crossbill"=>"Loxia leucoptera",
+"White-tailed Eagle"=>"Haliaeetus albicilla",
+"Atlantic Murre"=>"Uria aalge",
+"Garganey"=>"Anas querquedula",
+"Black Redstart"=>"Phoenicurus ochruros",
+"Common Scoter"=>"Melanitta nigra",
+"Rock Pipit"=>"Anthus petrosus",
+"Lesser Spotted Eagle"=>"Aquila pomarina",
+"Cattle Egret"=>"Bubulcus ibis",
+"White-winged Black Tern"=>"Chlidonias leucopterus",
+"Black Stork"=>"Ciconia nigra",
+"Mediterranean Gull"=>"Larus melanocephalus",
+"Black Kite"=>"Milvus migrans",
+"Yellow Wagtail"=>"Motacilla flavissima",
+"Red-necked Grebe"=>"Podiceps grisegena",
+"Gull-billed Tern"=>"Gelochelidon nilotica",
+"Pectoral Sandpiper"=>"Calidris melanotos",
+"Barred Warbler"=>"Sylvia nisoria",
+"Red-throated Pipit"=>"Anthus cervinus",
+"Grey Wagtail"=>"Motacilla cinerea",
+"Richard`s Pipit"=>"Anthus richardi",
+"Black Woodpecker"=>"Dryocopus martius",
+"Little Ringed Plover"=>"Charadrius dubius",
+"Whiskered Tern"=>"Chlidonias hybrida",
+"Lesser Redpoll"=>"Carduelis cabaret",
+"Pallas' Bunting"=>"Emberiza pallasi",
+"Ferruginous Duck"=>"Aythya nyroca",
+"Whistling Swan"=>"Cygnus columbianus",
+"Black Brant"=>"Branta nigricans",
+"Marbled Teal"=>"Marmaronetta angustirostris",
+"Canvasback"=>"Aythya valisineria",
+"Redhead"=>"Aythya americana",
+"Lesser Scaup"=>"Aythya affinis",
+"Steller`s Eider"=>"Polysticta stelleri",
+"Spectacled Eider"=>"Somateria fischeri",
+"Harlequin Duck"=>"Histronicus histrionicus",
+"Black Scoter"=>"Melanitta americana",
+"Surf Scoter"=>"Melanitta perspicillata",
+"Barrow`s Goldeneye"=>"Bucephala islandica",
+"Falcated Duck"=>"Anas falcata",
+"American Wigeon"=>"Anas americana",
+"Blue-winged Teal"=>"Anas discors",
+"American Black Duck"=>"Anas rubripes",
+"Baikal Teal"=>"Anas formosa",
+"Green-Winged Teal"=>"Anas carolinensis",
+"Hazel Grouse"=>"Bonasa bonasia",
+"Rock Partridge"=>"Alectoris graeca",
+"Red-legged Partridge"=>"Alectoris rufa",
+"Yellow-billed Loon"=>"Gavia adamsii",
+"Cory`s Shearwater"=>"Calonectris borealis",
+"Madeiran Storm-Petrel"=>"Oceanodroma castro",
+"Great White Pelican"=>"Pelecanus onocrotalus",
+"Dalmatian Pelican"=>"Pelecanus crispus",
+"American Bittern"=>"Botaurus lentiginosus",
+"Glossy Ibis"=>"Plegadis falcinellus",
+"Spanish Imperial Eagle"=>"Aquila adalberti",
+"Lesser Kestrel"=>"Falco naumanni",
+"Houbara Bustard"=>"Chlamydotis undulata",
+"Crab-Plover"=>"Dromas ardeola",
+"Cream-coloured Courser"=>"Cursorius cursor",
+"Collared Pratincole"=>"Glareola pratincola",
+"Black-winged Pratincole"=>"Glareola nordmanni",
+"Killdeer"=>"Charadrius vociferus",
+"Lesser Sand Plover"=>"Charadrius mongolus",
+"Greater Sand Plover"=>"Charadrius leschenaultii",
+"Caspian Plover"=>"Charadrius asiaticus",
+"American Golden Plover"=>"Pluvialis dominica",
+"Pacific Golden Plover"=>"Pluvialis fulva",
+"Sharp-tailed Sandpiper"=>"Calidris acuminata",
+"Broad-billed Sandpiper"=>"Limicola falcinellus",
+"Spoon-Billed Sandpiper"=>"Eurynorhynchus pygmaeus",
+"Short-Billed Dowitcher"=>"Limnodromus griseus",
+"Long-billed Dowitcher"=>"Limnodromus scolopaceus",
+"Hudsonian Godwit"=>"Limosa haemastica",
+"Little Curlew"=>"Numenius minutus",
+"Lesser Yellowlegs"=>"Tringa flavipes",
+"Wilson`s Phalarope"=>"Phalaropus tricolor",
+"Pallas`s Gull"=>"Larus ichthyaetus",
+"Laughing Gull"=>"Larus atricilla",
+"Franklin`s Gull"=>"Larus pipixcan",
+"Bonaparte`s Gull"=>"Larus philadelphia",
+"Ring-billed Gull"=>"Larus delawarensis",
+"American Herring Gull"=>"Larus smithsonianus",
+"Caspian Gull"=>"Larus cachinnans",
+"Ivory Gull"=>"Pagophila eburnea",
+"Royal Tern"=>"Sterna maxima",
+"Brünnich`s Murre"=>"Uria lomvia",
+"Crested Auklet"=>"Aethia cristatella",
+"Parakeet Auklet"=>"Cyclorrhynchus psittacula",
+"Tufted Puffin"=>"Lunda cirrhata",
+"Laughing Dove"=>"Streptopelia senegalensis",
+"Great Spotted Cuckoo"=>"Clamator glandarius",
+"Great Grey Owl"=>"Strix nebulosa",
+"Tengmalm`s Owl"=>"Aegolius funereus",
+"Red-Necked Nightjar"=>"Caprimulgus ruficollis",
+"Chimney Swift"=>"Chaetura pelagica",
+"Green Bea-Eater"=>"Merops orientalis",
+"Grey-headed Woodpecker"=>"Picus canus",
+"Lesser Short-Toed Lark"=>"Calandrella rufescens",
+"Eurasian Crag Martin"=>"Hirundo rupestris",
+"Red-rumped Swallow"=>"Cecropis daurica",
+"Blyth`s Pipit"=>"Anthus godlewskii",
+"Pechora Pipit"=>"Anthus gustavi",
+"Grey-headed Wagtail"=>"Motacilla thunbergi",
+"Yellow-Headed Wagtail"=>"Motacilla lutea",
+"White-throated Dipper"=>"Cinclus cinclus",
+"Rufous-Tailed Scrub Robin"=>"Cercotrichas galactotes",
+"Thrush Nightingale"=>"Luscinia luscinia",
+"White-throated Robin"=>"Irania gutturalis",
+"Caspian Stonechat"=>"Saxicola maura variegata",
+"Western Black-eared Wheatear"=>"Oenanthe hispanica",
+"Rufous-tailed Rock Thrush"=>"Monticola saxatilis",
+"Red-throated Thrush/Black-throated"=>"Turdus ruficollis",
+"American Robin"=>"Turdus migratorius",
+"Zitting Cisticola"=>"Cisticola juncidis",
+"Lanceolated Warbler"=>"Locustella lanceolata",
+"River Warbler"=>"Locustella fluviatilis",
+"Blyth`s Reed Warbler"=>"Acrocephalus dumetorum",
+"Caspian Reed Warbler"=>"Acrocephalus fuscus",
+"Aquatic Warbler"=>"Acrocephalus paludicola",
+"Booted Warbler"=>"Acrocephalus caligatus",
+"Marmora's Warbler"=>"Sylvia sarda",
+"Dartford Warbler"=>"Sylvia undata",
+"Subalpine Warbler"=>"Sylvia cantillans",
+"Ménétries's Warbler"=>"Sylvia mystacea",
+"Rüppel's Warbler"=>"Sylvia rueppelli",
+"Asian Desert Warbler"=>"Sylvia nana",
+"Western Orphean Warbler"=>"Sylvia hortensis hortensis",
+"Arctic Warbler"=>"Phylloscopus borealis",
+"Radde`s Warbler"=>"Phylloscopus schwarzi",
+"Western Bonelli`s Warbler"=>"Phylloscopus bonelli",
+"Red-breasted Flycatcher"=>"Ficedula parva",
+"Eurasian Penduline Tit"=>"Remiz pendulinus",
+"Daurian Shrike"=>"Lanius isabellinus",
+"Long-Tailed Shrike"=>"Lanius schach",
+"Lesser Grey Shrike"=>"Lanius minor",
+"Southern Grey Shrike"=>"Lanius meridionalis",
+"Masked Shrike"=>"Lanius nubicus",
+"Spotted Nutcracker"=>"Nucifraga caryocatactes",
+"Daurian Jackdaw"=>"Corvus dauuricus",
+"Purple-Backed Starling"=>"Sturnus sturninus",
+"Red-Fronted Serin"=>"Serinus pusillus",
+"Arctic Redpoll"=>"Carduelis hornemanni",
+"Scottish Crossbill"=>"Loxia scotica",
+"Parrot Crossbill"=>"Loxia pytyopsittacus",
+"Black-faced Bunting"=>"Emberiza spodocephala",
+"Pink-footed Goose"=>"Anser brachyrhynchus",
+"Black-winged Kite"=>"Elanus caeruleus",
+"European Bee-eater"=>"Merops apiaster",
+"Sabine`s Gull"=>"Larus sabini",
+"Sooty Shearwater"=>"Puffinus griseus",
+"Lesser Canada Goose"=>"Branta hutchinsii",
+"Ring-necked Duck"=>"Aythya collaris",
+"Greater Flamingo"=>"Phoenicopterus roseus",
+"Iberian Chiffchaff"=>"Phylloscopus ibericus",
+"Ashy-headed Wagtail"=>"Motacilla cinereocapilla",
+"Stilt Sandpiper"=>"Calidris himantopus",
+"Siberian Stonechat"=>"Saxicola maurus",
+"Greater Yellowlegs"=>"Tringa melanoleuca",
+"Forster`s Tern"=>"Sterna forsteri",
+"Dusky Warbler"=>"Phylloscopus fuscatus",
+"Cirl Bunting"=>"Emberiza cirlus",
+"Olive-backed Pipit"=>"Anthus hodgsoni",
+"Sociable Lapwing"=>"Vanellus gregarius",
+"Spotted Sandpiper"=>"Actitis macularius",
+"Baird`s Sandpiper"=>"Calidris bairdii",
+"Rustic Bunting"=>"Emberiza rustica",
+"Yellow-browed Bunting"=>"Emberiza chrysophrys",
+"Great Shearwater"=>"Puffinus gravis",
+"Bonelli`s Eagle"=>"Aquila fasciata",
+"Calandra Lark"=>"Melanocorypha calandra",
+"Sardinian Warbler"=>"Sylvia melanocephala",
+"Ross's Gull"=>"Larus roseus",
+"Yellow-Breasted Bunting"=>"Emberiza aureola",
+"Pine Bunting"=>"Emberiza leucocephalos",
+"Black Guillemot"=>"Cepphus grylle",
+"Pied-billed Grebe"=>"Podilymbus podiceps",
+"Soft-plumaged Petrel"=>"Pterodroma mollis",
+"Bulwer's Petrel"=>"Bulweria bulwerii",
+"White-Faced Storm-Petrel"=>"Pelagodroma marina",
+"Pallas’s Fish Eagle"=>"Haliaeetus leucoryphus",
+"Sandhill Crane"=>"Grus canadensis",
+"Macqueen’s Bustard"=>"Chlamydotis macqueenii",
+"White-tailed Lapwing"=>"Vanellus leucurus",
+"Great Knot"=>"Calidris tenuirostris",
+"Semipalmated Sandpiper"=>"Calidris pusilla",
+"Red-necked Stint"=>"Calidris ruficollis",
+"Slender-billed Curlew"=>"Numenius tenuirostris",
+"Bridled Tern"=>"Onychoprion anaethetus",
+"Pallas’s Sandgrouse"=>"Syrrhaptes paradoxus",
+"European Scops Owl"=>"Otus scops",
+"Northern Hawk Owl"=>"Surnia ulula",
+"White-Throated Needletail"=>"Hirundapus caudacutus",
+"Belted Kingfisher"=>"Ceryle alcyon",
+"Blue-cheeked Bee-eater"=>"Merops persicus",
+"Black-headed Wagtail"=>"Motacilla feldegg",
+"Northern Mockingbird"=>"Mimus polyglottos",
+"Alpine Accentor"=>"Prunella collaris",
+"Red-flanked Bluetail"=>"Tarsiger cyanurus",
+"Isabelline Wheatear"=>"Oenanthe isabellina",
+"Pied Wheatear"=>"Oenanthe pleschanka",
+"Eastern Black-eared Wheatear"=>"Oenanthe melanoleuca",
+"Desert Wheatear"=>"Oenanthe deserti",
+"White`s Thrush"=>"Zoothera aurea",
+"Siberian Thrush"=>"Zoothera sibirica",
+"Eyebrowed Thrush"=>"Turdus obscurus",
+"Dusky Thrush"=>"Turdus eunomus",
+"Black-throated Thrush"=>"Turdus atrogularis",
+"Pallas`s Grasshopper Warbler"=>"Locustella certhiola",
+"Spectacled Warbler"=>"Sylvia conspicillata",
+"Two-barred Warbler"=>"Phylloscopus plumbeitarsus",
+"Eastern Bonelli’s Warbler"=>"Phylloscopus orientalis",
+"Collared Flycatcher"=>"Ficedula albicollis",
+"Wallcreeper"=>"Tichodroma muraria",
+"Turkestan Shrike"=>"Lanius phoenicuroides",
+"Steppe Grey Shrike"=>"Lanius pallidirostris",
+"Spanish Sparrow"=>"Passer hispaniolensis",
+"Red-eyed Vireo"=>"Vireo olivaceus",
+"Myrtle Warbler"=>"Dendroica coronata",
+"White-crowned Sparrow"=>"Zonotrichia leucophrys",
+"White-throated Sparrow"=>"Zonotrichia albicollis",
+"Cretzschmar`s Bunting"=>"Emberiza caesia",
+"Chestnut Bunting"=>"Emberiza rutila",
+"Red-headed Bunting"=>"Emberiza bruniceps",
+"Black-headed Bunting"=>"Emberiza melanocephala",
+"Indigo Bunting"=>"Passerina cyanea",
+"Balearic Woodchat Shrike"=>"Lanius senator badius",
+"Demoiselle Crane"=>"Grus virgo",
+"Chough"=>"Pyrrhocorax pyrrhocorax",
+"Red-Billed Chough"=>"Pyrrhocorax graculus",
+"Elegant Tern"=>"Sterna elegans",
+"Chukar"=>"Alectoris chukar",
+"Yellow-Billed Cuckoo"=>"Coccyzus americanus",
+"American Sandwich Tern"=>"Sterna sandvicensis acuflavida",
+"Olive-Tree Warbler"=>"Hippolais olivetorum",
+"Eastern Olivaceous Warbler"=>"Acrocephalus pallidus",
+"Indian Cormorant"=>"Phalacrocorax fuscicollis",
+"Spur-Winged Lapwing"=>"Vanellus spinosus",
+"Yelkouan Shearwater"=>"Puffinus yelkouan",
+"Trumpeter Finch"=>"Bucanetes githagineus",
+"Red Grouse"=>"Lagopus scoticus",
+"Rock Ptarmigan"=>"Lagopus mutus",
+"Long-Tailed Cormorant"=>"Phalacrocorax africanus",
+"Double-crested Cormorant"=>"Phalacrocorax auritus",
+"Magnificent Frigatebird"=>"Fregata magnificens",
+"Naumann's Thrush"=>"Turdus naumanni",
+"Oriental Pratincole"=>"Glareola maldivarum",
+"Bufflehead"=>"Bucephala albeola",
+"Snowfinch"=>"Montifrigilla nivalis",
+"Ural owl"=>"Strix uralensis",
+"Spanish Wagtail"=>"Motacilla iberiae",
+"Song Sparrow"=>"Melospiza melodia",
+"Rock Bunting"=>"Emberiza cia",
+"Siberian Rubythroat"=>"Luscinia calliope",
+"Pallid Swift"=>"Apus pallidus",
+"Eurasian Pygmy Owl"=>"Glaucidium passerinum",
+"Madeira Little Shearwater"=>"Puffinus baroli",
+"House Finch"=>"Carpodacus mexicanus",
+"Green Heron"=>"Butorides virescens",
+"Solitary Sandpiper"=>"Tringa solitaria",
+"Heuglin's Gull"=>"Larus heuglini"
+foreach ($items as $key=>$value) {
+	if (strpos(strtolower($key), $q) !== false) {
+		echo "$key|$value\n";
+	}
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/jquery.autocomplete.css	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,48 @@
+.ac_results {
+	padding: 0px;
+	border: 1px solid #333333;
+	background-color: white;
+	overflow: hidden;
+	z-index: 99999;
+.ac_results ul {
+	width: 100%;
+	list-style-position: outside;
+	list-style: none;
+	padding: 0;
+	margin: 0;
+.ac_results li {
+	margin: 0px;
+	padding: 2px 5px;
+	cursor: default;
+	display: block;
+	/* 
+	if width will be 100% horizontal scrollbar will apear 
+	when scroll mode will be used
+	*/
+	/*width: 100%;*/
+	font: menu;
+	font-size: 12px;
+	/* 
+	it is very important, if line-height not setted or setted 
+	in relative units scroll will be broken in firefox
+	*/
+	line-height: 16px;
+	overflow: hidden;
+.ac_loading {
+	/*background: white url('indicator.gif') right center no-repeat;*/
+.ac_odd {
+	background-color: #666;
+.ac_over {
+	background-color: #333;
+	color: white;
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/jquery.autocomplete.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,808 @@
+ * jQuery Autocomplete plugin 1.1
+ *
+ * Copyright (c) 2009 Jörn Zaefferer
+ *
+ * Dual licensed under the MIT and GPL licenses:
+ *   http://www.opensource.org/licenses/mit-license.php
+ *   http://www.gnu.org/licenses/gpl.html
+ *
+ * Revision: $Id: jquery.autocomplete.js 15 2009-08-22 10:30:27Z joern.zaefferer $
+ */
+;(function($) {
+	autocomplete: function(urlOrData, options) {
+		var isUrl = typeof urlOrData == "string";
+		options = $.extend({}, $.Autocompleter.defaults, {
+			url: isUrl ? urlOrData : null,
+			data: isUrl ? null : urlOrData,
+			delay: isUrl ? $.Autocompleter.defaults.delay : 10,
+			max: options && !options.scroll ? 10 : 150
+		}, options);
+		// if highlight is set to false, replace it with a do-nothing function
+		options.highlight = options.highlight || function(value) { return value; };
+		// if the formatMatch option is not specified, then use formatItem for backwards compatibility
+		options.formatMatch = options.formatMatch || options.formatItem;
+		return this.each(function() {
+			new $.Autocompleter(this, options);
+		});
+	},
+	result: function(handler) {
+		return this.bind("result", handler);
+	},
+	search: function(handler) {
+		return this.trigger("search", [handler]);
+	},
+	flushCache: function() {
+		return this.trigger("flushCache");
+	},
+	setOptions: function(options){
+		return this.trigger("setOptions", [options]);
+	},
+	unautocomplete: function() {
+		return this.trigger("unautocomplete");
+	}
+$.Autocompleter = function(input, options) {
+	var KEY = {
+		UP: 38,
+		DOWN: 40,
+		DEL: 46,
+		TAB: 9,
+		RETURN: 13,
+		ESC: 27,
+		COMMA: 188,
+		PAGEUP: 33,
+		PAGEDOWN: 34,
+	};
+	// Create $ object for input element
+	var $input = $(input).attr("autocomplete", "off").addClass(options.inputClass);
+	var timeout;
+	var previousValue = "";
+	var cache = $.Autocompleter.Cache(options);
+	var hasFocus = 0;
+	var lastKeyPressCode;
+	var config = {
+		mouseDownOnSelect: false
+	};
+	var select = $.Autocompleter.Select(options, input, selectCurrent, config);
+	var blockSubmit;
+	// prevent form submit in opera when selecting with return key
+	$.browser.opera && $(input.form).bind("submit.autocomplete", function() {
+		if (blockSubmit) {
+			blockSubmit = false;
+			return false;
+		}
+	});
+	// only opera doesn't trigger keydown multiple times while pressed, others don't work with keypress at all
+	$input.bind(($.browser.opera ? "keypress" : "keydown") + ".autocomplete", function(event) {
+		// a keypress means the input has focus
+		// avoids issue where input had focus before the autocomplete was applied
+		hasFocus = 1;
+		// track last key pressed
+		lastKeyPressCode = event.keyCode;
+		switch(event.keyCode) {
+			case KEY.UP:
+				event.preventDefault();
+				if ( select.visible() ) {
+					select.prev();
+				} else {
+					onChange(0, true);
+				}
+				break;
+			case KEY.DOWN:
+				event.preventDefault();
+				if ( select.visible() ) {
+					select.next();
+				} else {
+					onChange(0, true);
+				}
+				break;
+			case KEY.PAGEUP:
+				event.preventDefault();
+				if ( select.visible() ) {
+					select.pageUp();
+				} else {
+					onChange(0, true);
+				}
+				break;
+			case KEY.PAGEDOWN:
+				event.preventDefault();
+				if ( select.visible() ) {
+					select.pageDown();
+				} else {
+					onChange(0, true);
+				}
+				break;
+			// matches also semicolon
+			case options.multiple && $.trim(options.multipleSeparator) == "," && KEY.COMMA:
+			case KEY.TAB:
+			case KEY.RETURN:
+				if( selectCurrent() ) {
+					// stop default to prevent a form submit, Opera needs special handling
+					event.preventDefault();
+					blockSubmit = true;
+					return false;
+				}
+				break;
+			case KEY.ESC:
+				select.hide();
+				break;
+			default:
+				clearTimeout(timeout);
+				timeout = setTimeout(onChange, options.delay);
+				break;
+		}
+	}).focus(function(){
+		// track whether the field has focus, we shouldn't process any
+		// results if the field no longer has focus
+		hasFocus++;
+	}).blur(function() {
+		hasFocus = 0;
+		if (!config.mouseDownOnSelect) {
+			hideResults();
+		}
+	}).click(function() {
+		// show select when clicking in a focused field
+		if ( hasFocus++ > 1 && !select.visible() ) {
+			onChange(0, true);
+		}
+	}).bind("search", function() {
+		// TODO why not just specifying both arguments?
+		var fn = (arguments.length > 1) ? arguments[1] : null;
+		function findValueCallback(q, data) {
+			var result;
+			if( data && data.length ) {
+				for (var i=0; i < data.length; i++) {
+					if( data[i].result.toLowerCase() == q.toLowerCase() ) {
+						result = data[i];
+						break;
+					}
+				}
+			}
+			if( typeof fn == "function" ) fn(result);
+			else $input.trigger("result", result && [result.data, result.value]);
+		}
+		$.each(trimWords($input.val()), function(i, value) {
+			request(value, findValueCallback, findValueCallback);
+		});
+	}).bind("flushCache", function() {
+		cache.flush();
+	}).bind("setOptions", function() {
+		$.extend(options, arguments[1]);
+		// if we've updated the data, repopulate
+		if ( "data" in arguments[1] )
+			cache.populate();
+	}).bind("unautocomplete", function() {
+		select.unbind();
+		$input.unbind();
+		$(input.form).unbind(".autocomplete");
+	});
+	function selectCurrent() {
+		var selected = select.selected();
+		if( !selected )
+			return false;
+		var v = selected.result;
+		previousValue = v;
+		if ( options.multiple ) {
+			var words = trimWords($input.val());
+			if ( words.length > 1 ) {
+				var seperator = options.multipleSeparator.length;
+				var cursorAt = $(input).selection().start;
+				var wordAt, progress = 0;
+				$.each(words, function(i, word) {
+					progress += word.length;
+					if (cursorAt <= progress) {
+						wordAt = i;
+						return false;
+					}
+					progress += seperator;
+				});
+				words[wordAt] = v;
+				// TODO this should set the cursor to the right position, but it gets overriden somewhere
+				//$.Autocompleter.Selection(input, progress + seperator, progress + seperator);
+				v = words.join( options.multipleSeparator );
+			}
+			v += options.multipleSeparator;
+		}
+		$input.val(v);
+		hideResultsNow();
+		$input.trigger("result", [selected.data, selected.value]);
+		return true;
+	}
+	function onChange(crap, skipPrevCheck) {
+		if( lastKeyPressCode == KEY.DEL ) {
+			select.hide();
+			return;
+		}
+		var currentValue = $input.val();
+		if ( !skipPrevCheck && currentValue == previousValue )
+			return;
+		previousValue = currentValue;
+		currentValue = lastWord(currentValue);
+		if ( currentValue.length >= options.minChars) {
+			$input.addClass(options.loadingClass);
+			if (!options.matchCase)
+				currentValue = currentValue.toLowerCase();
+			request(currentValue, receiveData, hideResultsNow);
+		} else {
+			stopLoading();
+			select.hide();
+		}
+	};
+	function trimWords(value) {
+		if (!value)
+			return [""];
+		if (!options.multiple)
+			return [$.trim(value)];
+		return $.map(value.split(options.multipleSeparator), function(word) {
+			return $.trim(value).length ? $.trim(word) : null;
+		});
+	}
+	function lastWord(value) {
+		if ( !options.multiple )
+			return value;
+		var words = trimWords(value);
+		if (words.length == 1) 
+			return words[0];
+		var cursorAt = $(input).selection().start;
+		if (cursorAt == value.length) {
+			words = trimWords(value)
+		} else {
+			words = trimWords(value.replace(value.substring(cursorAt), ""));
+		}
+		return words[words.length - 1];
+	}
+	// fills in the input box w/the first match (assumed to be the best match)
+	// q: the term entered
+	// sValue: the first matching result
+	function autoFill(q, sValue){
+		// autofill in the complete box w/the first match as long as the user hasn't entered in more data
+		// if the last user key pressed was backspace, don't autofill
+		if( options.autoFill && (lastWord($input.val()).toLowerCase() == q.toLowerCase()) && lastKeyPressCode != KEY.BACKSPACE ) {
+			// fill in the value (keep the case the user has typed)
+			$input.val($input.val() + sValue.substring(lastWord(previousValue).length));
+			// select the portion of the value not typed by the user (so the next character will erase)
+			$(input).selection(previousValue.length, previousValue.length + sValue.length);
+		}
+	};
+	function hideResults() {
+		clearTimeout(timeout);
+		timeout = setTimeout(hideResultsNow, 200);
+	};
+	function hideResultsNow() {
+		var wasVisible = select.visible();
+		select.hide();
+		clearTimeout(timeout);
+		stopLoading();
+		if (options.mustMatch) {
+			// call search and run callback
+			$input.search(
+				function (result){
+					// if no value found, clear the input box
+					if( !result ) {
+						if (options.multiple) {
+							var words = trimWords($input.val()).slice(0, -1);
+							$input.val( words.join(options.multipleSeparator) + (words.length ? options.multipleSeparator : "") );
+						}
+						else {
+							$input.val( "" );
+							$input.trigger("result", null);
+						}
+					}
+				}
+			);
+		}
+	};
+	function receiveData(q, data) {
+		if ( data && data.length && hasFocus ) {
+			stopLoading();
+			select.display(data, q);
+			autoFill(q, data[0].value);
+			select.show();
+		} else {
+			hideResultsNow();
+		}
+	};
+	function request(term, success, failure) {
+		if (!options.matchCase)
+			term = term.toLowerCase();
+		var data = cache.load(term);
+		// recieve the cached data
+		if (data && data.length) {
+			success(term, data);
+		// if an AJAX url has been supplied, try loading the data now
+		} else if( (typeof options.url == "string") && (options.url.length > 0) ){
+			var extraParams = {
+				timestamp: +new Date()
+			};
+			$.each(options.extraParams, function(key, param) {
+				extraParams[key] = typeof param == "function" ? param() : param;
+			});
+			$.ajax({
+				// try to leverage ajaxQueue plugin to abort previous requests
+				mode: "abort",
+				// limit abortion to this input
+				port: "autocomplete" + input.name,
+				dataType: options.dataType,
+				url: options.url,
+				data: $.extend({
+					q: lastWord(term),
+					limit: options.max
+				}, extraParams),
+				success: function(data) {
+					var parsed = options.parse && options.parse(data) || parse(data);
+					cache.add(term, parsed);
+					success(term, parsed);
+				}
+			});
+		} else {
+			// if we have a failure, we need to empty the list -- this prevents the the [TAB] key from selecting the last successful match
+			select.emptyList();
+			failure(term);
+		}
+	};
+	function parse(data) {
+		var parsed = [];
+		var rows = data.split("\n");
+		for (var i=0; i < rows.length; i++) {
+			var row = $.trim(rows[i]);
+			if (row) {
+				row = row.split("|");
+				parsed[parsed.length] = {
+					data: row,
+					value: row[0],
+					result: options.formatResult && options.formatResult(row, row[0]) || row[0]
+				};
+			}
+		}
+		return parsed;
+	};
+	function stopLoading() {
+		$input.removeClass(options.loadingClass);
+	};
+$.Autocompleter.defaults = {
+	inputClass: "ac_input",
+	resultsClass: "ac_results",
+	loadingClass: "ac_loading",
+	minChars: 1,
+	delay: 400,
+	matchCase: false,
+	matchSubset: true,
+	matchContains: false,
+	cacheLength: 10,
+	max: 100,
+	mustMatch: false,
+	extraParams: {},
+	selectFirst: true,
+	formatItem: function(row) { return row[0]; },
+	formatMatch: null,
+	autoFill: false,
+	width: 0,
+	multiple: false,
+	multipleSeparator: ", ",
+	highlight: function(value, term) {
+		return value.replace(new RegExp("(?![^&;]+;)(?!<[^<>]*)(" + term.replace(/([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi, "\\$1") + ")(?![^<>]*>)(?![^&;]+;)", "gi"), "<strong>$1</strong>");
+	},
+    scroll: true,
+    scrollHeight: 180
+$.Autocompleter.Cache = function(options) {
+	var data = {};
+	var length = 0;
+	function matchSubset(s, sub) {
+		if (!options.matchCase) 
+			s = s.toLowerCase();
+		var i = s.indexOf(sub);
+		if (options.matchContains == "word"){
+			i = s.toLowerCase().search("\\b" + sub.toLowerCase());
+		}
+		if (i == -1) return false;
+		return i == 0 || options.matchContains;
+	};
+	function add(q, value) {
+		if (length > options.cacheLength){
+			flush();
+		}
+		if (!data[q]){ 
+			length++;
+		}
+		data[q] = value;
+	}
+	function populate(){
+		if( !options.data ) return false;
+		// track the matches
+		var stMatchSets = {},
+			nullData = 0;
+		// no url was specified, we need to adjust the cache length to make sure it fits the local data store
+		if( !options.url ) options.cacheLength = 1;
+		// track all options for minChars = 0
+		stMatchSets[""] = [];
+		// loop through the array and create a lookup structure
+		for ( var i = 0, ol = options.data.length; i < ol; i++ ) {
+			var rawValue = options.data[i];
+			// if rawValue is a string, make an array otherwise just reference the array
+			rawValue = (typeof rawValue == "string") ? [rawValue] : rawValue;
+			var value = options.formatMatch(rawValue, i+1, options.data.length);
+			if ( value === false )
+				continue;
+			var firstChar = value.charAt(0).toLowerCase();
+			// if no lookup array for this character exists, look it up now
+			if( !stMatchSets[firstChar] ) 
+				stMatchSets[firstChar] = [];
+			// if the match is a string
+			var row = {
+				value: value,
+				data: rawValue,
+				result: options.formatResult && options.formatResult(rawValue) || value
+			};
+			// push the current match into the set list
+			stMatchSets[firstChar].push(row);
+			// keep track of minChars zero items
+			if ( nullData++ < options.max ) {
+				stMatchSets[""].push(row);
+			}
+		};
+		// add the data items to the cache
+		$.each(stMatchSets, function(i, value) {
+			// increase the cache size
+			options.cacheLength++;
+			// add to the cache
+			add(i, value);
+		});
+	}
+	// populate any existing data
+	setTimeout(populate, 25);
+	function flush(){
+		data = {};
+		length = 0;
+	}
+	return {
+		flush: flush,
+		add: add,
+		populate: populate,
+		load: function(q) {
+			if (!options.cacheLength || !length)
+				return null;
+			/* 
+			 * if dealing w/local data and matchContains than we must make sure
+			 * to loop through all the data collections looking for matches
+			 */
+			if( !options.url && options.matchContains ){
+				// track all matches
+				var csub = [];
+				// loop through all the data grids for matches
+				for( var k in data ){
+					// don't search through the stMatchSets[""] (minChars: 0) cache
+					// this prevents duplicates
+					if( k.length > 0 ){
+						var c = data[k];
+						$.each(c, function(i, x) {
+							// if we've got a match, add it to the array
+							if (matchSubset(x.value, q)) {
+								csub.push(x);
+							}
+						});
+					}
+				}				
+				return csub;
+			} else 
+			// if the exact item exists, use it
+			if (data[q]){
+				return data[q];
+			} else
+			if (options.matchSubset) {
+				for (var i = q.length - 1; i >= options.minChars; i--) {
+					var c = data[q.substr(0, i)];
+					if (c) {
+						var csub = [];
+						$.each(c, function(i, x) {
+							if (matchSubset(x.value, q)) {
+								csub[csub.length] = x;
+							}
+						});
+						return csub;
+					}
+				}
+			}
+			return null;
+		}
+	};
+$.Autocompleter.Select = function (options, input, select, config) {
+	var CLASSES = {
+		ACTIVE: "ac_over"
+	};
+	var listItems,
+		active = -1,
+		data,
+		term = "",
+		needsInit = true,
+		element,
+		list;
+	// Create results
+	function init() {
+		if (!needsInit)
+			return;
+		element = $("<div/>")
+		.hide()
+		.addClass(options.resultsClass)
+		.css("position", "absolute")
+		.appendTo(document.body);
+		list = $("<ul/>").appendTo(element).mouseover( function(event) {
+			if(target(event).nodeName && target(event).nodeName.toUpperCase() == 'LI') {
+	            active = $("li", list).removeClass(CLASSES.ACTIVE).index(target(event));
+			    $(target(event)).addClass(CLASSES.ACTIVE);            
+	        }
+		}).click(function(event) {
+			$(target(event)).addClass(CLASSES.ACTIVE);
+			select();
+			// TODO provide option to avoid setting focus again after selection? useful for cleanup-on-focus
+			input.focus();
+			return false;
+		}).mousedown(function() {
+			config.mouseDownOnSelect = true;
+		}).mouseup(function() {
+			config.mouseDownOnSelect = false;
+		});
+		if( options.width > 0 )
+			element.css("width", options.width);
+		needsInit = false;
+	} 
+	function target(event) {
+		var element = event.target;
+		while(element && element.tagName != "LI")
+			element = element.parentNode;
+		// more fun with IE, sometimes event.target is empty, just ignore it then
+		if(!element)
+			return [];
+		return element;
+	}
+	function moveSelect(step) {
+		listItems.slice(active, active + 1).removeClass(CLASSES.ACTIVE);
+		movePosition(step);
+        var activeItem = listItems.slice(active, active + 1).addClass(CLASSES.ACTIVE);
+        if(options.scroll) {
+            var offset = 0;
+            listItems.slice(0, active).each(function() {
+				offset += this.offsetHeight;
+			});
+            if((offset + activeItem[0].offsetHeight - list.scrollTop()) > list[0].clientHeight) {
+                list.scrollTop(offset + activeItem[0].offsetHeight - list.innerHeight());
+            } else if(offset < list.scrollTop()) {
+                list.scrollTop(offset);
+            }
+        }
+	};
+	function movePosition(step) {
+		active += step;
+		if (active < 0) {
+			active = listItems.size() - 1;
+		} else if (active >= listItems.size()) {
+			active = 0;
+		}
+	}
+	function limitNumberOfItems(available) {
+		return options.max && options.max < available
+			? options.max
+			: available;
+	}
+	function fillList() {
+		list.empty();
+		var max = limitNumberOfItems(data.length);
+		for (var i=0; i < max; i++) {
+			if (!data[i])
+				continue;
+			var formatted = options.formatItem(data[i].data, i+1, max, data[i].value, term);
+			if ( formatted === false )
+				continue;
+			var li = $("<li/>").html( options.highlight(formatted, term) ).addClass(i%2 == 0 ? "ac_even" : "ac_odd").appendTo(list)[0];
+			$.data(li, "ac_data", data[i]);
+		}
+		listItems = list.find("li");
+		if ( options.selectFirst ) {
+			listItems.slice(0, 1).addClass(CLASSES.ACTIVE);
+			active = 0;
+		}
+		// apply bgiframe if available
+		if ( $.fn.bgiframe )
+			list.bgiframe();
+	}
+	return {
+		display: function(d, q) {
+			init();
+			data = d;
+			term = q;
+			fillList();
+		},
+		next: function() {
+			moveSelect(1);
+		},
+		prev: function() {
+			moveSelect(-1);
+		},
+		pageUp: function() {
+			if (active != 0 && active - 8 < 0) {
+				moveSelect( -active );
+			} else {
+				moveSelect(-8);
+			}
+		},
+		pageDown: function() {
+			if (active != listItems.size() - 1 && active + 8 > listItems.size()) {
+				moveSelect( listItems.size() - 1 - active );
+			} else {
+				moveSelect(8);
+			}
+		},
+		hide: function() {
+			element && element.hide();
+			listItems && listItems.removeClass(CLASSES.ACTIVE);
+			active = -1;
+		},
+		visible : function() {
+			return element && element.is(":visible");
+		},
+		current: function() {
+			return this.visible() && (listItems.filter("." + CLASSES.ACTIVE)[0] || options.selectFirst && listItems[0]);
+		},
+		show: function() {
+			var offset = $(input).offset();
+			element.css({
+				width: typeof options.width == "string" || options.width > 0 ? options.width : $(input).width(),
+				top: offset.top + input.offsetHeight,
+				left: offset.left
+			}).show();
+            if(options.scroll) {
+                list.scrollTop(0);
+                list.css({
+					maxHeight: options.scrollHeight,
+					overflow: 'auto'
+				});
+                if($.browser.msie && typeof document.body.style.maxHeight === "undefined") {
+					var listHeight = 0;
+					listItems.each(function() {
+						listHeight += this.offsetHeight;
+					});
+					var scrollbarsVisible = listHeight > options.scrollHeight;
+                    list.css('height', scrollbarsVisible ? options.scrollHeight : listHeight );
+					if (!scrollbarsVisible) {
+						// IE doesn't recalculate width when scrollbar disappears
+						listItems.width( list.width() - parseInt(listItems.css("padding-left")) - parseInt(listItems.css("padding-right")) );
+					}
+                }
+            }
+		},
+		selected: function() {
+			var selected = listItems && listItems.filter("." + CLASSES.ACTIVE).removeClass(CLASSES.ACTIVE);
+			return selected && selected.length && $.data(selected[0], "ac_data");
+		},
+		emptyList: function (){
+			list && list.empty();
+		},
+		unbind: function() {
+			element && element.remove();
+		}
+	};
+$.fn.selection = function(start, end) {
+	if (start !== undefined) {
+		return this.each(function() {
+			if( this.createTextRange ){
+				var selRange = this.createTextRange();
+				if (end === undefined || start == end) {
+					selRange.move("character", start);
+					selRange.select();
+				} else {
+					selRange.collapse(true);
+					selRange.moveStart("character", start);
+					selRange.moveEnd("character", end);
+					selRange.select();
+				}
+			} else if( this.setSelectionRange ){
+				this.setSelectionRange(start, end);
+			} else if( this.selectionStart ){
+				this.selectionStart = start;
+				this.selectionEnd = end;
+			}
+		});
+	}
+	var field = this[0];
+	if ( field.createTextRange ) {
+		var range = document.selection.createRange(),
+			orig = field.value,
+			teststring = "<->",
+			textLength = range.text.length;
+		range.text = teststring;
+		var caretAt = field.value.indexOf(teststring);
+		field.value = orig;
+		this.selection(caretAt, caretAt + textLength);
+		return {
+			start: caretAt,
+			end: caretAt + textLength
+		}
+	} else if( field.selectionStart !== undefined ){
+		return {
+			start: field.selectionStart,
+			end: field.selectionEnd
+		}
+	}
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/jquery.autocomplete.min.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,13 @@
+ * jQuery Autocomplete plugin 1.1
+ *
+ * Copyright (c) 2009 Jörn Zaefferer
+ *
+ * Dual licensed under the MIT and GPL licenses:
+ *   http://www.opensource.org/licenses/mit-license.php
+ *   http://www.gnu.org/licenses/gpl.html
+ *
+ * Revision: $Id: jquery.autocomplete.js 15 2009-08-22 10:30:27Z joern.zaefferer $
+ */;(function($){$.fn.extend({autocomplete:function(urlOrData,options){var isUrl=typeof urlOrData=="string";options=$.extend({},$.Autocompleter.defaults,{url:isUrl?urlOrData:null,data:isUrl?null:urlOrData,delay:isUrl?$.Autocompleter.defaults.delay:10,max:options&&!options.scroll?10:150},options);options.highlight=options.highlight||function(value){return value;};options.formatMatch=options.formatMatch||options.formatItem;return this.each(function(){new $.Autocompleter(this,options);});},result:function(handler){return this.bind("result",handler);},search:function(handler){return this.trigger("search",[handler]);},flushCache:function(){return this.trigger("flushCache");},setOptions:function(options){return this.trigger("setOptions",[options]);},unautocomplete:function(){return this.trigger("unautocomplete");}});$.Autocompleter=function(input,options){var KEY={UP:38,DOWN:40,DEL:46,TAB:9,RETURN:13,ESC:27,COMMA:188,PAGEUP:33,PAGEDOWN:34,BACKSPACE:8};var $input=$(input).attr("autocomplete","off").addClass(options.inputClass);var timeout;var previousValue="";var cache=$.Autocompleter.Cache(options);var hasFocus=0;var lastKeyPressCode;var config={mouseDownOnSelect:false};var select=$.Autocompleter.Select(options,input,selectCurrent,config);var blockSubmit;$.browser.opera&&$(input.form).bind("submit.autocomplete",function(){if(blockSubmit){blockSubmit=false;return false;}});$input.bind(($.browser.opera?"keypress":"keydown")+".autocomplete",function(event){hasFocus=1;lastKeyPressCode=event.keyCode;switch(event.keyCode){case KEY.UP:event.preventDefault();if(select.visible()){select.prev();}else{onChange(0,true);}break;case KEY.DOWN:event.preventDefault();if(select.visible()){select.next();}else{onChange(0,true);}break;case KEY.PAGEUP:event.preventDefault();if(select.visible()){select.pageUp();}else{onChange(0,true);}break;case KEY.PAGEDOWN:event.preventDefault();if(select.visible()){select.pageDown();}else{onChange(0,true);}break;case options.multiple&&$.trim(options.multipleSeparator)==","&&KEY.COMMA:case KEY.TAB:case KEY.RETURN:if(selectCurrent()){event.preventDefault();blockSubmit=true;return false;}break;case KEY.ESC:select.hide();break;default:clearTimeout(timeout);timeout=setTimeout(onChange,options.delay);break;}}).focus(function(){hasFocus++;}).blur(function(){hasFocus=0;if(!config.mouseDownOnSelect){hideResults();}}).click(function(){if(hasFocus++>1&&!select.visible()){onChange(0,true);}}).bind("search",function(){var fn=(arguments.length>1)?arguments[1]:null;function findValueCallback(q,data){var result;if(data&&data.length){for(var i=0;i<data.length;i++){if(data[i].result.toLowerCase()==q.toLowerCase()){result=data[i];break;}}}if(typeof fn=="function")fn(result);else $input.trigger("result",result&&[result.data,result.value]);}$.each(trimWords($input.val()),function(i,value){request(value,findValueCallback,findValueCallback);});}).bind("flushCache",function(){cache.flush();}).bind("setOptions",function(){$.extend(options,arguments[1]);if("data"in arguments[1])cache.populate();}).bind("unautocomplete",function(){select.unbind();$input.unbind();$(input.form).unbind(".autocomplete");});function selectCurrent(){var selected=select.selected();if(!selected)return false;var v=selected.result;previousValue=v;if(options.multiple){var words=trimWords($input.val());if(words.length>1){var seperator=options.multipleSeparator.length;var cursorAt=$(input).selection().start;var wordAt,progress=0;$.each(words,function(i,word){progress+=word.length;if(cursorAt<=progress){wordAt=i;return false;}progress+=seperator;});words[wordAt]=v;v=words.join(options.multipleSeparator);}v+=options.multipleSeparator;}$input.val(v);hideResultsNow();$input.trigger("result",[selected.data,selected.value]);return true;}function onChange(crap,skipPrevCheck){if(lastKeyPressCode==KEY.DEL){select.hide();return;}var currentValue=$input.val();if(!skipPrevCheck&&currentValue==previousValue)return;previousValue=currentValue;currentValue=lastWord(currentValue);if(currentValue.length>=options.minChars){$input.addClass(options.loadingClass);if(!options.matchCase)currentValue=currentValue.toLowerCase();request(currentValue,receiveData,hideResultsNow);}else{stopLoading();select.hide();}};function trimWords(value){if(!value)return[""];if(!options.multiple)return[$.trim(value)];return $.map(value.split(options.multipleSeparator),function(word){return $.trim(value).length?$.trim(word):null;});}function lastWord(value){if(!options.multiple)return value;var words=trimWords(value);if(words.length==1)return words[0];var cursorAt=$(input).selection().start;if(cursorAt==value.length){words=trimWords(value)}else{words=trimWords(value.replace(value.substring(cursorAt),""));}return words[words.length-1];}function autoFill(q,sValue){if(options.autoFill&&(lastWord($input.val()).toLowerCase()==q.toLowerCase())&&lastKeyPressCode!=KEY.BACKSPACE){$input.val($input.val()+sValue.substring(lastWord(previousValue).length));$(input).selection(previousValue.length,previousValue.length+sValue.length);}};function hideResults(){clearTimeout(timeout);timeout=setTimeout(hideResultsNow,200);};function hideResultsNow(){var wasVisible=select.visible();select.hide();clearTimeout(timeout);stopLoading();if(options.mustMatch){$input.search(function(result){if(!result){if(options.multiple){var words=trimWords($input.val()).slice(0,-1);$input.val(words.join(options.multipleSeparator)+(words.length?options.multipleSeparator:""));}else{$input.val("");$input.trigger("result",null);}}});}};function receiveData(q,data){if(data&&data.length&&hasFocus){stopLoading();select.display(data,q);autoFill(q,data[0].value);select.show();}else{hideResultsNow();}};function request(term,success,failure){if(!options.matchCase)term=term.toLowerCase();var data=cache.load(term);if(data&&data.length){success(term,data);}else if((typeof options.url=="string")&&(options.url.length>0)){var extraParams={timestamp:+new Date()};$.each(options.extraParams,function(key,param){extraParams[key]=typeof param=="function"?param():param;});$.ajax({mode:"abort",port:"autocomplete"+input.name,dataType:options.dataType,url:options.url,data:$.extend({q:lastWord(term),limit:options.max},extraParams),success:function(data){var parsed=options.parse&&options.parse(data)||parse(data);cache.add(term,parsed);success(term,parsed);}});}else{select.emptyList();failure(term);}};function parse(data){var parsed=[];var rows=data.split("\n");for(var i=0;i<rows.length;i++){var row=$.trim(rows[i]);if(row){row=row.split("|");parsed[parsed.length]={data:row,value:row[0],result:options.formatResult&&options.formatResult(row,row[0])||row[0]};}}return parsed;};function stopLoading(){$input.removeClass(options.loadingClass);};};$.Autocompleter.defaults={inputClass:"ac_input",resultsClass:"ac_results",loadingClass:"ac_loading",minChars:1,delay:400,matchCase:false,matchSubset:true,matchContains:false,cacheLength:10,max:100,mustMatch:false,extraParams:{},selectFirst:true,formatItem:function(row){return row[0];},formatMatch:null,autoFill:false,width:0,multiple:false,multipleSeparator:", ",highlight:function(value,term){return value.replace(new RegExp("(?![^&;]+;)(?!<[^<>]*)("+term.replace(/([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi,"\\$1")+")(?![^<>]*>)(?![^&;]+;)","gi"),"<strong>$1</strong>");},scroll:true,scrollHeight:180};$.Autocompleter.Cache=function(options){var data={};var length=0;function matchSubset(s,sub){if(!options.matchCase)s=s.toLowerCase();var i=s.indexOf(sub);if(options.matchContains=="word"){i=s.toLowerCase().search("\\b"+sub.toLowerCase());}if(i==-1)return false;return i==0||options.matchContains;};function add(q,value){if(length>options.cacheLength){flush();}if(!data[q]){length++;}data[q]=value;}function populate(){if(!options.data)return false;var stMatchSets={},nullData=0;if(!options.url)options.cacheLength=1;stMatchSets[""]=[];for(var i=0,ol=options.data.length;i<ol;i++){var rawValue=options.data[i];rawValue=(typeof rawValue=="string")?[rawValue]:rawValue;var value=options.formatMatch(rawValue,i+1,options.data.length);if(value===false)continue;var firstChar=value.charAt(0).toLowerCase();if(!stMatchSets[firstChar])stMatchSets[firstChar]=[];var row={value:value,data:rawValue,result:options.formatResult&&options.formatResult(rawValue)||value};stMatchSets[firstChar].push(row);if(nullData++<options.max){stMatchSets[""].push(row);}};$.each(stMatchSets,function(i,value){options.cacheLength++;add(i,value);});}setTimeout(populate,25);function flush(){data={};length=0;}return{flush:flush,add:add,populate:populate,load:function(q){if(!options.cacheLength||!length)return null;if(!options.url&&options.matchContains){var csub=[];for(var k in data){if(k.length>0){var c=data[k];$.each(c,function(i,x){if(matchSubset(x.value,q)){csub.push(x);}});}}return csub;}else
+if(data[q]){return data[q];}else
+if(options.matchSubset){for(var i=q.length-1;i>=options.minChars;i--){var c=data[q.substr(0,i)];if(c){var csub=[];$.each(c,function(i,x){if(matchSubset(x.value,q)){csub[csub.length]=x;}});return csub;}}}return null;}};};$.Autocompleter.Select=function(options,input,select,config){var CLASSES={ACTIVE:"ac_over"};var listItems,active=-1,data,term="",needsInit=true,element,list;function init(){if(!needsInit)return;element=$("<div/>").hide().addClass(options.resultsClass).css("position","absolute").appendTo(document.body);list=$("<ul/>").appendTo(element).mouseover(function(event){if(target(event).nodeName&&target(event).nodeName.toUpperCase()=='LI'){active=$("li",list).removeClass(CLASSES.ACTIVE).index(target(event));$(target(event)).addClass(CLASSES.ACTIVE);}}).click(function(event){$(target(event)).addClass(CLASSES.ACTIVE);select();input.focus();return false;}).mousedown(function(){config.mouseDownOnSelect=true;}).mouseup(function(){config.mouseDownOnSelect=false;});if(options.width>0)element.css("width",options.width);needsInit=false;}function target(event){var element=event.target;while(element&&element.tagName!="LI")element=element.parentNode;if(!element)return[];return element;}function moveSelect(step){listItems.slice(active,active+1).removeClass(CLASSES.ACTIVE);movePosition(step);var activeItem=listItems.slice(active,active+1).addClass(CLASSES.ACTIVE);if(options.scroll){var offset=0;listItems.slice(0,active).each(function(){offset+=this.offsetHeight;});if((offset+activeItem[0].offsetHeight-list.scrollTop())>list[0].clientHeight){list.scrollTop(offset+activeItem[0].offsetHeight-list.innerHeight());}else if(offset<list.scrollTop()){list.scrollTop(offset);}}};function movePosition(step){active+=step;if(active<0){active=listItems.size()-1;}else if(active>=listItems.size()){active=0;}}function limitNumberOfItems(available){return options.max&&options.max<available?options.max:available;}function fillList(){list.empty();var max=limitNumberOfItems(data.length);for(var i=0;i<max;i++){if(!data[i])continue;var formatted=options.formatItem(data[i].data,i+1,max,data[i].value,term);if(formatted===false)continue;var li=$("<li/>").html(options.highlight(formatted,term)).addClass(i%2==0?"ac_even":"ac_odd").appendTo(list)[0];$.data(li,"ac_data",data[i]);}listItems=list.find("li");if(options.selectFirst){listItems.slice(0,1).addClass(CLASSES.ACTIVE);active=0;}if($.fn.bgiframe)list.bgiframe();}return{display:function(d,q){init();data=d;term=q;fillList();},next:function(){moveSelect(1);},prev:function(){moveSelect(-1);},pageUp:function(){if(active!=0&&active-8<0){moveSelect(-active);}else{moveSelect(-8);}},pageDown:function(){if(active!=listItems.size()-1&&active+8>listItems.size()){moveSelect(listItems.size()-1-active);}else{moveSelect(8);}},hide:function(){element&&element.hide();listItems&&listItems.removeClass(CLASSES.ACTIVE);active=-1;},visible:function(){return element&&element.is(":visible");},current:function(){return this.visible()&&(listItems.filter("."+CLASSES.ACTIVE)[0]||options.selectFirst&&listItems[0]);},show:function(){var offset=$(input).offset();element.css({width:typeof options.width=="string"||options.width>0?options.width:$(input).width(),top:offset.top+input.offsetHeight,left:offset.left}).show();if(options.scroll){list.scrollTop(0);list.css({maxHeight:options.scrollHeight,overflow:'auto'});if($.browser.msie&&typeof document.body.style.maxHeight==="undefined"){var listHeight=0;listItems.each(function(){listHeight+=this.offsetHeight;});var scrollbarsVisible=listHeight>options.scrollHeight;list.css('height',scrollbarsVisible?options.scrollHeight:listHeight);if(!scrollbarsVisible){listItems.width(list.width()-parseInt(listItems.css("padding-left"))-parseInt(listItems.css("padding-right")));}}}},selected:function(){var selected=listItems&&listItems.filter("."+CLASSES.ACTIVE).removeClass(CLASSES.ACTIVE);return selected&&selected.length&&$.data(selected[0],"ac_data");},emptyList:function(){list&&list.empty();},unbind:function(){element&&element.remove();}};};$.fn.selection=function(start,end){if(start!==undefined){return this.each(function(){if(this.createTextRange){var selRange=this.createTextRange();if(end===undefined||start==end){selRange.move("character",start);selRange.select();}else{selRange.collapse(true);selRange.moveStart("character",start);selRange.moveEnd("character",end);selRange.select();}}else if(this.setSelectionRange){this.setSelectionRange(start,end);}else if(this.selectionStart){this.selectionStart=start;this.selectionEnd=end;}});}var field=this[0];if(field.createTextRange){var range=document.selection.createRange(),orig=field.value,teststring="<->",textLength=range.text.length;range.text=teststring;var caretAt=field.value.indexOf(teststring);field.value=orig;this.selection(caretAt,caretAt+textLength);return{start:caretAt,end:caretAt+textLength}}else if(field.selectionStart!==undefined){return{start:field.selectionStart,end:field.selectionEnd}}};})(jQuery);
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/jquery.autocomplete.pack.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,12 @@
+ * jQuery Autocomplete plugin 1.1
+ *
+ * Copyright (c) 2009 Jörn Zaefferer
+ *
+ * Dual licensed under the MIT and GPL licenses:
+ *   http://www.opensource.org/licenses/mit-license.php
+ *   http://www.gnu.org/licenses/gpl.html
+ *
+ * Revision: $Id: jquery.autocomplete.js 15 2009-08-22 10:30:27Z joern.zaefferer $
+ */
+eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}(';(3($){$.2e.1u({19:3(b,d){5 c=W b=="1B";d=$.1u({},$.M.1T,{Y:c?b:P,y:c?P:b,1J:c?$.M.1T.1J:10,X:d&&!d.1D?10:48},d);d.1y=d.1y||3(a){6 a};d.1v=d.1v||d.1R;6 A.I(3(){1M $.M(A,d)})},L:3(a){6 A.11("L",a)},1k:3(a){6 A.14("1k",[a])},2b:3(){6 A.14("2b")},28:3(a){6 A.14("28",[a])},24:3(){6 A.14("24")}});$.M=3(o,r){5 t={2Y:38,2S:40,2N:46,2I:9,2E:13,2B:27,2x:3I,2v:33,2p:34,2n:8};5 u=$(o).3r("19","3o").Q(r.2Q);5 p;5 m="";5 n=$.M.3c(r);5 s=0;5 k;5 h={1F:C};5 l=$.M.32(r,o,1Z,h);5 j;$.1Y.2X&&$(o.2U).11("45.19",3(){4(j){j=C;6 C}});u.11(($.1Y.2X?"43":"42")+".19",3(a){s=1;k=a.2M;3V(a.2M){O t.2Y:a.1d();4(l.N()){l.30()}w{12(0,D)}R;O t.2S:a.1d();4(l.N()){l.2D()}w{12(0,D)}R;O t.2v:a.1d();4(l.N()){l.2C()}w{12(0,D)}R;O t.2p:a.1d();4(l.N()){l.2A()}w{12(0,D)}R;O r.17&&$.1c(r.S)==","&&t.2x:O t.2I:O t.2E:4(1Z()){a.1d();j=D;6 C}R;O t.2B:l.Z();R;3J:1P(p);p=1O(12,r.1J);R}}).2t(3(){s++}).3E(3(){s=0;4(!h.1F){2r()}}).2q(3(){4(s++>1&&!l.N()){12(0,D)}}).11("1k",3(){5 c=(1r.7>1)?1r[1]:P;3 1N(q,a){5 b;4(a&&a.7){16(5 i=0;i<a.7;i++){4(a[i].L.J()==q.J()){b=a[i];R}}}4(W c=="3")c(b);w u.14("L",b&&[b.y,b.F])}$.I(15(u.K()),3(i,a){21(a,1N,1N)})}).11("2b",3(){n.1o()}).11("28",3(){$.1u(r,1r[1]);4("y"2h 1r[1])n.1e()}).11("24",3(){l.1p();u.1p();$(o.2U).1p(".19")});3 1Z(){5 e=l.2g();4(!e)6 C;5 v=e.L;m=v;4(r.17){5 b=15(u.K());4(b.7>1){5 f=r.S.7;5 c=$(o).18().1I;5 d,1H=0;$.I(b,3(i,a){1H+=a.7;4(c<=1H){d=i;6 C}1H+=f});b[d]=v;v=b.3f(r.S)}v+=r.S}u.K(v);1l();u.14("L",[e.y,e.F]);6 D}3 12(b,c){4(k==t.2N){l.Z();6}5 a=u.K();4(!c&&a==m)6;m=a;a=1m(a);4(a.7>=r.29){u.Q(r.26);4(!r.1s)a=a.J();21(a,3a,1l)}w{1q();l.Z()}};3 15(b){4(!b)6[""];4(!r.17)6[$.1c(b)];6 $.4h(b.23(r.S),3(a){6 $.1c(b).7?$.1c(a):P})}3 1m(a){4(!r.17)6 a;5 c=15(a);4(c.7==1)6 c[0];5 b=$(o).18().1I;4(b==a.7){c=15(a)}w{c=15(a.22(a.37(b),""))}6 c[c.7-1]}3 1G(q,a){4(r.1G&&(1m(u.K()).J()==q.J())&&k!=t.2n){u.K(u.K()+a.37(1m(m).7));$(o).18(m.7,m.7+a.7)}};3 2r(){1P(p);p=1O(1l,4g)};3 1l(){5 c=l.N();l.Z();1P(p);1q();4(r.36){u.1k(3(a){4(!a){4(r.17){5 b=15(u.K()).1n(0,-1);u.K(b.3f(r.S)+(b.7?r.S:""))}w{u.K("");u.14("L",P)}}})}};3 3a(q,a){4(a&&a.7&&s){1q();l.35(a,q);1G(q,a[0].F);l.20()}w{1l()}};3 21(f,d,g){4(!r.1s)f=f.J();5 e=n.31(f);4(e&&e.7){d(f,e)}w 4((W r.Y=="1B")&&(r.Y.7>0)){5 c={4f:+1M 4e()};$.I(r.2Z,3(a,b){c[a]=W b=="3"?b():b});$.4d({4c:"4b",4a:"19"+o.49,2V:r.2V,Y:r.Y,y:$.1u({q:1m(f),47:r.X},c),44:3(a){5 b=r.1A&&r.1A(a)||1A(a);n.1i(f,b);d(f,b)}})}w{l.2T();g(f)}};3 1A(c){5 d=[];5 b=c.23("\\n");16(5 i=0;i<b.7;i++){5 a=$.1c(b[i]);4(a){a=a.23("|");d[d.7]={y:a,F:a[0],L:r.1z&&r.1z(a,a[0])||a[0]}}}6 d};3 1q(){u.1h(r.26)}};$.M.1T={2Q:"41",2P:"3Z",26:"3Y",29:1,1J:3W,1s:C,1f:D,1w:C,1g:10,X:3U,36:C,2Z:{},1X:D,1R:3(a){6 a[0]},1v:P,1G:C,E:0,17:C,S:", ",1y:3(b,a){6 b.22(1M 3T("(?![^&;]+;)(?!<[^<>]*)("+a.22(/([\\^\\$\\(\\)\\[\\]\\{\\}\\*\\.\\+\\?\\|\\\\])/2K,"\\\\$1")+")(?![^<>]*>)(?![^&;]+;)","2K"),"<2J>$1</2J>")},1D:D,1E:3S};$.M.3c=3(g){5 h={};5 j=0;3 1f(s,a){4(!g.1s)s=s.J();5 i=s.2H(a);4(g.1w=="3R"){i=s.J().1k("\\\\b"+a.J())}4(i==-1)6 C;6 i==0||g.1w};3 1i(q,a){4(j>g.1g){1o()}4(!h[q]){j++}h[q]=a}3 1e(){4(!g.y)6 C;5 f={},2G=0;4(!g.Y)g.1g=1;f[""]=[];16(5 i=0,2F=g.y.7;i<2F;i++){5 c=g.y[i];c=(W c=="1B")?[c]:c;5 d=g.1v(c,i+1,g.y.7);4(d===C)1V;5 e=d.3Q(0).J();4(!f[e])f[e]=[];5 b={F:d,y:c,L:g.1z&&g.1z(c)||d};f[e].1U(b);4(2G++<g.X){f[""].1U(b)}};$.I(f,3(i,a){g.1g++;1i(i,a)})}1O(1e,25);3 1o(){h={};j=0}6{1o:1o,1i:1i,1e:1e,31:3(q){4(!g.1g||!j)6 P;4(!g.Y&&g.1w){5 a=[];16(5 k 2h h){4(k.7>0){5 c=h[k];$.I(c,3(i,x){4(1f(x.F,q)){a.1U(x)}})}}6 a}w 4(h[q]){6 h[q]}w 4(g.1f){16(5 i=q.7-1;i>=g.29;i--){5 c=h[q.3O(0,i)];4(c){5 a=[];$.I(c,3(i,x){4(1f(x.F,q)){a[a.7]=x}});6 a}}}6 P}}};$.M.32=3(e,g,f,k){5 h={H:"3N"};5 j,z=-1,y,1t="",1S=D,G,B;3 2y(){4(!1S)6;G=$("<3M/>").Z().Q(e.2P).T("3L","3K").1Q(1K.2w);B=$("<3H/>").1Q(G).3G(3(a){4(U(a).2u&&U(a).2u.3F()==\'2s\'){z=$("1L",B).1h(h.H).3D(U(a));$(U(a)).Q(h.H)}}).2q(3(a){$(U(a)).Q(h.H);f();g.2t();6 C}).3C(3(){k.1F=D}).3B(3(){k.1F=C});4(e.E>0)G.T("E",e.E);1S=C}3 U(a){5 b=a.U;3A(b&&b.3z!="2s")b=b.3y;4(!b)6[];6 b}3 V(b){j.1n(z,z+1).1h(h.H);2o(b);5 a=j.1n(z,z+1).Q(h.H);4(e.1D){5 c=0;j.1n(0,z).I(3(){c+=A.1a});4((c+a[0].1a-B.1b())>B[0].3x){B.1b(c+a[0].1a-B.3w())}w 4(c<B.1b()){B.1b(c)}}};3 2o(a){z+=a;4(z<0){z=j.1j()-1}w 4(z>=j.1j()){z=0}}3 2m(a){6 e.X&&e.X<a?e.X:a}3 2l(){B.2z();5 b=2m(y.7);16(5 i=0;i<b;i++){4(!y[i])1V;5 a=e.1R(y[i].y,i+1,b,y[i].F,1t);4(a===C)1V;5 c=$("<1L/>").3v(e.1y(a,1t)).Q(i%2==0?"3u":"3P").1Q(B)[0];$.y(c,"2k",y[i])}j=B.3t("1L");4(e.1X){j.1n(0,1).Q(h.H);z=0}4($.2e.2W)B.2W()}6{35:3(d,q){2y();y=d;1t=q;2l()},2D:3(){V(1)},30:3(){V(-1)},2C:3(){4(z!=0&&z-8<0){V(-z)}w{V(-8)}},2A:3(){4(z!=j.1j()-1&&z+8>j.1j()){V(j.1j()-1-z)}w{V(8)}},Z:3(){G&&G.Z();j&&j.1h(h.H);z=-1},N:3(){6 G&&G.3s(":N")},3q:3(){6 A.N()&&(j.2j("."+h.H)[0]||e.1X&&j[0])},20:3(){5 a=$(g).3p();G.T({E:W e.E=="1B"||e.E>0?e.E:$(g).E(),2i:a.2i+g.1a,1W:a.1W}).20();4(e.1D){B.1b(0);B.T({2L:e.1E,3n:\'3X\'});4($.1Y.3m&&W 1K.2w.3l.2L==="1x"){5 c=0;j.I(3(){c+=A.1a});5 b=c>e.1E;B.T(\'3k\',b?e.1E:c);4(!b){j.E(B.E()-2R(j.T("2O-1W"))-2R(j.T("2O-3j")))}}}},2g:3(){5 a=j&&j.2j("."+h.H).1h(h.H);6 a&&a.7&&$.y(a[0],"2k")},2T:3(){B&&B.2z()},1p:3(){G&&G.3i()}}};$.2e.18=3(b,f){4(b!==1x){6 A.I(3(){4(A.2d){5 a=A.2d();4(f===1x||b==f){a.4n("2c",b);a.3h()}w{a.4m(D);a.4l("2c",b);a.4k("2c",f);a.3h()}}w 4(A.3g){A.3g(b,f)}w 4(A.1C){A.1C=b;A.3e=f}})}5 c=A[0];4(c.2d){5 e=1K.18.4j(),3d=c.F,2a="<->",2f=e.3b.7;e.3b=2a;5 d=c.F.2H(2a);c.F=3d;A.18(d,d+2f);6{1I:d,39:d+2f}}w 4(c.1C!==1x){6{1I:c.1C,39:c.3e}}}})(4i);',62,272,'|||function|if|var|return|length|||||||||||||||||||||||||else||data|active|this|list|false|true|width|value|element|ACTIVE|each|toLowerCase|val|result|Autocompleter|visible|case|null|addClass|break|multipleSeparator|css|target|moveSelect|typeof|max|url|hide||bind|onChange||trigger|trimWords|for|multiple|selection|autocomplete|offsetHeight|scrollTop|trim|preventDefault|populate|matchSubset|cacheLength|removeClass|add|size|search|hideResultsNow|lastWord|slice|flush|unbind|stopLoading|arguments|matchCase|term|extend|formatMatch|matchContains|undefined|highlight|formatResult|parse|string|selectionStart|scroll|scrollHeight|mouseDownOnSelect|autoFill|progress|start|delay|document|li|new|findValueCallback|setTimeout|clearTimeout|appendTo|formatItem|needsInit|defaults|push|continue|left|selectFirst|browser|selectCurrent|show|request|replace|split|unautocomplete||loadingClass||setOptions|minChars|teststring|flushCache|character|createTextRange|fn|textLength|selected|in|top|filter|ac_data|fillList|limitNumberOfItems|BACKSPACE|movePosition|PAGEDOWN|click|hideResults|LI|focus|nodeName|PAGEUP|body|COMMA|init|empty|pageDown|ESC|pageUp|next|RETURN|ol|nullData|indexOf|TAB|strong|gi|maxHeight|keyCode|DEL|padding|resultsClass|inputClass|parseInt|DOWN|emptyList|form|dataType|bgiframe|opera|UP|extraParams|prev|load|Select|||display|mustMatch|substring||end|receiveData|text|Cache|orig|selectionEnd|join|setSelectionRange|select|remove|right|height|style|msie|overflow|off|offset|current|attr|is|find|ac_even|html|innerHeight|clientHeight|parentNode|tagName|while|mouseup|mousedown|index|blur|toUpperCase|mouseover|ul|188|default|absolute|position|div|ac_over|substr|ac_odd|charAt|word|180|RegExp|100|switch|400|auto|ac_loading|ac_results||ac_input|keydown|keypress|success|submit||limit|150|name|port|abort|mode|ajax|Date|timestamp|200|map|jQuery|createRange|moveEnd|moveStart|collapse|move'.split('|'),0,{}))
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/lib/jquery.ajaxQueue.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,116 @@
+ * Ajax Queue Plugin
+ * 
+ * Homepage: http://jquery.com/plugins/project/ajaxqueue
+ * Documentation: http://docs.jquery.com/AjaxQueue
+ */
+	jQuery.ajaxQueue({
+		url: "test.php",
+		success: function(html){ jQuery("ul").append(html); }
+	});
+	jQuery.ajaxQueue({
+		url: "test.php",
+		success: function(html){ jQuery("ul").append(html); }
+	});
+	jQuery.ajaxSync({
+		url: "test.php",
+		success: function(html){ jQuery("ul").append("<b>"+html+"</b>"); }
+	});
+	jQuery.ajaxSync({
+		url: "test.php",
+		success: function(html){ jQuery("ul").append("<b>"+html+"</b>"); }
+	});
+<ul style="position: absolute; top: 5px; right: 5px;"></ul>
+ */
+ * Queued Ajax requests.
+ * A new Ajax request won't be started until the previous queued 
+ * request has finished.
+ */
+ * Synced Ajax requests.
+ * The Ajax request will happen as soon as you call this method, but
+ * the callbacks (success/error/complete) won't fire until all previous
+ * synced requests have been completed.
+ */
+(function($) {
+	var ajax = $.ajax;
+	var pendingRequests = {};
+	var synced = [];
+	var syncedData = [];
+	$.ajax = function(settings) {
+		// create settings for compatibility with ajaxSetup
+		settings = jQuery.extend(settings, jQuery.extend({}, jQuery.ajaxSettings, settings));
+		var port = settings.port;
+		switch(settings.mode) {
+		case "abort": 
+			if ( pendingRequests[port] ) {
+				pendingRequests[port].abort();
+			}
+			return pendingRequests[port] = ajax.apply(this, arguments);
+		case "queue": 
+			var _old = settings.complete;
+			settings.complete = function(){
+				if ( _old )
+					_old.apply( this, arguments );
+				jQuery([ajax]).dequeue("ajax" + port );;
+			};
+			jQuery([ ajax ]).queue("ajax" + port, function(){
+				ajax( settings );
+			});
+			return;
+		case "sync":
+			var pos = synced.length;
+			synced[ pos ] = {
+				error: settings.error,
+				success: settings.success,
+				complete: settings.complete,
+				done: false
+			};
+			syncedData[ pos ] = {
+				error: [],
+				success: [],
+				complete: []
+			};
+			settings.error = function(){ syncedData[ pos ].error = arguments; };
+			settings.success = function(){ syncedData[ pos ].success = arguments; };
+			settings.complete = function(){
+				syncedData[ pos ].complete = arguments;
+				synced[ pos ].done = true;
+				if ( pos == 0 || !synced[ pos-1 ] )
+					for ( var i = pos; i < synced.length && synced[i].done; i++ ) {
+						if ( synced[i].error ) synced[i].error.apply( jQuery, syncedData[i].error );
+						if ( synced[i].success ) synced[i].success.apply( jQuery, syncedData[i].success );
+						if ( synced[i].complete ) synced[i].complete.apply( jQuery, syncedData[i].complete );
+						synced[i] = null;
+						syncedData[i] = null;
+					}
+			};
+		}
+		return ajax.apply(this, arguments);
+	};
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/lib/jquery.bgiframe.min.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,10 @@
+/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net)
+ * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php) 
+ * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
+ *
+ * $LastChangedDate: 2007-07-22 01:45:56 +0200 (Son, 22 Jul 2007) $
+ * $Rev: 2447 $
+ *
+ * Version 2.1.1
+ */
+(function($){$.fn.bgIframe=$.fn.bgiframe=function(s){if($.browser.msie&&/6.0/.test(navigator.userAgent)){s=$.extend({top:'auto',left:'auto',width:'auto',height:'auto',opacity:true,src:'javascript:false;'},s||{});var prop=function(n){return n&&n.constructor==Number?n+'px':n;},html='<iframe class="bgiframe"frameborder="0"tabindex="-1"src="'+s.src+'"'+'style="display:block;position:absolute;z-index:-1;'+(s.opacity!==false?'filter:Alpha(Opacity=\'0\');':'')+'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+'"/>';return this.each(function(){if($('> iframe.bgiframe',this).length==0)this.insertBefore(document.createElement(html),this.firstChild);});}return this;};})(jQuery);
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/lib/jquery.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,3558 @@
+ * jQuery 1.2.6 - New Wave Javascript
+ *
+ * Copyright (c) 2008 John Resig (jquery.com)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * $Date: 2008-05-27 21:17:26 +0200 (Di, 27 Mai 2008) $
+ * $Rev: 5700 $
+ */
+// Map over jQuery in case of overwrite
+var _jQuery = window.jQuery,
+// Map over the $ in case of overwrite
+	_$ = window.$;
+var jQuery = window.jQuery = window.$ = function( selector, context ) {
+	// The jQuery object is actually just the init constructor 'enhanced'
+	return new jQuery.fn.init( selector, context );
+// A simple way to check for HTML strings or ID strings
+// (both of which we optimize for)
+var quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#(\w+)$/,
+// Is it a simple selector
+	isSimple = /^.[^:#\[\.]*$/,
+// Will speed up references to undefined, and allows munging its name.
+	undefined;
+jQuery.fn = jQuery.prototype = {
+	init: function( selector, context ) {
+		// Make sure that a selection was provided
+		selector = selector || document;
+		// Handle $(DOMElement)
+		if ( selector.nodeType ) {
+			this[0] = selector;
+			this.length = 1;
+			return this;
+		}
+		// Handle HTML strings
+		if ( typeof selector == "string" ) {
+			// Are we dealing with HTML string or an ID?
+			var match = quickExpr.exec( selector );
+			// Verify a match, and that no context was specified for #id
+			if ( match && (match[1] || !context) ) {
+				// HANDLE: $(html) -> $(array)
+				if ( match[1] )
+					selector = jQuery.clean( [ match[1] ], context );
+				// HANDLE: $("#id")
+				else {
+					var elem = document.getElementById( match[3] );
+					// Make sure an element was located
+					if ( elem ){
+						// Handle the case where IE and Opera return items
+						// by name instead of ID
+						if ( elem.id != match[3] )
+							return jQuery().find( selector );
+						// Otherwise, we inject the element directly into the jQuery object
+						return jQuery( elem );
+					}
+					selector = [];
+				}
+			// HANDLE: $(expr, [context])
+			// (which is just equivalent to: $(content).find(expr)
+			} else
+				return jQuery( context ).find( selector );
+		// HANDLE: $(function)
+		// Shortcut for document ready
+		} else if ( jQuery.isFunction( selector ) )
+			return jQuery( document )[ jQuery.fn.ready ? "ready" : "load" ]( selector );
+		return this.setArray(jQuery.makeArray(selector));
+	},
+	// The current version of jQuery being used
+	jquery: "1.2.6",
+	// The number of elements contained in the matched element set
+	size: function() {
+		return this.length;
+	},
+	// The number of elements contained in the matched element set
+	length: 0,
+	// Get the Nth element in the matched element set OR
+	// Get the whole matched element set as a clean array
+	get: function( num ) {
+		return num == undefined ?
+			// Return a 'clean' array
+			jQuery.makeArray( this ) :
+			// Return just the object
+			this[ num ];
+	},
+	// Take an array of elements and push it onto the stack
+	// (returning the new matched element set)
+	pushStack: function( elems ) {
+		// Build a new jQuery matched element set
+		var ret = jQuery( elems );
+		// Add the old object onto the stack (as a reference)
+		ret.prevObject = this;
+		// Return the newly-formed element set
+		return ret;
+	},
+	// Force the current matched set of elements to become
+	// the specified array of elements (destroying the stack in the process)
+	// You should use pushStack() in order to do this, but maintain the stack
+	setArray: function( elems ) {
+		// Resetting the length to 0, then using the native Array push
+		// is a super-fast way to populate an object with array-like properties
+		this.length = 0;
+		Array.prototype.push.apply( this, elems );
+		return this;
+	},
+	// Execute a callback for every element in the matched set.
+	// (You can seed the arguments with an array of args, but this is
+	// only used internally.)
+	each: function( callback, args ) {
+		return jQuery.each( this, callback, args );
+	},
+	// Determine the position of an element within
+	// the matched set of elements
+	index: function( elem ) {
+		var ret = -1;
+		// Locate the position of the desired element
+		return jQuery.inArray(
+			// If it receives a jQuery object, the first element is used
+			elem && elem.jquery ? elem[0] : elem
+		, this );
+	},
+	attr: function( name, value, type ) {
+		var options = name;
+		// Look for the case where we're accessing a style value
+		if ( name.constructor == String )
+			if ( value === undefined )
+				return this[0] && jQuery[ type || "attr" ]( this[0], name );
+			else {
+				options = {};
+				options[ name ] = value;
+			}
+		// Check to see if we're setting style values
+		return this.each(function(i){
+			// Set all the styles
+			for ( name in options )
+				jQuery.attr(
+					type ?
+						this.style :
+						this,
+					name, jQuery.prop( this, options[ name ], type, i, name )
+				);
+		});
+	},
+	css: function( key, value ) {
+		// ignore negative width and height values
+		if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 )
+			value = undefined;
+		return this.attr( key, value, "curCSS" );
+	},
+	text: function( text ) {
+		if ( typeof text != "object" && text != null )
+			return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) );
+		var ret = "";
+		jQuery.each( text || this, function(){
+			jQuery.each( this.childNodes, function(){
+				if ( this.nodeType != 8 )
+					ret += this.nodeType != 1 ?
+						this.nodeValue :
+						jQuery.fn.text( [ this ] );
+			});
+		});
+		return ret;
+	},
+	wrapAll: function( html ) {
+		if ( this[0] )
+			// The elements to wrap the target around
+			jQuery( html, this[0].ownerDocument )
+				.clone()
+				.insertBefore( this[0] )
+				.map(function(){
+					var elem = this;
+					while ( elem.firstChild )
+						elem = elem.firstChild;
+					return elem;
+				})
+				.append(this);
+		return this;
+	},
+	wrapInner: function( html ) {
+		return this.each(function(){
+			jQuery( this ).contents().wrapAll( html );
+		});
+	},
+	wrap: function( html ) {
+		return this.each(function(){
+			jQuery( this ).wrapAll( html );
+		});
+	},
+	append: function() {
+		return this.domManip(arguments, true, false, function(elem){
+			if (this.nodeType == 1)
+				this.appendChild( elem );
+		});
+	},
+	prepend: function() {
+		return this.domManip(arguments, true, true, function(elem){
+			if (this.nodeType == 1)
+				this.insertBefore( elem, this.firstChild );
+		});
+	},
+	before: function() {
+		return this.domManip(arguments, false, false, function(elem){
+			this.parentNode.insertBefore( elem, this );
+		});
+	},
+	after: function() {
+		return this.domManip(arguments, false, true, function(elem){
+			this.parentNode.insertBefore( elem, this.nextSibling );
+		});
+	},
+	end: function() {
+		return this.prevObject || jQuery( [] );
+	},
+	find: function( selector ) {
+		var elems = jQuery.map(this, function(elem){
+			return jQuery.find( selector, elem );
+		});
+		return this.pushStack( /[^+>] [^+>]/.test( selector ) || selector.indexOf("..") > -1 ?
+			jQuery.unique( elems ) :
+			elems );
+	},
+	clone: function( events ) {
+		// Do the clone
+		var ret = this.map(function(){
+			if ( jQuery.browser.msie && !jQuery.isXMLDoc(this) ) {
+				// IE copies events bound via attachEvent when
+				// using cloneNode. Calling detachEvent on the
+				// clone will also remove the events from the orignal
+				// In order to get around this, we use innerHTML.
+				// Unfortunately, this means some modifications to
+				// attributes in IE that are actually only stored
+				// as properties will not be copied (such as the
+				// the name attribute on an input).
+				var clone = this.cloneNode(true),
+					container = document.createElement("div");
+				container.appendChild(clone);
+				return jQuery.clean([container.innerHTML])[0];
+			} else
+				return this.cloneNode(true);
+		});
+		// Need to set the expando to null on the cloned set if it exists
+		// removeData doesn't work here, IE removes it from the original as well
+		// this is primarily for IE but the data expando shouldn't be copied over in any browser
+		var clone = ret.find("*").andSelf().each(function(){
+			if ( this[ expando ] != undefined )
+				this[ expando ] = null;
+		});
+		// Copy the events from the original to the clone
+		if ( events === true )
+			this.find("*").andSelf().each(function(i){
+				if (this.nodeType == 3)
+					return;
+				var events = jQuery.data( this, "events" );
+				for ( var type in events )
+					for ( var handler in events[ type ] )
+						jQuery.event.add( clone[ i ], type, events[ type ][ handler ], events[ type ][ handler ].data );
+			});
+		// Return the cloned set
+		return ret;
+	},
+	filter: function( selector ) {
+		return this.pushStack(
+			jQuery.isFunction( selector ) &&
+			jQuery.grep(this, function(elem, i){
+				return selector.call( elem, i );
+			}) ||
+			jQuery.multiFilter( selector, this ) );
+	},
+	not: function( selector ) {
+		if ( selector.constructor == String )
+			// test special case where just one selector is passed in
+			if ( isSimple.test( selector ) )
+				return this.pushStack( jQuery.multiFilter( selector, this, true ) );
+			else
+				selector = jQuery.multiFilter( selector, this );
+		var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType;
+		return this.filter(function() {
+			return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector;
+		});
+	},
+	add: function( selector ) {
+		return this.pushStack( jQuery.unique( jQuery.merge(
+			this.get(),
+			typeof selector == 'string' ?
+				jQuery( selector ) :
+				jQuery.makeArray( selector )
+		)));
+	},
+	is: function( selector ) {
+		return !!selector && jQuery.multiFilter( selector, this ).length > 0;
+	},
+	hasClass: function( selector ) {
+		return this.is( "." + selector );
+	},
+	val: function( value ) {
+		if ( value == undefined ) {
+			if ( this.length ) {
+				var elem = this[0];
+				// We need to handle select boxes special
+				if ( jQuery.nodeName( elem, "select" ) ) {
+					var index = elem.selectedIndex,
+						values = [],
+						options = elem.options,
+						one = elem.type == "select-one";
+					// Nothing was selected
+					if ( index < 0 )
+						return null;
+					// Loop through all the selected options
+					for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) {
+						var option = options[ i ];
+						if ( option.selected ) {
+							// Get the specifc value for the option
+							value = jQuery.browser.msie && !option.attributes.value.specified ? option.text : option.value;
+							// We don't need an array for one selects
+							if ( one )
+								return value;
+							// Multi-Selects return an array
+							values.push( value );
+						}
+					}
+					return values;
+				// Everything else, we just grab the value
+				} else
+					return (this[0].value || "").replace(/\r/g, "");
+			}
+			return undefined;
+		}
+		if( value.constructor == Number )
+			value += '';
+		return this.each(function(){
+			if ( this.nodeType != 1 )
+				return;
+			if ( value.constructor == Array && /radio|checkbox/.test( this.type ) )
+				this.checked = (jQuery.inArray(this.value, value) >= 0 ||
+					jQuery.inArray(this.name, value) >= 0);
+			else if ( jQuery.nodeName( this, "select" ) ) {
+				var values = jQuery.makeArray(value);
+				jQuery( "option", this ).each(function(){
+					this.selected = (jQuery.inArray( this.value, values ) >= 0 ||
+						jQuery.inArray( this.text, values ) >= 0);
+				});
+				if ( !values.length )
+					this.selectedIndex = -1;
+			} else
+				this.value = value;
+		});
+	},
+	html: function( value ) {
+		return value == undefined ?
+			(this[0] ?
+				this[0].innerHTML :
+				null) :
+			this.empty().append( value );
+	},
+	replaceWith: function( value ) {
+		return this.after( value ).remove();
+	},
+	eq: function( i ) {
+		return this.slice( i, i + 1 );
+	},
+	slice: function() {
+		return this.pushStack( Array.prototype.slice.apply( this, arguments ) );
+	},
+	map: function( callback ) {
+		return this.pushStack( jQuery.map(this, function(elem, i){
+			return callback.call( elem, i, elem );
+		}));
+	},
+	andSelf: function() {
+		return this.add( this.prevObject );
+	},
+	data: function( key, value ){
+		var parts = key.split(".");
+		parts[1] = parts[1] ? "." + parts[1] : "";
+		if ( value === undefined ) {
+			var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]);
+			if ( data === undefined && this.length )
+				data = jQuery.data( this[0], key );
+			return data === undefined && parts[1] ?
+				this.data( parts[0] ) :
+				data;
+		} else
+			return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function(){
+				jQuery.data( this, key, value );
+			});
+	},
+	removeData: function( key ){
+		return this.each(function(){
+			jQuery.removeData( this, key );
+		});
+	},
+	domManip: function( args, table, reverse, callback ) {
+		var clone = this.length > 1, elems;
+		return this.each(function(){
+			if ( !elems ) {
+				elems = jQuery.clean( args, this.ownerDocument );
+				if ( reverse )
+					elems.reverse();
+			}
+			var obj = this;
+			if ( table && jQuery.nodeName( this, "table" ) && jQuery.nodeName( elems[0], "tr" ) )
+				obj = this.getElementsByTagName("tbody")[0] || this.appendChild( this.ownerDocument.createElement("tbody") );
+			var scripts = jQuery( [] );
+			jQuery.each(elems, function(){
+				var elem = clone ?
+					jQuery( this ).clone( true )[0] :
+					this;
+				// execute all scripts after the elements have been injected
+				if ( jQuery.nodeName( elem, "script" ) )
+					scripts = scripts.add( elem );
+				else {
+					// Remove any inner scripts for later evaluation
+					if ( elem.nodeType == 1 )
+						scripts = scripts.add( jQuery( "script", elem ).remove() );
+					// Inject the elements into the document
+					callback.call( obj, elem );
+				}
+			});
+			scripts.each( evalScript );
+		});
+	}
+// Give the init function the jQuery prototype for later instantiation
+jQuery.fn.init.prototype = jQuery.fn;
+function evalScript( i, elem ) {
+	if ( elem.src )
+		jQuery.ajax({
+			url: elem.src,
+			async: false,
+			dataType: "script"
+		});
+	else
+		jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" );
+	if ( elem.parentNode )
+		elem.parentNode.removeChild( elem );
+function now(){
+	return +new Date;
+jQuery.extend = jQuery.fn.extend = function() {
+	// copy reference to target object
+	var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options;
+	// Handle a deep copy situation
+	if ( target.constructor == Boolean ) {
+		deep = target;
+		target = arguments[1] || {};
+		// skip the boolean and the target
+		i = 2;
+	}
+	// Handle case when target is a string or something (possible in deep copy)
+	if ( typeof target != "object" && typeof target != "function" )
+		target = {};
+	// extend jQuery itself if only one argument is passed
+	if ( length == i ) {
+		target = this;
+		--i;
+	}
+	for ( ; i < length; i++ )
+		// Only deal with non-null/undefined values
+		if ( (options = arguments[ i ]) != null )
+			// Extend the base object
+			for ( var name in options ) {
+				var src = target[ name ], copy = options[ name ];
+				// Prevent never-ending loop
+				if ( target === copy )
+					continue;
+				// Recurse if we're merging object values
+				if ( deep && copy && typeof copy == "object" && !copy.nodeType )
+					target[ name ] = jQuery.extend( deep, 
+						// Never move original objects, clone them
+						src || ( copy.length != null ? [ ] : { } )
+					, copy );
+				// Don't bring in undefined values
+				else if ( copy !== undefined )
+					target[ name ] = copy;
+			}
+	// Return the modified object
+	return target;
+var expando = "jQuery" + now(), uuid = 0, windowData = {},
+	// exclude the following css properties to add px
+	exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i,
+	// cache defaultView
+	defaultView = document.defaultView || {};
+	noConflict: function( deep ) {
+		window.$ = _$;
+		if ( deep )
+			window.jQuery = _jQuery;
+		return jQuery;
+	},
+	// See test/unit/core.js for details concerning this function.
+	isFunction: function( fn ) {
+		return !!fn && typeof fn != "string" && !fn.nodeName &&
+			fn.constructor != Array && /^[\s[]?function/.test( fn + "" );
+	},
+	// check if an element is in a (or is an) XML document
+	isXMLDoc: function( elem ) {
+		return elem.documentElement && !elem.body ||
+			elem.tagName && elem.ownerDocument && !elem.ownerDocument.body;
+	},
+	// Evalulates a script in a global context
+	globalEval: function( data ) {
+		data = jQuery.trim( data );
+		if ( data ) {
+			// Inspired by code by Andrea Giammarchi
+			// http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html
+			var head = document.getElementsByTagName("head")[0] || document.documentElement,
+				script = document.createElement("script");
+			script.type = "text/javascript";
+			if ( jQuery.browser.msie )
+				script.text = data;
+			else
+				script.appendChild( document.createTextNode( data ) );
+			// Use insertBefore instead of appendChild  to circumvent an IE6 bug.
+			// This arises when a base node is used (#2709).
+			head.insertBefore( script, head.firstChild );
+			head.removeChild( script );
+		}
+	},
+	nodeName: function( elem, name ) {
+		return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase();
+	},
+	cache: {},
+	data: function( elem, name, data ) {
+		elem = elem == window ?
+			windowData :
+			elem;
+		var id = elem[ expando ];
+		// Compute a unique ID for the element
+		if ( !id )
+			id = elem[ expando ] = ++uuid;
+		// Only generate the data cache if we're
+		// trying to access or manipulate it
+		if ( name && !jQuery.cache[ id ] )
+			jQuery.cache[ id ] = {};
+		// Prevent overriding the named cache with undefined values
+		if ( data !== undefined )
+			jQuery.cache[ id ][ name ] = data;
+		// Return the named cache data, or the ID for the element
+		return name ?
+			jQuery.cache[ id ][ name ] :
+			id;
+	},
+	removeData: function( elem, name ) {
+		elem = elem == window ?
+			windowData :
+			elem;
+		var id = elem[ expando ];
+		// If we want to remove a specific section of the element's data
+		if ( name ) {
+			if ( jQuery.cache[ id ] ) {
+				// Remove the section of cache data
+				delete jQuery.cache[ id ][ name ];
+				// If we've removed all the data, remove the element's cache
+				name = "";
+				for ( name in jQuery.cache[ id ] )
+					break;
+				if ( !name )
+					jQuery.removeData( elem );
+			}
+		// Otherwise, we want to remove all of the element's data
+		} else {
+			// Clean up the element expando
+			try {
+				delete elem[ expando ];
+			} catch(e){
+				// IE has trouble directly removing the expando
+				// but it's ok with using removeAttribute
+				if ( elem.removeAttribute )
+					elem.removeAttribute( expando );
+			}
+			// Completely remove the data cache
+			delete jQuery.cache[ id ];
+		}
+	},
+	// args is for internal usage only
+	each: function( object, callback, args ) {
+		var name, i = 0, length = object.length;
+		if ( args ) {
+			if ( length == undefined ) {
+				for ( name in object )
+					if ( callback.apply( object[ name ], args ) === false )
+						break;
+			} else
+				for ( ; i < length; )
+					if ( callback.apply( object[ i++ ], args ) === false )
+						break;
+		// A special, fast, case for the most common use of each
+		} else {
+			if ( length == undefined ) {
+				for ( name in object )
+					if ( callback.call( object[ name ], name, object[ name ] ) === false )
+						break;
+			} else
+				for ( var value = object[0];
+					i < length && callback.call( value, i, value ) !== false; value = object[++i] ){}
+		}
+		return object;
+	},
+	prop: function( elem, value, type, i, name ) {
+		// Handle executable functions
+		if ( jQuery.isFunction( value ) )
+			value = value.call( elem, i );
+		// Handle passing in a number to a CSS property
+		return value && value.constructor == Number && type == "curCSS" && !exclude.test( name ) ?
+			value + "px" :
+			value;
+	},
+	className: {
+		// internal only, use addClass("class")
+		add: function( elem, classNames ) {
+			jQuery.each((classNames || "").split(/\s+/), function(i, className){
+				if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) )
+					elem.className += (elem.className ? " " : "") + className;
+			});
+		},
+		// internal only, use removeClass("class")
+		remove: function( elem, classNames ) {
+			if (elem.nodeType == 1)
+				elem.className = classNames != undefined ?
+					jQuery.grep(elem.className.split(/\s+/), function(className){
+						return !jQuery.className.has( classNames, className );
+					}).join(" ") :
+					"";
+		},
+		// internal only, use hasClass("class")
+		has: function( elem, className ) {
+			return jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1;
+		}
+	},
+	// A method for quickly swapping in/out CSS properties to get correct calculations
+	swap: function( elem, options, callback ) {
+		var old = {};
+		// Remember the old values, and insert the new ones
+		for ( var name in options ) {
+			old[ name ] = elem.style[ name ];
+			elem.style[ name ] = options[ name ];
+		}
+		callback.call( elem );
+		// Revert the old values
+		for ( var name in options )
+			elem.style[ name ] = old[ name ];
+	},
+	css: function( elem, name, force ) {
+		if ( name == "width" || name == "height" ) {
+			var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ];
+			function getWH() {
+				val = name == "width" ? elem.offsetWidth : elem.offsetHeight;
+				var padding = 0, border = 0;
+				jQuery.each( which, function() {
+					padding += parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0;
+					border += parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0;
+				});
+				val -= Math.round(padding + border);
+			}
+			if ( jQuery(elem).is(":visible") )
+				getWH();
+			else
+				jQuery.swap( elem, props, getWH );
+			return Math.max(0, val);
+		}
+		return jQuery.curCSS( elem, name, force );
+	},
+	curCSS: function( elem, name, force ) {
+		var ret, style = elem.style;
+		// A helper method for determining if an element's values are broken
+		function color( elem ) {
+			if ( !jQuery.browser.safari )
+				return false;
+			// defaultView is cached
+			var ret = defaultView.getComputedStyle( elem, null );
+			return !ret || ret.getPropertyValue("color") == "";
+		}
+		// We need to handle opacity special in IE
+		if ( name == "opacity" && jQuery.browser.msie ) {
+			ret = jQuery.attr( style, "opacity" );
+			return ret == "" ?
+				"1" :
+				ret;
+		}
+		// Opera sometimes will give the wrong display answer, this fixes it, see #2037
+		if ( jQuery.browser.opera && name == "display" ) {
+			var save = style.outline;
+			style.outline = "0 solid black";
+			style.outline = save;
+		}
+		// Make sure we're using the right name for getting the float value
+		if ( name.match( /float/i ) )
+			name = styleFloat;
+		if ( !force && style && style[ name ] )
+			ret = style[ name ];
+		else if ( defaultView.getComputedStyle ) {
+			// Only "float" is needed here
+			if ( name.match( /float/i ) )
+				name = "float";
+			name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase();
+			var computedStyle = defaultView.getComputedStyle( elem, null );
+			if ( computedStyle && !color( elem ) )
+				ret = computedStyle.getPropertyValue( name );
+			// If the element isn't reporting its values properly in Safari
+			// then some display: none elements are involved
+			else {
+				var swap = [], stack = [], a = elem, i = 0;
+				// Locate all of the parent display: none elements
+				for ( ; a && color(a); a = a.parentNode )
+					stack.unshift(a);
+				// Go through and make them visible, but in reverse
+				// (It would be better if we knew the exact display type that they had)
+				for ( ; i < stack.length; i++ )
+					if ( color( stack[ i ] ) ) {
+						swap[ i ] = stack[ i ].style.display;
+						stack[ i ].style.display = "block";
+					}
+				// Since we flip the display style, we have to handle that
+				// one special, otherwise get the value
+				ret = name == "display" && swap[ stack.length - 1 ] != null ?
+					"none" :
+					( computedStyle && computedStyle.getPropertyValue( name ) ) || "";
+				// Finally, revert the display styles back
+				for ( i = 0; i < swap.length; i++ )
+					if ( swap[ i ] != null )
+						stack[ i ].style.display = swap[ i ];
+			}
+			// We should always get a number back from opacity
+			if ( name == "opacity" && ret == "" )
+				ret = "1";
+		} else if ( elem.currentStyle ) {
+			var camelCase = name.replace(/\-(\w)/g, function(all, letter){
+				return letter.toUpperCase();
+			});
+			ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ];
+			// From the awesome hack by Dean Edwards
+			// http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291
+			// If we're not dealing with a regular pixel number
+			// but a number that has a weird ending, we need to convert it to pixels
+			if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) {
+				// Remember the original values
+				var left = style.left, rsLeft = elem.runtimeStyle.left;
+				// Put in the new values to get a computed value out
+				elem.runtimeStyle.left = elem.currentStyle.left;
+				style.left = ret || 0;
+				ret = style.pixelLeft + "px";
+				// Revert the changed values
+				style.left = left;
+				elem.runtimeStyle.left = rsLeft;
+			}
+		}
+		return ret;
+	},
+	clean: function( elems, context ) {
+		var ret = [];
+		context = context || document;
+		// !context.createElement fails in IE with an error but returns typeof 'object'
+		if (typeof context.createElement == 'undefined')
+			context = context.ownerDocument || context[0] && context[0].ownerDocument || document;
+		jQuery.each(elems, function(i, elem){
+			if ( !elem )
+				return;
+			if ( elem.constructor == Number )
+				elem += '';
+			// Convert html string into DOM nodes
+			if ( typeof elem == "string" ) {
+				// Fix "XHTML"-style tags in all browsers
+				elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){
+					return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ?
+						all :
+						front + "></" + tag + ">";
+				});
+				// Trim whitespace, otherwise indexOf won't work as expected
+				var tags = jQuery.trim( elem ).toLowerCase(), div = context.createElement("div");
+				var wrap =
+					// option or optgroup
+					!tags.indexOf("<opt") &&
+					[ 1, "<select multiple='multiple'>", "</select>" ] ||
+					!tags.indexOf("<leg") &&
+					[ 1, "<fieldset>", "</fieldset>" ] ||
+					tags.match(/^<(thead|tbody|tfoot|colg|cap)/) &&
+					[ 1, "<table>", "</table>" ] ||
+					!tags.indexOf("<tr") &&
+					[ 2, "<table><tbody>", "</tbody></table>" ] ||
+				 	// <thead> matched above
+					(!tags.indexOf("<td") || !tags.indexOf("<th")) &&
+					[ 3, "<table><tbody><tr>", "</tr></tbody></table>" ] ||
+					!tags.indexOf("<col") &&
+					[ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ] ||
+					// IE can't serialize <link> and <script> tags normally
+					jQuery.browser.msie &&
+					[ 1, "div<div>", "</div>" ] ||
+					[ 0, "", "" ];
+				// Go to html and back, then peel off extra wrappers
+				div.innerHTML = wrap[1] + elem + wrap[2];
+				// Move to the right depth
+				while ( wrap[0]-- )
+					div = div.lastChild;
+				// Remove IE's autoinserted <tbody> from table fragments
+				if ( jQuery.browser.msie ) {
+					// String was a <table>, *may* have spurious <tbody>
+					var tbody = !tags.indexOf("<table") && tags.indexOf("<tbody") < 0 ?
+						div.firstChild && div.firstChild.childNodes :
+						// String was a bare <thead> or <tfoot>
+						wrap[1] == "<table>" && tags.indexOf("<tbody") < 0 ?
+							div.childNodes :
+							[];
+					for ( var j = tbody.length - 1; j >= 0 ; --j )
+						if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length )
+							tbody[ j ].parentNode.removeChild( tbody[ j ] );
+					// IE completely kills leading whitespace when innerHTML is used
+					if ( /^\s/.test( elem ) )
+						div.insertBefore( context.createTextNode( elem.match(/^\s*/)[0] ), div.firstChild );
+				}
+				elem = jQuery.makeArray( div.childNodes );
+			}
+			if ( elem.length === 0 && (!jQuery.nodeName( elem, "form" ) && !jQuery.nodeName( elem, "select" )) )
+				return;
+			if ( elem[0] == undefined || jQuery.nodeName( elem, "form" ) || elem.options )
+				ret.push( elem );
+			else
+				ret = jQuery.merge( ret, elem );
+		});
+		return ret;
+	},
+	attr: function( elem, name, value ) {
+		// don't set attributes on text and comment nodes
+		if (!elem || elem.nodeType == 3 || elem.nodeType == 8)
+			return undefined;
+		var notxml = !jQuery.isXMLDoc( elem ),
+			// Whether we are setting (or getting)
+			set = value !== undefined,
+			msie = jQuery.browser.msie;
+		// Try to normalize/fix the name
+		name = notxml && jQuery.props[ name ] || name;
+		// Only do all the following if this is a node (faster for style)
+		// IE elem.getAttribute passes even for style
+		if ( elem.tagName ) {
+			// These attributes require special treatment
+			var special = /href|src|style/.test( name );
+			// Safari mis-reports the default selected property of a hidden option
+			// Accessing the parent's selectedIndex property fixes it
+			if ( name == "selected" && jQuery.browser.safari )
+				elem.parentNode.selectedIndex;
+			// If applicable, access the attribute via the DOM 0 way
+			if ( name in elem && notxml && !special ) {
+				if ( set ){
+					// We can't allow the type property to be changed (since it causes problems in IE)
+					if ( name == "type" && jQuery.nodeName( elem, "input" ) && elem.parentNode )
+						throw "type property can't be changed";
+					elem[ name ] = value;
+				}
+				// browsers index elements by id/name on forms, give priority to attributes.
+				if( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) )
+					return elem.getAttributeNode( name ).nodeValue;
+				return elem[ name ];
+			}
+			if ( msie && notxml &&  name == "style" )
+				return jQuery.attr( elem.style, "cssText", value );
+			if ( set )
+				// convert the value to a string (all browsers do this but IE) see #1070
+				elem.setAttribute( name, "" + value );
+			var attr = msie && notxml && special
+					// Some attributes require a special call on IE
+					? elem.getAttribute( name, 2 )
+					: elem.getAttribute( name );
+			// Non-existent attributes return null, we normalize to undefined
+			return attr === null ? undefined : attr;
+		}
+		// elem is actually elem.style ... set the style
+		// IE uses filters for opacity
+		if ( msie && name == "opacity" ) {
+			if ( set ) {
+				// IE has trouble with opacity if it does not have layout
+				// Force it by setting the zoom level
+				elem.zoom = 1;
+				// Set the alpha filter to set the opacity
+				elem.filter = (elem.filter || "").replace( /alpha\([^)]*\)/, "" ) +
+					(parseInt( value ) + '' == "NaN" ? "" : "alpha(opacity=" + value * 100 + ")");
+			}
+			return elem.filter && elem.filter.indexOf("opacity=") >= 0 ?
+				(parseFloat( elem.filter.match(/opacity=([^)]*)/)[1] ) / 100) + '':
+				"";
+		}
+		name = name.replace(/-([a-z])/ig, function(all, letter){
+			return letter.toUpperCase();
+		});
+		if ( set )
+			elem[ name ] = value;
+		return elem[ name ];
+	},
+	trim: function( text ) {
+		return (text || "").replace( /^\s+|\s+$/g, "" );
+	},
+	makeArray: function( array ) {
+		var ret = [];
+		if( array != null ){
+			var i = array.length;
+			//the window, strings and functions also have 'length'
+			if( i == null || array.split || array.setInterval || array.call )
+				ret[0] = array;
+			else
+				while( i )
+					ret[--i] = array[i];
+		}
+		return ret;
+	},
+	inArray: function( elem, array ) {
+		for ( var i = 0, length = array.length; i < length; i++ )
+		// Use === because on IE, window == document
+			if ( array[ i ] === elem )
+				return i;
+		return -1;
+	},
+	merge: function( first, second ) {
+		// We have to loop this way because IE & Opera overwrite the length
+		// expando of getElementsByTagName
+		var i = 0, elem, pos = first.length;
+		// Also, we need to make sure that the correct elements are being returned
+		// (IE returns comment nodes in a '*' query)
+		if ( jQuery.browser.msie ) {
+			while ( elem = second[ i++ ] )
+				if ( elem.nodeType != 8 )
+					first[ pos++ ] = elem;
+		} else
+			while ( elem = second[ i++ ] )
+				first[ pos++ ] = elem;
+		return first;
+	},
+	unique: function( array ) {
+		var ret = [], done = {};
+		try {
+			for ( var i = 0, length = array.length; i < length; i++ ) {
+				var id = jQuery.data( array[ i ] );
+				if ( !done[ id ] ) {
+					done[ id ] = true;
+					ret.push( array[ i ] );
+				}
+			}
+		} catch( e ) {
+			ret = array;
+		}
+		return ret;
+	},
+	grep: function( elems, callback, inv ) {
+		var ret = [];
+		// Go through the array, only saving the items
+		// that pass the validator function
+		for ( var i = 0, length = elems.length; i < length; i++ )
+			if ( !inv != !callback( elems[ i ], i ) )
+				ret.push( elems[ i ] );
+		return ret;
+	},
+	map: function( elems, callback ) {
+		var ret = [];
+		// Go through the array, translating each of the items to their
+		// new value (or values).
+		for ( var i = 0, length = elems.length; i < length; i++ ) {
+			var value = callback( elems[ i ], i );
+			if ( value != null )
+				ret[ ret.length ] = value;
+		}
+		return ret.concat.apply( [], ret );
+	}
+var userAgent = navigator.userAgent.toLowerCase();
+// Figure out what browser is being used
+jQuery.browser = {
+	version: (userAgent.match( /.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/ ) || [])[1],
+	safari: /webkit/.test( userAgent ),
+	opera: /opera/.test( userAgent ),
+	msie: /msie/.test( userAgent ) && !/opera/.test( userAgent ),
+	mozilla: /mozilla/.test( userAgent ) && !/(compatible|webkit)/.test( userAgent )
+var styleFloat = jQuery.browser.msie ?
+	"styleFloat" :
+	"cssFloat";
+	// Check to see if the W3C box model is being used
+	boxModel: !jQuery.browser.msie || document.compatMode == "CSS1Compat",
+	props: {
+		"for": "htmlFor",
+		"class": "className",
+		"float": styleFloat,
+		cssFloat: styleFloat,
+		styleFloat: styleFloat,
+		readonly: "readOnly",
+		maxlength: "maxLength",
+		cellspacing: "cellSpacing",
+		rowspan: "rowSpan"
+	}
+	parent: function(elem){return elem.parentNode;},
+	parents: function(elem){return jQuery.dir(elem,"parentNode");},
+	next: function(elem){return jQuery.nth(elem,2,"nextSibling");},
+	prev: function(elem){return jQuery.nth(elem,2,"previousSibling");},
+	nextAll: function(elem){return jQuery.dir(elem,"nextSibling");},
+	prevAll: function(elem){return jQuery.dir(elem,"previousSibling");},
+	siblings: function(elem){return jQuery.sibling(elem.parentNode.firstChild,elem);},
+	children: function(elem){return jQuery.sibling(elem.firstChild);},
+	contents: function(elem){return jQuery.nodeName(elem,"iframe")?elem.contentDocument||elem.contentWindow.document:jQuery.makeArray(elem.childNodes);}
+}, function(name, fn){
+	jQuery.fn[ name ] = function( selector ) {
+		var ret = jQuery.map( this, fn );
+		if ( selector && typeof selector == "string" )
+			ret = jQuery.multiFilter( selector, ret );
+		return this.pushStack( jQuery.unique( ret ) );
+	};
+	appendTo: "append",
+	prependTo: "prepend",
+	insertBefore: "before",
+	insertAfter: "after",
+	replaceAll: "replaceWith"
+}, function(name, original){
+	jQuery.fn[ name ] = function() {
+		var args = arguments;
+		return this.each(function(){
+			for ( var i = 0, length = args.length; i < length; i++ )
+				jQuery( args[ i ] )[ original ]( this );
+		});
+	};
+	removeAttr: function( name ) {
+		jQuery.attr( this, name, "" );
+		if (this.nodeType == 1)
+			this.removeAttribute( name );
+	},
+	addClass: function( classNames ) {
+		jQuery.className.add( this, classNames );
+	},
+	removeClass: function( classNames ) {
+		jQuery.className.remove( this, classNames );
+	},
+	toggleClass: function( classNames ) {
+		jQuery.className[ jQuery.className.has( this, classNames ) ? "remove" : "add" ]( this, classNames );
+	},
+	remove: function( selector ) {
+		if ( !selector || jQuery.filter( selector, [ this ] ).r.length ) {
+			// Prevent memory leaks
+			jQuery( "*", this ).add(this).each(function(){
+				jQuery.event.remove(this);
+				jQuery.removeData(this);
+			});
+			if (this.parentNode)
+				this.parentNode.removeChild( this );
+		}
+	},
+	empty: function() {
+		// Remove element nodes and prevent memory leaks
+		jQuery( ">*", this ).remove();
+		// Remove any remaining nodes
+		while ( this.firstChild )
+			this.removeChild( this.firstChild );
+	}
+}, function(name, fn){
+	jQuery.fn[ name ] = function(){
+		return this.each( fn, arguments );
+	};
+jQuery.each([ "Height", "Width" ], function(i, name){
+	var type = name.toLowerCase();
+	jQuery.fn[ type ] = function( size ) {
+		// Get window width or height
+		return this[0] == window ?
+			// Opera reports document.body.client[Width/Height] properly in both quirks and standards
+			jQuery.browser.opera && document.body[ "client" + name ] ||
+			// Safari reports inner[Width/Height] just fine (Mozilla and Opera include scroll bar widths)
+			jQuery.browser.safari && window[ "inner" + name ] ||
+			// Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode
+			document.compatMode == "CSS1Compat" && document.documentElement[ "client" + name ] || document.body[ "client" + name ] :
+			// Get document width or height
+			this[0] == document ?
+				// Either scroll[Width/Height] or offset[Width/Height], whichever is greater
+				Math.max(
+					Math.max(document.body["scroll" + name], document.documentElement["scroll" + name]),
+					Math.max(document.body["offset" + name], document.documentElement["offset" + name])
+				) :
+				// Get or set width or height on the element
+				size == undefined ?
+					// Get width or height on the element
+					(this.length ? jQuery.css( this[0], type ) : null) :
+					// Set the width or height on the element (default to pixels if value is unitless)
+					this.css( type, size.constructor == String ? size : size + "px" );
+	};
+// Helper function used by the dimensions and offset modules
+function num(elem, prop) {
+	return elem[0] && parseInt( jQuery.curCSS(elem[0], prop, true), 10 ) || 0;
+}var chars = jQuery.browser.safari && parseInt(jQuery.browser.version) < 417 ?
+		"(?:[\\w*_-]|\\\\.)" :
+		"(?:[\\w\u0128-\uFFFF*_-]|\\\\.)",
+	quickChild = new RegExp("^>\\s*(" + chars + "+)"),
+	quickID = new RegExp("^(" + chars + "+)(#)(" + chars + "+)"),
+	quickClass = new RegExp("^([#.]?)(" + chars + "*)");
+	expr: {
+		"": function(a,i,m){return m[2]=="*"||jQuery.nodeName(a,m[2]);},
+		"#": function(a,i,m){return a.getAttribute("id")==m[2];},
+		":": {
+			// Position Checks
+			lt: function(a,i,m){return i<m[3]-0;},
+			gt: function(a,i,m){return i>m[3]-0;},
+			nth: function(a,i,m){return m[3]-0==i;},
+			eq: function(a,i,m){return m[3]-0==i;},
+			first: function(a,i){return i==0;},
+			last: function(a,i,m,r){return i==r.length-1;},
+			even: function(a,i){return i%2==0;},
+			odd: function(a,i){return i%2;},
+			// Child Checks
+			"first-child": function(a){return a.parentNode.getElementsByTagName("*")[0]==a;},
+			"last-child": function(a){return jQuery.nth(a.parentNode.lastChild,1,"previousSibling")==a;},
+			"only-child": function(a){return !jQuery.nth(a.parentNode.lastChild,2,"previousSibling");},
+			// Parent Checks
+			parent: function(a){return a.firstChild;},
+			empty: function(a){return !a.firstChild;},
+			// Text Check
+			contains: function(a,i,m){return (a.textContent||a.innerText||jQuery(a).text()||"").indexOf(m[3])>=0;},
+			// Visibility
+			visible: function(a){return "hidden"!=a.type&&jQuery.css(a,"display")!="none"&&jQuery.css(a,"visibility")!="hidden";},
+			hidden: function(a){return "hidden"==a.type||jQuery.css(a,"display")=="none"||jQuery.css(a,"visibility")=="hidden";},
+			// Form attributes
+			enabled: function(a){return !a.disabled;},
+			disabled: function(a){return a.disabled;},
+			checked: function(a){return a.checked;},
+			selected: function(a){return a.selected||jQuery.attr(a,"selected");},
+			// Form elements
+			text: function(a){return "text"==a.type;},
+			radio: function(a){return "radio"==a.type;},
+			checkbox: function(a){return "checkbox"==a.type;},
+			file: function(a){return "file"==a.type;},
+			password: function(a){return "password"==a.type;},
+			submit: function(a){return "submit"==a.type;},
+			image: function(a){return "image"==a.type;},
+			reset: function(a){return "reset"==a.type;},
+			button: function(a){return "button"==a.type||jQuery.nodeName(a,"button");},
+			input: function(a){return /input|select|textarea|button/i.test(a.nodeName);},
+			// :has()
+			has: function(a,i,m){return jQuery.find(m[3],a).length;},
+			// :header
+			header: function(a){return /h\d/i.test(a.nodeName);},
+			// :animated
+			animated: function(a){return jQuery.grep(jQuery.timers,function(fn){return a==fn.elem;}).length;}
+		}
+	},
+	// The regular expressions that power the parsing engine
+	parse: [
+		// Match: [@value='test'], [@foo]
+		/^(\[) *@?([\w-]+) *([!*$^~=]*) *('?"?)(.*?)\4 *\]/,
+		// Match: :contains('foo')
+		/^(:)([\w-]+)\("?'?(.*?(\(.*?\))?[^(]*?)"?'?\)/,
+		// Match: :even, :last-child, #id, .class
+		new RegExp("^([:.#]*)(" + chars + "+)")
+	],
+	multiFilter: function( expr, elems, not ) {
+		var old, cur = [];
+		while ( expr && expr != old ) {
+			old = expr;
+			var f = jQuery.filter( expr, elems, not );
+			expr = f.t.replace(/^\s*,\s*/, "" );
+			cur = not ? elems = f.r : jQuery.merge( cur, f.r );
+		}
+		return cur;
+	},
+	find: function( t, context ) {
+		// Quickly handle non-string expressions
+		if ( typeof t != "string" )
+			return [ t ];
+		// check to make sure context is a DOM element or a document
+		if ( context && context.nodeType != 1 && context.nodeType != 9)
+			return [ ];
+		// Set the correct context (if none is provided)
+		context = context || document;
+		// Initialize the search
+		var ret = [context], done = [], last, nodeName;
+		// Continue while a selector expression exists, and while
+		// we're no longer looping upon ourselves
+		while ( t && last != t ) {
+			var r = [];
+			last = t;
+			t = jQuery.trim(t);
+			var foundToken = false,
+			// An attempt at speeding up child selectors that
+			// point to a specific element tag
+				re = quickChild,
+				m = re.exec(t);
+			if ( m ) {
+				nodeName = m[1].toUpperCase();
+				// Perform our own iteration and filter
+				for ( var i = 0; ret[i]; i++ )
+					for ( var c = ret[i].firstChild; c; c = c.nextSibling )
+						if ( c.nodeType == 1 && (nodeName == "*" || c.nodeName.toUpperCase() == nodeName) )
+							r.push( c );
+				ret = r;
+				t = t.replace( re, "" );
+				if ( t.indexOf(" ") == 0 ) continue;
+				foundToken = true;
+			} else {
+				re = /^([>+~])\s*(\w*)/i;
+				if ( (m = re.exec(t)) != null ) {
+					r = [];
+					var merge = {};
+					nodeName = m[2].toUpperCase();
+					m = m[1];
+					for ( var j = 0, rl = ret.length; j < rl; j++ ) {
+						var n = m == "~" || m == "+" ? ret[j].nextSibling : ret[j].firstChild;
+						for ( ; n; n = n.nextSibling )
+							if ( n.nodeType == 1 ) {
+								var id = jQuery.data(n);
+								if ( m == "~" && merge[id] ) break;
+								if (!nodeName || n.nodeName.toUpperCase() == nodeName ) {
+									if ( m == "~" ) merge[id] = true;
+									r.push( n );
+								}
+								if ( m == "+" ) break;
+							}
+					}
+					ret = r;
+					// And remove the token
+					t = jQuery.trim( t.replace( re, "" ) );
+					foundToken = true;
+				}
+			}
+			// See if there's still an expression, and that we haven't already
+			// matched a token
+			if ( t && !foundToken ) {
+				// Handle multiple expressions
+				if ( !t.indexOf(",") ) {
+					// Clean the result set
+					if ( context == ret[0] ) ret.shift();
+					// Merge the result sets
+					done = jQuery.merge( done, ret );
+					// Reset the context
+					r = ret = [context];
+					// Touch up the selector string
+					t = " " + t.substr(1,t.length);
+				} else {
+					// Optimize for the case nodeName#idName
+					var re2 = quickID;
+					var m = re2.exec(t);
+					// Re-organize the results, so that they're consistent
+					if ( m ) {
+						m = [ 0, m[2], m[3], m[1] ];
+					} else {
+						// Otherwise, do a traditional filter check for
+						// ID, class, and element selectors
+						re2 = quickClass;
+						m = re2.exec(t);
+					}
+					m[2] = m[2].replace(/\\/g, "");
+					var elem = ret[ret.length-1];
+					// Try to do a global search by ID, where we can
+					if ( m[1] == "#" && elem && elem.getElementById && !jQuery.isXMLDoc(elem) ) {
+						// Optimization for HTML document case
+						var oid = elem.getElementById(m[2]);
+						// Do a quick check for the existence of the actual ID attribute
+						// to avoid selecting by the name attribute in IE
+						// also check to insure id is a string to avoid selecting an element with the name of 'id' inside a form
+						if ( (jQuery.browser.msie||jQuery.browser.opera) && oid && typeof oid.id == "string" && oid.id != m[2] )
+							oid = jQuery('[@id="'+m[2]+'"]', elem)[0];
+						// Do a quick check for node name (where applicable) so
+						// that div#foo searches will be really fast
+						ret = r = oid && (!m[3] || jQuery.nodeName(oid, m[3])) ? [oid] : [];
+					} else {
+						// We need to find all descendant elements
+						for ( var i = 0; ret[i]; i++ ) {
+							// Grab the tag name being searched for
+							var tag = m[1] == "#" && m[3] ? m[3] : m[1] != "" || m[0] == "" ? "*" : m[2];
+							// Handle IE7 being really dumb about <object>s
+							if ( tag == "*" && ret[i].nodeName.toLowerCase() == "object" )
+								tag = "param";
+							r = jQuery.merge( r, ret[i].getElementsByTagName( tag ));
+						}
+						// It's faster to filter by class and be done with it
+						if ( m[1] == "." )
+							r = jQuery.classFilter( r, m[2] );
+						// Same with ID filtering
+						if ( m[1] == "#" ) {
+							var tmp = [];
+							// Try to find the element with the ID
+							for ( var i = 0; r[i]; i++ )
+								if ( r[i].getAttribute("id") == m[2] ) {
+									tmp = [ r[i] ];
+									break;
+								}
+							r = tmp;
+						}
+						ret = r;
+					}
+					t = t.replace( re2, "" );
+				}
+			}
+			// If a selector string still exists
+			if ( t ) {
+				// Attempt to filter it
+				var val = jQuery.filter(t,r);
+				ret = r = val.r;
+				t = jQuery.trim(val.t);
+			}
+		}
+		// An error occurred with the selector;
+		// just return an empty set instead
+		if ( t )
+			ret = [];
+		// Remove the root context
+		if ( ret && context == ret[0] )
+			ret.shift();
+		// And combine the results
+		done = jQuery.merge( done, ret );
+		return done;
+	},
+	classFilter: function(r,m,not){
+		m = " " + m + " ";
+		var tmp = [];
+		for ( var i = 0; r[i]; i++ ) {
+			var pass = (" " + r[i].className + " ").indexOf( m ) >= 0;
+			if ( !not && pass || not && !pass )
+				tmp.push( r[i] );
+		}
+		return tmp;
+	},
+	filter: function(t,r,not) {
+		var last;
+		// Look for common filter expressions
+		while ( t && t != last ) {
+			last = t;
+			var p = jQuery.parse, m;
+			for ( var i = 0; p[i]; i++ ) {
+				m = p[i].exec( t );
+				if ( m ) {
+					// Remove what we just matched
+					t = t.substring( m[0].length );
+					m[2] = m[2].replace(/\\/g, "");
+					break;
+				}
+			}
+			if ( !m )
+				break;
+			// :not() is a special case that can be optimized by
+			// keeping it out of the expression list
+			if ( m[1] == ":" && m[2] == "not" )
+				// optimize if only one selector found (most common case)
+				r = isSimple.test( m[3] ) ?
+					jQuery.filter(m[3], r, true).r :
+					jQuery( r ).not( m[3] );
+			// We can get a big speed boost by filtering by class here
+			else if ( m[1] == "." )
+				r = jQuery.classFilter(r, m[2], not);
+			else if ( m[1] == "[" ) {
+				var tmp = [], type = m[3];
+				for ( var i = 0, rl = r.length; i < rl; i++ ) {
+					var a = r[i], z = a[ jQuery.props[m[2]] || m[2] ];
+					if ( z == null || /href|src|selected/.test(m[2]) )
+						z = jQuery.attr(a,m[2]) || '';
+					if ( (type == "" && !!z ||
+						 type == "=" && z == m[5] ||
+						 type == "!=" && z != m[5] ||
+						 type == "^=" && z && !z.indexOf(m[5]) ||
+						 type == "$=" && z.substr(z.length - m[5].length) == m[5] ||
+						 (type == "*=" || type == "~=") && z.indexOf(m[5]) >= 0) ^ not )
+							tmp.push( a );
+				}
+				r = tmp;
+			// We can get a speed boost by handling nth-child here
+			} else if ( m[1] == ":" && m[2] == "nth-child" ) {
+				var merge = {}, tmp = [],
+					// parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6'
+					test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec(
+						m[3] == "even" && "2n" || m[3] == "odd" && "2n+1" ||
+						!/\D/.test(m[3]) && "0n+" + m[3] || m[3]),
+					// calculate the numbers (first)n+(last) including if they are negative
+					first = (test[1] + (test[2] || 1)) - 0, last = test[3] - 0;
+				// loop through all the elements left in the jQuery object
+				for ( var i = 0, rl = r.length; i < rl; i++ ) {
+					var node = r[i], parentNode = node.parentNode, id = jQuery.data(parentNode);
+					if ( !merge[id] ) {
+						var c = 1;
+						for ( var n = parentNode.firstChild; n; n = n.nextSibling )
+							if ( n.nodeType == 1 )
+								n.nodeIndex = c++;
+						merge[id] = true;
+					}
+					var add = false;
+					if ( first == 0 ) {
+						if ( node.nodeIndex == last )
+							add = true;
+					} else if ( (node.nodeIndex - last) % first == 0 && (node.nodeIndex - last) / first >= 0 )
+						add = true;
+					if ( add ^ not )
+						tmp.push( node );
+				}
+				r = tmp;
+			// Otherwise, find the expression to execute
+			} else {
+				var fn = jQuery.expr[ m[1] ];
+				if ( typeof fn == "object" )
+					fn = fn[ m[2] ];
+				if ( typeof fn == "string" )
+					fn = eval("false||function(a,i){return " + fn + ";}");
+				// Execute it against the current filter
+				r = jQuery.grep( r, function(elem, i){
+					return fn(elem, i, m, r);
+				}, not );
+			}
+		}
+		// Return an array of filtered elements (r)
+		// and the modified expression string (t)
+		return { r: r, t: t };
+	},
+	dir: function( elem, dir ){
+		var matched = [],
+			cur = elem[dir];
+		while ( cur && cur != document ) {
+			if ( cur.nodeType == 1 )
+				matched.push( cur );
+			cur = cur[dir];
+		}
+		return matched;
+	},
+	nth: function(cur,result,dir,elem){
+		result = result || 1;
+		var num = 0;
+		for ( ; cur; cur = cur[dir] )
+			if ( cur.nodeType == 1 && ++num == result )
+				break;
+		return cur;
+	},
+	sibling: function( n, elem ) {
+		var r = [];
+		for ( ; n; n = n.nextSibling ) {
+			if ( n.nodeType == 1 && n != elem )
+				r.push( n );
+		}
+		return r;
+	}
+ * A number of helper functions used for managing events.
+ * Many of the ideas behind this code orignated from
+ * Dean Edwards' addEvent library.
+ */
+jQuery.event = {
+	// Bind an event to an element
+	// Original by Dean Edwards
+	add: function(elem, types, handler, data) {
+		if ( elem.nodeType == 3 || elem.nodeType == 8 )
+			return;
+		// For whatever reason, IE has trouble passing the window object
+		// around, causing it to be cloned in the process
+		if ( jQuery.browser.msie && elem.setInterval )
+			elem = window;
+		// Make sure that the function being executed has a unique ID
+		if ( !handler.guid )
+			handler.guid = this.guid++;
+		// if data is passed, bind to handler
+		if( data != undefined ) {
+			// Create temporary function pointer to original handler
+			var fn = handler;
+			// Create unique handler function, wrapped around original handler
+			handler = this.proxy( fn, function() {
+				// Pass arguments and context to original handler
+				return fn.apply(this, arguments);
+			});
+			// Store data in unique handler
+			handler.data = data;
+		}
+		// Init the element's event structure
+		var events = jQuery.data(elem, "events") || jQuery.data(elem, "events", {}),
+			handle = jQuery.data(elem, "handle") || jQuery.data(elem, "handle", function(){
+				// Handle the second event of a trigger and when
+				// an event is called after a page has unloaded
+				if ( typeof jQuery != "undefined" && !jQuery.event.triggered )
+					return jQuery.event.handle.apply(arguments.callee.elem, arguments);
+			});
+		// Add elem as a property of the handle function
+		// This is to prevent a memory leak with non-native
+		// event in IE.
+		handle.elem = elem;
+		// Handle multiple events separated by a space
+		// jQuery(...).bind("mouseover mouseout", fn);
+		jQuery.each(types.split(/\s+/), function(index, type) {
+			// Namespaced event handlers
+			var parts = type.split(".");
+			type = parts[0];
+			handler.type = parts[1];
+			// Get the current list of functions bound to this event
+			var handlers = events[type];
+			// Init the event handler queue
+			if (!handlers) {
+				handlers = events[type] = {};
+				// Check for a special event handler
+				// Only use addEventListener/attachEvent if the special
+				// events handler returns false
+				if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem) === false ) {
+					// Bind the global event handler to the element
+					if (elem.addEventListener)
+						elem.addEventListener(type, handle, false);
+					else if (elem.attachEvent)
+						elem.attachEvent("on" + type, handle);
+				}
+			}
+			// Add the function to the element's handler list
+			handlers[handler.guid] = handler;
+			// Keep track of which events have been used, for global triggering
+			jQuery.event.global[type] = true;
+		});
+		// Nullify elem to prevent memory leaks in IE
+		elem = null;
+	},
+	guid: 1,
+	global: {},
+	// Detach an event or set of events from an element
+	remove: function(elem, types, handler) {
+		// don't do events on text and comment nodes
+		if ( elem.nodeType == 3 || elem.nodeType == 8 )
+			return;
+		var events = jQuery.data(elem, "events"), ret, index;
+		if ( events ) {
+			// Unbind all events for the element
+			if ( types == undefined || (typeof types == "string" && types.charAt(0) == ".") )
+				for ( var type in events )
+					this.remove( elem, type + (types || "") );
+			else {
+				// types is actually an event object here
+				if ( types.type ) {
+					handler = types.handler;
+					types = types.type;
+				}
+				// Handle multiple events seperated by a space
+				// jQuery(...).unbind("mouseover mouseout", fn);
+				jQuery.each(types.split(/\s+/), function(index, type){
+					// Namespaced event handlers
+					var parts = type.split(".");
+					type = parts[0];
+					if ( events[type] ) {
+						// remove the given handler for the given type
+						if ( handler )
+							delete events[type][handler.guid];
+						// remove all handlers for the given type
+						else
+							for ( handler in events[type] )
+								// Handle the removal of namespaced events
+								if ( !parts[1] || events[type][handler].type == parts[1] )
+									delete events[type][handler];
+						// remove generic event handler if no more handlers exist
+						for ( ret in events[type] ) break;
+						if ( !ret ) {
+							if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem) === false ) {
+								if (elem.removeEventListener)
+									elem.removeEventListener(type, jQuery.data(elem, "handle"), false);
+								else if (elem.detachEvent)
+									elem.detachEvent("on" + type, jQuery.data(elem, "handle"));
+							}
+							ret = null;
+							delete events[type];
+						}
+					}
+				});
+			}
+			// Remove the expando if it's no longer used
+			for ( ret in events ) break;
+			if ( !ret ) {
+				var handle = jQuery.data( elem, "handle" );
+				if ( handle ) handle.elem = null;
+				jQuery.removeData( elem, "events" );
+				jQuery.removeData( elem, "handle" );
+			}
+		}
+	},
+	trigger: function(type, data, elem, donative, extra) {
+		// Clone the incoming data, if any
+		data = jQuery.makeArray(data);
+		if ( type.indexOf("!") >= 0 ) {
+			type = type.slice(0, -1);
+			var exclusive = true;
+		}
+		// Handle a global trigger
+		if ( !elem ) {
+			// Only trigger if we've ever bound an event for it
+			if ( this.global[type] )
+				jQuery("*").add([window, document]).trigger(type, data);
+		// Handle triggering a single element
+		} else {
+			// don't do events on text and comment nodes
+			if ( elem.nodeType == 3 || elem.nodeType == 8 )
+				return undefined;
+			var val, ret, fn = jQuery.isFunction( elem[ type ] || null ),
+				// Check to see if we need to provide a fake event, or not
+				event = !data[0] || !data[0].preventDefault;
+			// Pass along a fake event
+			if ( event ) {
+				data.unshift({
+					type: type,
+					target: elem,
+					preventDefault: function(){},
+					stopPropagation: function(){},
+					timeStamp: now()
+				});
+				data[0][expando] = true; // no need to fix fake event
+			}
+			// Enforce the right trigger type
+			data[0].type = type;
+			if ( exclusive )
+				data[0].exclusive = true;
+			// Trigger the event, it is assumed that "handle" is a function
+			var handle = jQuery.data(elem, "handle");
+			if ( handle )
+				val = handle.apply( elem, data );
+			// Handle triggering native .onfoo handlers (and on links since we don't call .click() for links)
+			if ( (!fn || (jQuery.nodeName(elem, 'a') && type == "click")) && elem["on"+type] && elem["on"+type].apply( elem, data ) === false )
+				val = false;
+			// Extra functions don't get the custom event object
+			if ( event )
+				data.shift();
+			// Handle triggering of extra function
+			if ( extra && jQuery.isFunction( extra ) ) {
+				// call the extra function and tack the current return value on the end for possible inspection
+				ret = extra.apply( elem, val == null ? data : data.concat( val ) );
+				// if anything is returned, give it precedence and have it overwrite the previous value
+				if (ret !== undefined)
+					val = ret;
+			}
+			// Trigger the native events (except for clicks on links)
+			if ( fn && donative !== false && val !== false && !(jQuery.nodeName(elem, 'a') && type == "click") ) {
+				this.triggered = true;
+				try {
+					elem[ type ]();
+				// prevent IE from throwing an error for some hidden elements
+				} catch (e) {}
+			}
+			this.triggered = false;
+		}
+		return val;
+	},
+	handle: function(event) {
+		// returned undefined or false
+		var val, ret, namespace, all, handlers;
+		event = arguments[0] = jQuery.event.fix( event || window.event );
+		// Namespaced event handlers
+		namespace = event.type.split(".");
+		event.type = namespace[0];
+		namespace = namespace[1];
+		// Cache this now, all = true means, any handler
+		all = !namespace && !event.exclusive;
+		handlers = ( jQuery.data(this, "events") || {} )[event.type];
+		for ( var j in handlers ) {
+			var handler = handlers[j];
+			// Filter the functions by class
+			if ( all || handler.type == namespace ) {
+				// Pass in a reference to the handler function itself
+				// So that we can later remove it
+				event.handler = handler;
+				event.data = handler.data;
+				ret = handler.apply( this, arguments );
+				if ( val !== false )
+					val = ret;
+				if ( ret === false ) {
+					event.preventDefault();
+					event.stopPropagation();
+				}
+			}
+		}
+		return val;
+	},
+	props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target timeStamp toElement type view wheelDelta which".split(" "),
+	fix: function(event) {
+		if ( event[expando] == true )
+			return event;
+		// store a copy of the original event object
+		// and "clone" to set read-only properties
+		var originalEvent = event;
+		event = { originalEvent: originalEvent };
+		for ( var i = this.props.length, prop; i; ){
+			prop = this.props[ --i ];
+			event[ prop ] = originalEvent[ prop ];
+		}
+		// Mark it as fixed
+		event[expando] = true;
+		// add preventDefault and stopPropagation since
+		// they will not work on the clone
+		event.preventDefault = function() {
+			// if preventDefault exists run it on the original event
+			if (originalEvent.preventDefault)
+				originalEvent.preventDefault();
+			// otherwise set the returnValue property of the original event to false (IE)
+			originalEvent.returnValue = false;
+		};
+		event.stopPropagation = function() {
+			// if stopPropagation exists run it on the original event
+			if (originalEvent.stopPropagation)
+				originalEvent.stopPropagation();
+			// otherwise set the cancelBubble property of the original event to true (IE)
+			originalEvent.cancelBubble = true;
+		};
+		// Fix timeStamp
+		event.timeStamp = event.timeStamp || now();
+		// Fix target property, if necessary
+		if ( !event.target )
+			event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either
+		// check if target is a textnode (safari)
+		if ( event.target.nodeType == 3 )
+			event.target = event.target.parentNode;
+		// Add relatedTarget, if necessary
+		if ( !event.relatedTarget && event.fromElement )
+			event.relatedTarget = event.fromElement == event.target ? event.toElement : event.fromElement;
+		// Calculate pageX/Y if missing and clientX/Y available
+		if ( event.pageX == null && event.clientX != null ) {
+			var doc = document.documentElement, body = document.body;
+			event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc.clientLeft || 0);
+			event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc.clientTop || 0);
+		}
+		// Add which for key events
+		if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) )
+			event.which = event.charCode || event.keyCode;
+		// Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs)
+		if ( !event.metaKey && event.ctrlKey )
+			event.metaKey = event.ctrlKey;
+		// Add which for click: 1 == left; 2 == middle; 3 == right
+		// Note: button is not normalized, so don't use it
+		if ( !event.which && event.button )
+			event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) ));
+		return event;
+	},
+	proxy: function( fn, proxy ){
+		// Set the guid of unique handler to the same of original handler, so it can be removed
+		proxy.guid = fn.guid = fn.guid || proxy.guid || this.guid++;
+		// So proxy can be declared as an argument
+		return proxy;
+	},
+	special: {
+		ready: {
+			setup: function() {
+				// Make sure the ready event is setup
+				bindReady();
+				return;
+			},
+			teardown: function() { return; }
+		},
+		mouseenter: {
+			setup: function() {
+				if ( jQuery.browser.msie ) return false;
+				jQuery(this).bind("mouseover", jQuery.event.special.mouseenter.handler);
+				return true;
+			},
+			teardown: function() {
+				if ( jQuery.browser.msie ) return false;
+				jQuery(this).unbind("mouseover", jQuery.event.special.mouseenter.handler);
+				return true;
+			},
+			handler: function(event) {
+				// If we actually just moused on to a sub-element, ignore it
+				if ( withinElement(event, this) ) return true;
+				// Execute the right handlers by setting the event type to mouseenter
+				event.type = "mouseenter";
+				return jQuery.event.handle.apply(this, arguments);
+			}
+		},
+		mouseleave: {
+			setup: function() {
+				if ( jQuery.browser.msie ) return false;
+				jQuery(this).bind("mouseout", jQuery.event.special.mouseleave.handler);
+				return true;
+			},
+			teardown: function() {
+				if ( jQuery.browser.msie ) return false;
+				jQuery(this).unbind("mouseout", jQuery.event.special.mouseleave.handler);
+				return true;
+			},
+			handler: function(event) {
+				// If we actually just moused on to a sub-element, ignore it
+				if ( withinElement(event, this) ) return true;
+				// Execute the right handlers by setting the event type to mouseleave
+				event.type = "mouseleave";
+				return jQuery.event.handle.apply(this, arguments);
+			}
+		}
+	}
+	bind: function( type, data, fn ) {
+		return type == "unload" ? this.one(type, data, fn) : this.each(function(){
+			jQuery.event.add( this, type, fn || data, fn && data );
+		});
+	},
+	one: function( type, data, fn ) {
+		var one = jQuery.event.proxy( fn || data, function(event) {
+			jQuery(this).unbind(event, one);
+			return (fn || data).apply( this, arguments );
+		});
+		return this.each(function(){
+			jQuery.event.add( this, type, one, fn && data);
+		});
+	},
+	unbind: function( type, fn ) {
+		return this.each(function(){
+			jQuery.event.remove( this, type, fn );
+		});
+	},
+	trigger: function( type, data, fn ) {
+		return this.each(function(){
+			jQuery.event.trigger( type, data, this, true, fn );
+		});
+	},
+	triggerHandler: function( type, data, fn ) {
+		return this[0] && jQuery.event.trigger( type, data, this[0], false, fn );
+	},
+	toggle: function( fn ) {
+		// Save reference to arguments for access in closure
+		var args = arguments, i = 1;
+		// link all the functions, so any of them can unbind this click handler
+		while( i < args.length )
+			jQuery.event.proxy( fn, args[i++] );
+		return this.click( jQuery.event.proxy( fn, function(event) {
+			// Figure out which function to execute
+			this.lastToggle = ( this.lastToggle || 0 ) % i;
+			// Make sure that clicks stop
+			event.preventDefault();
+			// and execute the function
+			return args[ this.lastToggle++ ].apply( this, arguments ) || false;
+		}));
+	},
+	hover: function(fnOver, fnOut) {
+		return this.bind('mouseenter', fnOver).bind('mouseleave', fnOut);
+	},
+	ready: function(fn) {
+		// Attach the listeners
+		bindReady();
+		// If the DOM is already ready
+		if ( jQuery.isReady )
+			// Execute the function immediately
+			fn.call( document, jQuery );
+		// Otherwise, remember the function for later
+		else
+			// Add the function to the wait list
+			jQuery.readyList.push( function() { return fn.call(this, jQuery); } );
+		return this;
+	}
+	isReady: false,
+	readyList: [],
+	// Handle when the DOM is ready
+	ready: function() {
+		// Make sure that the DOM is not already loaded
+		if ( !jQuery.isReady ) {
+			// Remember that the DOM is ready
+			jQuery.isReady = true;
+			// If there are functions bound, to execute
+			if ( jQuery.readyList ) {
+				// Execute all of them
+				jQuery.each( jQuery.readyList, function(){
+					this.call( document );
+				});
+				// Reset the list of functions
+				jQuery.readyList = null;
+			}
+			// Trigger any bound ready events
+			jQuery(document).triggerHandler("ready");
+		}
+	}
+var readyBound = false;
+function bindReady(){
+	if ( readyBound ) return;
+	readyBound = true;
+	// Mozilla, Opera (see further below for it) and webkit nightlies currently support this event
+	if ( document.addEventListener && !jQuery.browser.opera)
+		// Use the handy event callback
+		document.addEventListener( "DOMContentLoaded", jQuery.ready, false );
+	// If IE is used and is not in a frame
+	// Continually check to see if the document is ready
+	if ( jQuery.browser.msie && window == top ) (function(){
+		if (jQuery.isReady) return;
+		try {
+			// If IE is used, use the trick by Diego Perini
+			// http://javascript.nwbox.com/IEContentLoaded/
+			document.documentElement.doScroll("left");
+		} catch( error ) {
+			setTimeout( arguments.callee, 0 );
+			return;
+		}
+		// and execute any waiting functions
+		jQuery.ready();
+	})();
+	if ( jQuery.browser.opera )
+		document.addEventListener( "DOMContentLoaded", function () {
+			if (jQuery.isReady) return;
+			for (var i = 0; i < document.styleSheets.length; i++)
+				if (document.styleSheets[i].disabled) {
+					setTimeout( arguments.callee, 0 );
+					return;
+				}
+			// and execute any waiting functions
+			jQuery.ready();
+		}, false);
+	if ( jQuery.browser.safari ) {
+		var numStyles;
+		(function(){
+			if (jQuery.isReady) return;
+			if ( document.readyState != "loaded" && document.readyState != "complete" ) {
+				setTimeout( arguments.callee, 0 );
+				return;
+			}
+			if ( numStyles === undefined )
+				numStyles = jQuery("style, link[rel=stylesheet]").length;
+			if ( document.styleSheets.length != numStyles ) {
+				setTimeout( arguments.callee, 0 );
+				return;
+			}
+			// and execute any waiting functions
+			jQuery.ready();
+		})();
+	}
+	// A fallback to window.onload, that will always work
+	jQuery.event.add( window, "load", jQuery.ready );
+jQuery.each( ("blur,focus,load,resize,scroll,unload,click,dblclick," +
+	"mousedown,mouseup,mousemove,mouseover,mouseout,change,select," +
+	"submit,keydown,keypress,keyup,error").split(","), function(i, name){
+	// Handle event binding
+	jQuery.fn[name] = function(fn){
+		return fn ? this.bind(name, fn) : this.trigger(name);
+	};
+// Checks if an event happened on an element within another element
+// Used in jQuery.event.special.mouseenter and mouseleave handlers
+var withinElement = function(event, elem) {
+	// Check if mouse(over|out) are still within the same parent element
+	var parent = event.relatedTarget;
+	// Traverse up the tree
+	while ( parent && parent != elem ) try { parent = parent.parentNode; } catch(error) { parent = elem; }
+	// Return true if we actually just moused on to a sub-element
+	return parent == elem;
+// Prevent memory leaks in IE
+// And prevent errors on refresh with events like mouseover in other browsers
+// Window isn't included so as not to unbind existing unload events
+jQuery(window).bind("unload", function() {
+	jQuery("*").add(document).unbind();
+	// Keep a copy of the old load
+	_load: jQuery.fn.load,
+	load: function( url, params, callback ) {
+		if ( typeof url != 'string' )
+			return this._load( url );
+		var off = url.indexOf(" ");
+		if ( off >= 0 ) {
+			var selector = url.slice(off, url.length);
+			url = url.slice(0, off);
+		}
+		callback = callback || function(){};
+		// Default to a GET request
+		var type = "GET";
+		// If the second parameter was provided
+		if ( params )
+			// If it's a function
+			if ( jQuery.isFunction( params ) ) {
+				// We assume that it's the callback
+				callback = params;
+				params = null;
+			// Otherwise, build a param string
+			} else if( typeof params == 'object' ) {
+				params = jQuery.param( params );
+				type = "POST";
+			}
+		var self = this;
+		// Request the remote document
+		jQuery.ajax({
+			url: url,
+			type: type,
+			dataType: "html",
+			data: params,
+			complete: function(res, status){
+				// If successful, inject the HTML into all the matched elements
+				if ( status == "success" || status == "notmodified" )
+					// See if a selector was specified
+					self.html( selector ?
+						// Create a dummy div to hold the results
+						jQuery("<div/>")
+							// inject the contents of the document in, removing the scripts
+							// to avoid any 'Permission Denied' errors in IE
+							.append(res.responseText.replace(/<script(.|\s)*?\/script>/g, ""))
+							// Locate the specified elements
+							.find(selector) :
+						// If not, just inject the full result
+						res.responseText );
+				self.each( callback, [res.responseText, status, res] );
+			}
+		});
+		return this;
+	},
+	serialize: function() {
+		return jQuery.param(this.serializeArray());
+	},
+	serializeArray: function() {
+		return this.map(function(){
+			return jQuery.nodeName(this, "form") ?
+				jQuery.makeArray(this.elements) : this;
+		})
+		.filter(function(){
+			return this.name && !this.disabled &&
+				(this.checked || /select|textarea/i.test(this.nodeName) ||
+					/text|hidden|password/i.test(this.type));
+		})
+		.map(function(i, elem){
+			var val = jQuery(this).val();
+			return val == null ? null :
+				val.constructor == Array ?
+					jQuery.map( val, function(val, i){
+						return {name: elem.name, value: val};
+					}) :
+					{name: elem.name, value: val};
+		}).get();
+	}
+// Attach a bunch of functions for handling common AJAX events
+jQuery.each( "ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","), function(i,o){
+	jQuery.fn[o] = function(f){
+		return this.bind(o, f);
+	};
+var jsc = now();
+	get: function( url, data, callback, type ) {
+		// shift arguments if data argument was ommited
+		if ( jQuery.isFunction( data ) ) {
+			callback = data;
+			data = null;
+		}
+		return jQuery.ajax({
+			type: "GET",
+			url: url,
+			data: data,
+			success: callback,
+			dataType: type
+		});
+	},
+	getScript: function( url, callback ) {
+		return jQuery.get(url, null, callback, "script");
+	},
+	getJSON: function( url, data, callback ) {
+		return jQuery.get(url, data, callback, "json");
+	},
+	post: function( url, data, callback, type ) {
+		if ( jQuery.isFunction( data ) ) {
+			callback = data;
+			data = {};
+		}
+		return jQuery.ajax({
+			type: "POST",
+			url: url,
+			data: data,
+			success: callback,
+			dataType: type
+		});
+	},
+	ajaxSetup: function( settings ) {
+		jQuery.extend( jQuery.ajaxSettings, settings );
+	},
+	ajaxSettings: {
+		url: location.href,
+		global: true,
+		type: "GET",
+		timeout: 0,
+		contentType: "application/x-www-form-urlencoded",
+		processData: true,
+		async: true,
+		data: null,
+		username: null,
+		password: null,
+		accepts: {
+			xml: "application/xml, text/xml",
+			html: "text/html",
+			script: "text/javascript, application/javascript",
+			json: "application/json, text/javascript",
+			text: "text/plain",
+			_default: "*/*"
+		}
+	},
+	// Last-Modified header cache for next request
+	lastModified: {},
+	ajax: function( s ) {
+		// Extend the settings, but re-extend 's' so that it can be
+		// checked again later (in the test suite, specifically)
+		s = jQuery.extend(true, s, jQuery.extend(true, {}, jQuery.ajaxSettings, s));
+		var jsonp, jsre = /=\?(&|$)/g, status, data,
+			type = s.type.toUpperCase();
+		// convert data if not already a string
+		if ( s.data && s.processData && typeof s.data != "string" )
+			s.data = jQuery.param(s.data);
+		// Handle JSONP Parameter Callbacks
+		if ( s.dataType == "jsonp" ) {
+			if ( type == "GET" ) {
+				if ( !s.url.match(jsre) )
+					s.url += (s.url.match(/\?/) ? "&" : "?") + (s.jsonp || "callback") + "=?";
+			} else if ( !s.data || !s.data.match(jsre) )
+				s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?";
+			s.dataType = "json";
+		}
+		// Build temporary JSONP function
+		if ( s.dataType == "json" && (s.data && s.data.match(jsre) || s.url.match(jsre)) ) {
+			jsonp = "jsonp" + jsc++;
+			// Replace the =? sequence both in the query string and the data
+			if ( s.data )
+				s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1");
+			s.url = s.url.replace(jsre, "=" + jsonp + "$1");
+			// We need to make sure
+			// that a JSONP style response is executed properly
+			s.dataType = "script";
+			// Handle JSONP-style loading
+			window[ jsonp ] = function(tmp){
+				data = tmp;
+				success();
+				complete();
+				// Garbage collect
+				window[ jsonp ] = undefined;
+				try{ delete window[ jsonp ]; } catch(e){}
+				if ( head )
+					head.removeChild( script );
+			};
+		}
+		if ( s.dataType == "script" && s.cache == null )
+			s.cache = false;
+		if ( s.cache === false && type == "GET" ) {
+			var ts = now();
+			// try replacing _= if it is there
+			var ret = s.url.replace(/(\?|&)_=.*?(&|$)/, "$1_=" + ts + "$2");
+			// if nothing was replaced, add timestamp to the end
+			s.url = ret + ((ret == s.url) ? (s.url.match(/\?/) ? "&" : "?") + "_=" + ts : "");
+		}
+		// If data is available, append data to url for get requests
+		if ( s.data && type == "GET" ) {
+			s.url += (s.url.match(/\?/) ? "&" : "?") + s.data;
+			// IE likes to send both get and post data, prevent this
+			s.data = null;
+		}
+		// Watch for a new set of requests
+		if ( s.global && ! jQuery.active++ )
+			jQuery.event.trigger( "ajaxStart" );
+		// Matches an absolute URL, and saves the domain
+		var remote = /^(?:\w+:)?\/\/([^\/?#]+)/;
+		// If we're requesting a remote document
+		// and trying to load JSON or Script with a GET
+		if ( s.dataType == "script" && type == "GET"
+				&& remote.test(s.url) && remote.exec(s.url)[1] != location.host ){
+			var head = document.getElementsByTagName("head")[0];
+			var script = document.createElement("script");
+			script.src = s.url;
+			if (s.scriptCharset)
+				script.charset = s.scriptCharset;
+			// Handle Script loading
+			if ( !jsonp ) {
+				var done = false;
+				// Attach handlers for all browsers
+				script.onload = script.onreadystatechange = function(){
+					if ( !done && (!this.readyState ||
+							this.readyState == "loaded" || this.readyState == "complete") ) {
+						done = true;
+						success();
+						complete();
+						head.removeChild( script );
+					}
+				};
+			}
+			head.appendChild(script);
+			// We handle everything using the script element injection
+			return undefined;
+		}
+		var requestDone = false;
+		// Create the request object; Microsoft failed to properly
+		// implement the XMLHttpRequest in IE7, so we use the ActiveXObject when it is available
+		var xhr = window.ActiveXObject ? new ActiveXObject("Microsoft.XMLHTTP") : new XMLHttpRequest();
+		// Open the socket
+		// Passing null username, generates a login popup on Opera (#2865)
+		if( s.username )
+			xhr.open(type, s.url, s.async, s.username, s.password);
+		else
+			xhr.open(type, s.url, s.async);
+		// Need an extra try/catch for cross domain requests in Firefox 3
+		try {
+			// Set the correct header, if data is being sent
+			if ( s.data )
+				xhr.setRequestHeader("Content-Type", s.contentType);
+			// Set the If-Modified-Since header, if ifModified mode.
+			if ( s.ifModified )
+				xhr.setRequestHeader("If-Modified-Since",
+					jQuery.lastModified[s.url] || "Thu, 01 Jan 1970 00:00:00 GMT" );
+			// Set header so the called script knows that it's an XMLHttpRequest
+			xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest");
+			// Set the Accepts header for the server, depending on the dataType
+			xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ?
+				s.accepts[ s.dataType ] + ", */*" :
+				s.accepts._default );
+		} catch(e){}
+		// Allow custom headers/mimetypes
+		if ( s.beforeSend && s.beforeSend(xhr, s) === false ) {
+			// cleanup active request counter
+			s.global && jQuery.active--;
+			// close opended socket
+			xhr.abort();
+			return false;
+		}
+		if ( s.global )
+			jQuery.event.trigger("ajaxSend", [xhr, s]);
+		// Wait for a response to come back
+		var onreadystatechange = function(isTimeout){
+			// The transfer is complete and the data is available, or the request timed out
+			if ( !requestDone && xhr && (xhr.readyState == 4 || isTimeout == "timeout") ) {
+				requestDone = true;
+				// clear poll interval
+				if (ival) {
+					clearInterval(ival);
+					ival = null;
+				}
+				status = isTimeout == "timeout" ? "timeout" :
+					!jQuery.httpSuccess( xhr ) ? "error" :
+					s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? "notmodified" :
+					"success";
+				if ( status == "success" ) {
+					// Watch for, and catch, XML document parse errors
+					try {
+						// process the data (runs the xml through httpData regardless of callback)
+						data = jQuery.httpData( xhr, s.dataType, s.dataFilter );
+					} catch(e) {
+						status = "parsererror";
+					}
+				}
+				// Make sure that the request was successful or notmodified
+				if ( status == "success" ) {
+					// Cache Last-Modified header, if ifModified mode.
+					var modRes;
+					try {
+						modRes = xhr.getResponseHeader("Last-Modified");
+					} catch(e) {} // swallow exception thrown by FF if header is not available
+					if ( s.ifModified && modRes )
+						jQuery.lastModified[s.url] = modRes;
+					// JSONP handles its own success callback
+					if ( !jsonp )
+						success();
+				} else
+					jQuery.handleError(s, xhr, status);
+				// Fire the complete handlers
+				complete();
+				// Stop memory leaks
+				if ( s.async )
+					xhr = null;
+			}
+		};
+		if ( s.async ) {
+			// don't attach the handler to the request, just poll it instead
+			var ival = setInterval(onreadystatechange, 13);
+			// Timeout checker
+			if ( s.timeout > 0 )
+				setTimeout(function(){
+					// Check to see if the request is still happening
+					if ( xhr ) {
+						// Cancel the request
+						xhr.abort();
+						if( !requestDone )
+							onreadystatechange( "timeout" );
+					}
+				}, s.timeout);
+		}
+		// Send the data
+		try {
+			xhr.send(s.data);
+		} catch(e) {
+			jQuery.handleError(s, xhr, null, e);
+		}
+		// firefox 1.5 doesn't fire statechange for sync requests
+		if ( !s.async )
+			onreadystatechange();
+		function success(){
+			// If a local callback was specified, fire it and pass it the data
+			if ( s.success )
+				s.success( data, status );
+			// Fire the global callback
+			if ( s.global )
+				jQuery.event.trigger( "ajaxSuccess", [xhr, s] );
+		}
+		function complete(){
+			// Process result
+			if ( s.complete )
+				s.complete(xhr, status);
+			// The request was completed
+			if ( s.global )
+				jQuery.event.trigger( "ajaxComplete", [xhr, s] );
+			// Handle the global AJAX counter
+			if ( s.global && ! --jQuery.active )
+				jQuery.event.trigger( "ajaxStop" );
+		}
+		// return XMLHttpRequest to allow aborting the request etc.
+		return xhr;
+	},
+	handleError: function( s, xhr, status, e ) {
+		// If a local callback was specified, fire it
+		if ( s.error ) s.error( xhr, status, e );
+		// Fire the global callback
+		if ( s.global )
+			jQuery.event.trigger( "ajaxError", [xhr, s, e] );
+	},
+	// Counter for holding the number of active queries
+	active: 0,
+	// Determines if an XMLHttpRequest was successful or not
+	httpSuccess: function( xhr ) {
+		try {
+			// IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450
+			return !xhr.status && location.protocol == "file:" ||
+				( xhr.status >= 200 && xhr.status < 300 ) || xhr.status == 304 || xhr.status == 1223 ||
+				jQuery.browser.safari && xhr.status == undefined;
+		} catch(e){}
+		return false;
+	},
+	// Determines if an XMLHttpRequest returns NotModified
+	httpNotModified: function( xhr, url ) {
+		try {
+			var xhrRes = xhr.getResponseHeader("Last-Modified");
+			// Firefox always returns 200. check Last-Modified date
+			return xhr.status == 304 || xhrRes == jQuery.lastModified[url] ||
+				jQuery.browser.safari && xhr.status == undefined;
+		} catch(e){}
+		return false;
+	},
+	httpData: function( xhr, type, filter ) {
+		var ct = xhr.getResponseHeader("content-type"),
+			xml = type == "xml" || !type && ct && ct.indexOf("xml") >= 0,
+			data = xml ? xhr.responseXML : xhr.responseText;
+		if ( xml && data.documentElement.tagName == "parsererror" )
+			throw "parsererror";
+		// Allow a pre-filtering function to sanitize the response
+		if( filter )
+			data = filter( data, type );
+		// If the type is "script", eval it in global context
+		if ( type == "script" )
+			jQuery.globalEval( data );
+		// Get the JavaScript object, if JSON is used.
+		if ( type == "json" )
+			data = eval("(" + data + ")");
+		return data;
+	},
+	// Serialize an array of form elements or a set of
+	// key/values into a query string
+	param: function( a ) {
+		var s = [ ];
+		function add( key, value ){
+			s[ s.length ] = encodeURIComponent(key) + '=' + encodeURIComponent(value);
+		};
+		// If an array was passed in, assume that it is an array
+		// of form elements
+		if ( a.constructor == Array || a.jquery )
+			// Serialize the form elements
+			jQuery.each( a, function(){
+				add( this.name, this.value );
+			});
+		// Otherwise, assume that it's an object of key/value pairs
+		else
+			// Serialize the key/values
+			for ( var j in a )
+				// If the value is an array then the key names need to be repeated
+				if ( a[j] && a[j].constructor == Array )
+					jQuery.each( a[j], function(){
+						add( j, this );
+					});
+				else
+					add( j, jQuery.isFunction(a[j]) ? a[j]() : a[j] );
+		// Return the resulting serialization
+		return s.join("&").replace(/%20/g, "+");
+	}
+	show: function(speed,callback){
+		return speed ?
+			this.animate({
+				height: "show", width: "show", opacity: "show"
+			}, speed, callback) :
+			this.filter(":hidden").each(function(){
+				this.style.display = this.oldblock || "";
+				if ( jQuery.css(this,"display") == "none" ) {
+					var elem = jQuery("<" + this.tagName + " />").appendTo("body");
+					this.style.display = elem.css("display");
+					// handle an edge condition where css is - div { display:none; } or similar
+					if (this.style.display == "none")
+						this.style.display = "block";
+					elem.remove();
+				}
+			}).end();
+	},
+	hide: function(speed,callback){
+		return speed ?
+			this.animate({
+				height: "hide", width: "hide", opacity: "hide"
+			}, speed, callback) :
+			this.filter(":visible").each(function(){
+				this.oldblock = this.oldblock || jQuery.css(this,"display");
+				this.style.display = "none";
+			}).end();
+	},
+	// Save the old toggle function
+	_toggle: jQuery.fn.toggle,
+	toggle: function( fn, fn2 ){
+		return jQuery.isFunction(fn) && jQuery.isFunction(fn2) ?
+			this._toggle.apply( this, arguments ) :
+			fn ?
+				this.animate({
+					height: "toggle", width: "toggle", opacity: "toggle"
+				}, fn, fn2) :
+				this.each(function(){
+					jQuery(this)[ jQuery(this).is(":hidden") ? "show" : "hide" ]();
+				});
+	},
+	slideDown: function(speed,callback){
+		return this.animate({height: "show"}, speed, callback);
+	},
+	slideUp: function(speed,callback){
+		return this.animate({height: "hide"}, speed, callback);
+	},
+	slideToggle: function(speed, callback){
+		return this.animate({height: "toggle"}, speed, callback);
+	},
+	fadeIn: function(speed, callback){
+		return this.animate({opacity: "show"}, speed, callback);
+	},
+	fadeOut: function(speed, callback){
+		return this.animate({opacity: "hide"}, speed, callback);
+	},
+	fadeTo: function(speed,to,callback){
+		return this.animate({opacity: to}, speed, callback);
+	},
+	animate: function( prop, speed, easing, callback ) {
+		var optall = jQuery.speed(speed, easing, callback);
+		return this[ optall.queue === false ? "each" : "queue" ](function(){
+			if ( this.nodeType != 1)
+				return false;
+			var opt = jQuery.extend({}, optall), p,
+				hidden = jQuery(this).is(":hidden"), self = this;
+			for ( p in prop ) {
+				if ( prop[p] == "hide" && hidden || prop[p] == "show" && !hidden )
+					return opt.complete.call(this);
+				if ( p == "height" || p == "width" ) {
+					// Store display property
+					opt.display = jQuery.css(this, "display");
+					// Make sure that nothing sneaks out
+					opt.overflow = this.style.overflow;
+				}
+			}
+			if ( opt.overflow != null )
+				this.style.overflow = "hidden";
+			opt.curAnim = jQuery.extend({}, prop);
+			jQuery.each( prop, function(name, val){
+				var e = new jQuery.fx( self, opt, name );
+				if ( /toggle|show|hide/.test(val) )
+					e[ val == "toggle" ? hidden ? "show" : "hide" : val ]( prop );
+				else {
+					var parts = val.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/),
+						start = e.cur(true) || 0;
+					if ( parts ) {
+						var end = parseFloat(parts[2]),
+							unit = parts[3] || "px";
+						// We need to compute starting value
+						if ( unit != "px" ) {
+							self.style[ name ] = (end || 1) + unit;
+							start = ((end || 1) / e.cur(true)) * start;
+							self.style[ name ] = start + unit;
+						}
+						// If a +=/-= token was provided, we're doing a relative animation
+						if ( parts[1] )
+							end = ((parts[1] == "-=" ? -1 : 1) * end) + start;
+						e.custom( start, end, unit );
+					} else
+						e.custom( start, val, "" );
+				}
+			});
+			// For JS strict compliance
+			return true;
+		});
+	},
+	queue: function(type, fn){
+		if ( jQuery.isFunction(type) || ( type && type.constructor == Array )) {
+			fn = type;
+			type = "fx";
+		}
+		if ( !type || (typeof type == "string" && !fn) )
+			return queue( this[0], type );
+		return this.each(function(){
+			if ( fn.constructor == Array )
+				queue(this, type, fn);
+			else {
+				queue(this, type).push( fn );
+				if ( queue(this, type).length == 1 )
+					fn.call(this);
+			}
+		});
+	},
+	stop: function(clearQueue, gotoEnd){
+		var timers = jQuery.timers;
+		if (clearQueue)
+			this.queue([]);
+		this.each(function(){
+			// go in reverse order so anything added to the queue during the loop is ignored
+			for ( var i = timers.length - 1; i >= 0; i-- )
+				if ( timers[i].elem == this ) {
+					if (gotoEnd)
+						// force the next step to be the last
+						timers[i](true);
+					timers.splice(i, 1);
+				}
+		});
+		// start the next in the queue if the last step wasn't forced
+		if (!gotoEnd)
+			this.dequeue();
+		return this;
+	}
+var queue = function( elem, type, array ) {
+	if ( elem ){
+		type = type || "fx";
+		var q = jQuery.data( elem, type + "queue" );
+		if ( !q || array )
+			q = jQuery.data( elem, type + "queue", jQuery.makeArray(array) );
+	}
+	return q;
+jQuery.fn.dequeue = function(type){
+	type = type || "fx";
+	return this.each(function(){
+		var q = queue(this, type);
+		q.shift();
+		if ( q.length )
+			q[0].call( this );
+	});
+	speed: function(speed, easing, fn) {
+		var opt = speed && speed.constructor == Object ? speed : {
+			complete: fn || !fn && easing ||
+				jQuery.isFunction( speed ) && speed,
+			duration: speed,
+			easing: fn && easing || easing && easing.constructor != Function && easing
+		};
+		opt.duration = (opt.duration && opt.duration.constructor == Number ?
+			opt.duration :
+			jQuery.fx.speeds[opt.duration]) || jQuery.fx.speeds.def;
+		// Queueing
+		opt.old = opt.complete;
+		opt.complete = function(){
+			if ( opt.queue !== false )
+				jQuery(this).dequeue();
+			if ( jQuery.isFunction( opt.old ) )
+				opt.old.call( this );
+		};
+		return opt;
+	},
+	easing: {
+		linear: function( p, n, firstNum, diff ) {
+			return firstNum + diff * p;
+		},
+		swing: function( p, n, firstNum, diff ) {
+			return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum;
+		}
+	},
+	timers: [],
+	timerId: null,
+	fx: function( elem, options, prop ){
+		this.options = options;
+		this.elem = elem;
+		this.prop = prop;
+		if ( !options.orig )
+			options.orig = {};
+	}
+jQuery.fx.prototype = {
+	// Simple function for setting a style value
+	update: function(){
+		if ( this.options.step )
+			this.options.step.call( this.elem, this.now, this );
+		(jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this );
+		// Set display property to block for height/width animations
+		if ( this.prop == "height" || this.prop == "width" )
+			this.elem.style.display = "block";
+	},
+	// Get the current size
+	cur: function(force){
+		if ( this.elem[this.prop] != null && this.elem.style[this.prop] == null )
+			return this.elem[ this.prop ];
+		var r = parseFloat(jQuery.css(this.elem, this.prop, force));
+		return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0;
+	},
+	// Start an animation from one number to another
+	custom: function(from, to, unit){
+		this.startTime = now();
+		this.start = from;
+		this.end = to;
+		this.unit = unit || this.unit || "px";
+		this.now = this.start;
+		this.pos = this.state = 0;
+		this.update();
+		var self = this;
+		function t(gotoEnd){
+			return self.step(gotoEnd);
+		}
+		t.elem = this.elem;
+		jQuery.timers.push(t);
+		if ( jQuery.timerId == null ) {
+			jQuery.timerId = setInterval(function(){
+				var timers = jQuery.timers;
+				for ( var i = 0; i < timers.length; i++ )
+					if ( !timers[i]() )
+						timers.splice(i--, 1);
+				if ( !timers.length ) {
+					clearInterval( jQuery.timerId );
+					jQuery.timerId = null;
+				}
+			}, 13);
+		}
+	},
+	// Simple 'show' function
+	show: function(){
+		// Remember where we started, so that we can go back to it later
+		this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop );
+		this.options.show = true;
+		// Begin the animation
+		this.custom(0, this.cur());
+		// Make sure that we start at a small width/height to avoid any
+		// flash of content
+		if ( this.prop == "width" || this.prop == "height" )
+			this.elem.style[this.prop] = "1px";
+		// Start by showing the element
+		jQuery(this.elem).show();
+	},
+	// Simple 'hide' function
+	hide: function(){
+		// Remember where we started, so that we can go back to it later
+		this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop );
+		this.options.hide = true;
+		// Begin the animation
+		this.custom(this.cur(), 0);
+	},
+	// Each step of an animation
+	step: function(gotoEnd){
+		var t = now();
+		if ( gotoEnd || t > this.options.duration + this.startTime ) {
+			this.now = this.end;
+			this.pos = this.state = 1;
+			this.update();
+			this.options.curAnim[ this.prop ] = true;
+			var done = true;
+			for ( var i in this.options.curAnim )
+				if ( this.options.curAnim[i] !== true )
+					done = false;
+			if ( done ) {
+				if ( this.options.display != null ) {
+					// Reset the overflow
+					this.elem.style.overflow = this.options.overflow;
+					// Reset the display
+					this.elem.style.display = this.options.display;
+					if ( jQuery.css(this.elem, "display") == "none" )
+						this.elem.style.display = "block";
+				}
+				// Hide the element if the "hide" operation was done
+				if ( this.options.hide )
+					this.elem.style.display = "none";
+				// Reset the properties, if the item has been hidden or shown
+				if ( this.options.hide || this.options.show )
+					for ( var p in this.options.curAnim )
+						jQuery.attr(this.elem.style, p, this.options.orig[p]);
+			}
+			if ( done )
+				// Execute the complete function
+				this.options.complete.call( this.elem );
+			return false;
+		} else {
+			var n = t - this.startTime;
+			this.state = n / this.options.duration;
+			// Perform the easing function, defaults to swing
+			this.pos = jQuery.easing[this.options.easing || (jQuery.easing.swing ? "swing" : "linear")](this.state, n, 0, 1, this.options.duration);
+			this.now = this.start + ((this.end - this.start) * this.pos);
+			// Perform the next step of the animation
+			this.update();
+		}
+		return true;
+	}
+jQuery.extend( jQuery.fx, {
+	speeds:{
+		slow: 600,
+ 		fast: 200,
+ 		// Default speed
+ 		def: 400
+	},
+	step: {
+		scrollLeft: function(fx){
+			fx.elem.scrollLeft = fx.now;
+		},
+		scrollTop: function(fx){
+			fx.elem.scrollTop = fx.now;
+		},
+		opacity: function(fx){
+			jQuery.attr(fx.elem.style, "opacity", fx.now);
+		},
+		_default: function(fx){
+			fx.elem.style[ fx.prop ] = fx.now + fx.unit;
+		}
+	}
+// The Offset Method
+// Originally By Brandon Aaron, part of the Dimension Plugin
+// http://jquery.com/plugins/project/dimensions
+jQuery.fn.offset = function() {
+	var left = 0, top = 0, elem = this[0], results;
+	if ( elem ) with ( jQuery.browser ) {
+		var parent       = elem.parentNode,
+		    offsetChild  = elem,
+		    offsetParent = elem.offsetParent,
+		    doc          = elem.ownerDocument,
+		    safari2      = safari && parseInt(version) < 522 && !/adobeair/i.test(userAgent),
+		    css          = jQuery.curCSS,
+		    fixed        = css(elem, "position") == "fixed";
+		// Use getBoundingClientRect if available
+		if ( !(mozilla && elem == document.body) && elem.getBoundingClientRect ) {
+			var box = elem.getBoundingClientRect();
+			// Add the document scroll offsets
+			add(box.left + Math.max(doc.documentElement.scrollLeft, doc.body.scrollLeft),
+				box.top  + Math.max(doc.documentElement.scrollTop,  doc.body.scrollTop));
+			// IE adds the HTML element's border, by default it is medium which is 2px
+			// IE 6 and 7 quirks mode the border width is overwritable by the following css html { border: 0; }
+			// IE 7 standards mode, the border is always 2px
+			// This border/offset is typically represented by the clientLeft and clientTop properties
+			// However, in IE6 and 7 quirks mode the clientLeft and clientTop properties are not updated when overwriting it via CSS
+			// Therefore this method will be off by 2px in IE while in quirksmode
+			add( -doc.documentElement.clientLeft, -doc.documentElement.clientTop );
+		// Otherwise loop through the offsetParents and parentNodes
+		} else {
+			// Initial element offsets
+			add( elem.offsetLeft, elem.offsetTop );
+			// Get parent offsets
+			while ( offsetParent ) {
+				// Add offsetParent offsets
+				add( offsetParent.offsetLeft, offsetParent.offsetTop );
+				// Mozilla and Safari > 2 does not include the border on offset parents
+				// However Mozilla adds the border for table or table cells
+				if ( mozilla && !/^t(able|d|h)$/i.test(offsetParent.tagName) || safari && !safari2 )
+					border( offsetParent );
+				// Add the document scroll offsets if position is fixed on any offsetParent
+				if ( !fixed && css(offsetParent, "position") == "fixed" )
+					fixed = true;
+				// Set offsetChild to previous offsetParent unless it is the body element
+				offsetChild  = /^body$/i.test(offsetParent.tagName) ? offsetChild : offsetParent;
+				// Get next offsetParent
+				offsetParent = offsetParent.offsetParent;
+			}
+			// Get parent scroll offsets
+			while ( parent && parent.tagName && !/^body|html$/i.test(parent.tagName) ) {
+				// Remove parent scroll UNLESS that parent is inline or a table to work around Opera inline/table scrollLeft/Top bug
+				if ( !/^inline|table.*$/i.test(css(parent, "display")) )
+					// Subtract parent scroll offsets
+					add( -parent.scrollLeft, -parent.scrollTop );
+				// Mozilla does not add the border for a parent that has overflow != visible
+				if ( mozilla && css(parent, "overflow") != "visible" )
+					border( parent );
+				// Get next parent
+				parent = parent.parentNode;
+			}
+			// Safari <= 2 doubles body offsets with a fixed position element/offsetParent or absolutely positioned offsetChild
+			// Mozilla doubles body offsets with a non-absolutely positioned offsetChild
+			if ( (safari2 && (fixed || css(offsetChild, "position") == "absolute")) ||
+				(mozilla && css(offsetChild, "position") != "absolute") )
+					add( -doc.body.offsetLeft, -doc.body.offsetTop );
+			// Add the document scroll offsets if position is fixed
+			if ( fixed )
+				add(Math.max(doc.documentElement.scrollLeft, doc.body.scrollLeft),
+					Math.max(doc.documentElement.scrollTop,  doc.body.scrollTop));
+		}
+		// Return an object with top and left properties
+		results = { top: top, left: left };
+	}
+	function border(elem) {
+		add( jQuery.curCSS(elem, "borderLeftWidth", true), jQuery.curCSS(elem, "borderTopWidth", true) );
+	}
+	function add(l, t) {
+		left += parseInt(l, 10) || 0;
+		top += parseInt(t, 10) || 0;
+	}
+	return results;
+	position: function() {
+		var left = 0, top = 0, results;
+		if ( this[0] ) {
+			// Get *real* offsetParent
+			var offsetParent = this.offsetParent(),
+			// Get correct offsets
+			offset       = this.offset(),
+			parentOffset = /^body|html$/i.test(offsetParent[0].tagName) ? { top: 0, left: 0 } : offsetParent.offset();
+			// Subtract element margins
+			// note: when an element has margin: auto the offsetLeft and marginLeft 
+			// are the same in Safari causing offset.left to incorrectly be 0
+			offset.top  -= num( this, 'marginTop' );
+			offset.left -= num( this, 'marginLeft' );
+			// Add offsetParent borders
+			parentOffset.top  += num( offsetParent, 'borderTopWidth' );
+			parentOffset.left += num( offsetParent, 'borderLeftWidth' );
+			// Subtract the two offsets
+			results = {
+				top:  offset.top  - parentOffset.top,
+				left: offset.left - parentOffset.left
+			};
+		}
+		return results;
+	},
+	offsetParent: function() {
+		var offsetParent = this[0].offsetParent;
+		while ( offsetParent && (!/^body|html$/i.test(offsetParent.tagName) && jQuery.css(offsetParent, 'position') == 'static') )
+			offsetParent = offsetParent.offsetParent;
+		return jQuery(offsetParent);
+	}
+// Create scrollLeft and scrollTop methods
+jQuery.each( ['Left', 'Top'], function(i, name) {
+	var method = 'scroll' + name;
+	jQuery.fn[ method ] = function(val) {
+		if (!this[0]) return;
+		return val != undefined ?
+			// Set the scroll offset
+			this.each(function() {
+				this == window || this == document ?
+					window.scrollTo(
+						!i ? val : jQuery(window).scrollLeft(),
+						 i ? val : jQuery(window).scrollTop()
+					) :
+					this[ method ] = val;
+			}) :
+			// Return the scroll offset
+			this[0] == window || this[0] == document ?
+				self[ i ? 'pageYOffset' : 'pageXOffset' ] ||
+					jQuery.boxModel && document.documentElement[ method ] ||
+					document.body[ method ] :
+				this[0][ method ];
+	};
+// Create innerHeight, innerWidth, outerHeight and outerWidth methods
+jQuery.each([ "Height", "Width" ], function(i, name){
+	var tl = i ? "Left"  : "Top",  // top or left
+		br = i ? "Right" : "Bottom"; // bottom or right
+	// innerHeight and innerWidth
+	jQuery.fn["inner" + name] = function(){
+		return this[ name.toLowerCase() ]() +
+			num(this, "padding" + tl) +
+			num(this, "padding" + br);
+	};
+	// outerHeight and outerWidth
+	jQuery.fn["outer" + name] = function(margin) {
+		return this["inner" + name]() +
+			num(this, "border" + tl + "Width") +
+			num(this, "border" + br + "Width") +
+			(margin ?
+				num(this, "margin" + tl) + num(this, "margin" + br) : 0);
+	};
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/lib/thickbox-compressed.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,10 @@
+ * Thickbox 3 - One Box To Rule Them All.
+ * By Cody Lindley (http://www.codylindley.com)
+ * Copyright (c) 2007 cody lindley
+ * Licensed under the MIT License: http://www.opensource.org/licenses/mit-license.php
+var tb_pathToImage = "images/loadingAnimation.gif";
+eval(function(p,a,c,k,e,r){e=function(c){return(c<a?'':e(parseInt(c/a)))+((c=c%a)>35?String.fromCharCode(c+29):c.toString(36))};if(!''.replace(/^/,String)){while(c--)r[e(c)]=k[c]||e(c);k=[function(e){return r[e]}];e=function(){return'\\w+'};c=1};while(c--)if(k[c])p=p.replace(new RegExp('\\b'+e(c)+'\\b','g'),k[c]);return p}('$(o).2S(9(){1u(\'a.18, 3n.18, 3i.18\');1w=1p 1t();1w.L=2H});9 1u(b){$(b).s(9(){6 t=X.Q||X.1v||M;6 a=X.u||X.23;6 g=X.1N||P;19(t,a,g);X.2E();H P})}9 19(d,f,g){3m{3(2t o.v.J.2i==="2g"){$("v","11").r({A:"28%",z:"28%"});$("11").r("22","2Z");3(o.1Y("1F")===M){$("v").q("<U 5=\'1F\'></U><4 5=\'B\'></4><4 5=\'8\'></4>");$("#B").s(G)}}n{3(o.1Y("B")===M){$("v").q("<4 5=\'B\'></4><4 5=\'8\'></4>");$("#B").s(G)}}3(1K()){$("#B").1J("2B")}n{$("#B").1J("2z")}3(d===M){d=""}$("v").q("<4 5=\'K\'><1I L=\'"+1w.L+"\' /></4>");$(\'#K\').2y();6 h;3(f.O("?")!==-1){h=f.3l(0,f.O("?"))}n{h=f}6 i=/\\.2s$|\\.2q$|\\.2m$|\\.2l$|\\.2k$/;6 j=h.1C().2h(i);3(j==\'.2s\'||j==\'.2q\'||j==\'.2m\'||j==\'.2l\'||j==\'.2k\'){1D="";1G="";14="";1z="";1x="";R="";1n="";1r=P;3(g){E=$("a[@1N="+g+"]").36();25(D=0;((D<E.1c)&&(R===""));D++){6 k=E[D].u.1C().2h(i);3(!(E[D].u==f)){3(1r){1z=E[D].Q;1x=E[D].u;R="<1e 5=\'1X\'>&1d;&1d;<a u=\'#\'>2T &2R;</a></1e>"}n{1D=E[D].Q;1G=E[D].u;14="<1e 5=\'1U\'>&1d;&1d;<a u=\'#\'>&2O; 2N</a></1e>"}}n{1r=1b;1n="1t "+(D+1)+" 2L "+(E.1c)}}}S=1p 1t();S.1g=9(){S.1g=M;6 a=2x();6 x=a[0]-1M;6 y=a[1]-1M;6 b=S.z;6 c=S.A;3(b>x){c=c*(x/b);b=x;3(c>y){b=b*(y/c);c=y}}n 3(c>y){b=b*(y/c);c=y;3(b>x){c=c*(x/b);b=x}}13=b+30;1a=c+2G;$("#8").q("<a u=\'\' 5=\'1L\' Q=\'1o\'><1I 5=\'2F\' L=\'"+f+"\' z=\'"+b+"\' A=\'"+c+"\' 23=\'"+d+"\'/></a>"+"<4 5=\'2D\'>"+d+"<4 5=\'2C\'>"+1n+14+R+"</4></4><4 5=\'2A\'><a u=\'#\' 5=\'Z\' Q=\'1o\'>1l</a> 1k 1j 1s</4>");$("#Z").s(G);3(!(14==="")){9 12(){3($(o).N("s",12)){$(o).N("s",12)}$("#8").C();$("v").q("<4 5=\'8\'></4>");19(1D,1G,g);H P}$("#1U").s(12)}3(!(R==="")){9 1i(){$("#8").C();$("v").q("<4 5=\'8\'></4>");19(1z,1x,g);H P}$("#1X").s(1i)}o.1h=9(e){3(e==M){I=2w.2v}n{I=e.2u}3(I==27){G()}n 3(I==3k){3(!(R=="")){o.1h="";1i()}}n 3(I==3j){3(!(14=="")){o.1h="";12()}}};16();$("#K").C();$("#1L").s(G);$("#8").r({Y:"T"})};S.L=f}n{6 l=f.2r(/^[^\\?]+\\??/,\'\');6 m=2p(l);13=(m[\'z\']*1)+30||3h;1a=(m[\'A\']*1)+3g||3f;W=13-30;V=1a-3e;3(f.O(\'2j\')!=-1){1E=f.1B(\'3d\');$("#15").C();3(m[\'1A\']!="1b"){$("#8").q("<4 5=\'2f\'><4 5=\'1H\'>"+d+"</4><4 5=\'2e\'><a u=\'#\' 5=\'Z\' Q=\'1o\'>1l</a> 1k 1j 1s</4></4><U 1W=\'0\' 2d=\'0\' L=\'"+1E[0]+"\' 5=\'15\' 1v=\'15"+1f.2c(1f.1y()*2b)+"\' 1g=\'1m()\' J=\'z:"+(W+29)+"p;A:"+(V+17)+"p;\' > </U>")}n{$("#B").N();$("#8").q("<U 1W=\'0\' 2d=\'0\' L=\'"+1E[0]+"\' 5=\'15\' 1v=\'15"+1f.2c(1f.1y()*2b)+"\' 1g=\'1m()\' J=\'z:"+(W+29)+"p;A:"+(V+17)+"p;\'> </U>")}}n{3($("#8").r("Y")!="T"){3(m[\'1A\']!="1b"){$("#8").q("<4 5=\'2f\'><4 5=\'1H\'>"+d+"</4><4 5=\'2e\'><a u=\'#\' 5=\'Z\'>1l</a> 1k 1j 1s</4></4><4 5=\'F\' J=\'z:"+W+"p;A:"+V+"p\'></4>")}n{$("#B").N();$("#8").q("<4 5=\'F\' 3c=\'3b\' J=\'z:"+W+"p;A:"+V+"p;\'></4>")}}n{$("#F")[0].J.z=W+"p";$("#F")[0].J.A=V+"p";$("#F")[0].3a=0;$("#1H").11(d)}}$("#Z").s(G);3(f.O(\'37\')!=-1){$("#F").q($(\'#\'+m[\'26\']).1T());$("#8").24(9(){$(\'#\'+m[\'26\']).q($("#F").1T())});16();$("#K").C();$("#8").r({Y:"T"})}n 3(f.O(\'2j\')!=-1){16();3($.1q.35){$("#K").C();$("#8").r({Y:"T"})}}n{$("#F").34(f+="&1y="+(1p 33().32()),9(){16();$("#K").C();1u("#F a.18");$("#8").r({Y:"T"})})}}3(!m[\'1A\']){o.21=9(e){3(e==M){I=2w.2v}n{I=e.2u}3(I==27){G()}}}}31(e){}}9 1m(){$("#K").C();$("#8").r({Y:"T"})}9 G(){$("#2Y").N("s");$("#Z").N("s");$("#8").2X("2W",9(){$(\'#8,#B,#1F\').2V("24").N().C()});$("#K").C();3(2t o.v.J.2i=="2g"){$("v","11").r({A:"1Z",z:"1Z"});$("11").r("22","")}o.1h="";o.21="";H P}9 16(){$("#8").r({2U:\'-\'+20((13/2),10)+\'p\',z:13+\'p\'});3(!(1V.1q.2Q&&1V.1q.2P<7)){$("#8").r({38:\'-\'+20((1a/2),10)+\'p\'})}}9 2p(a){6 b={};3(!a){H b}6 c=a.1B(/[;&]/);25(6 i=0;i<c.1c;i++){6 d=c[i].1B(\'=\');3(!d||d.1c!=2){39}6 e=2a(d[0]);6 f=2a(d[1]);f=f.2r(/\\+/g,\' \');b[e]=f}H b}9 2x(){6 a=o.2M;6 w=1S.2o||1R.2o||(a&&a.1Q)||o.v.1Q;6 h=1S.1P||1R.1P||(a&&a.2n)||o.v.2n;1O=[w,h];H 1O}9 1K(){6 a=2K.2J.1C();3(a.O(\'2I\')!=-1&&a.O(\'3o\')!=-1){H 1b}}',62,211,'|||if|div|id|var||TB_window|function||||||||||||||else|document|px|append|css|click||href|body||||width|height|TB_overlay|remove|TB_Counter|TB_TempArray|TB_ajaxContent|tb_remove|return|keycode|style|TB_load|src|null|unbind|indexOf|false|title|TB_NextHTML|imgPreloader|block|iframe|ajaxContentH|ajaxContentW|this|display|TB_closeWindowButton||html|goPrev|TB_WIDTH|TB_PrevHTML|TB_iframeContent|tb_position||thickbox|tb_show|TB_HEIGHT|true|length|nbsp|span|Math|onload|onkeydown|goNext|Esc|or|close|tb_showIframe|TB_imageCount|Close|new|browser|TB_FoundURL|Key|Image|tb_init|name|imgLoader|TB_NextURL|random|TB_NextCaption|modal|split|toLowerCase|TB_PrevCaption|urlNoQuery|TB_HideSelect|TB_PrevURL|TB_ajaxWindowTitle|img|addClass|tb_detectMacXFF|TB_ImageOff|150|rel|arrayPageSize|innerHeight|clientWidth|self|window|children|TB_prev|jQuery|frameborder|TB_next|getElementById|auto|parseInt|onkeyup|overflow|alt|unload|for|inlineId||100||unescape|1000|round|hspace|TB_closeAjaxWindow|TB_title|undefined|match|maxHeight|TB_iframe|bmp|gif|png|clientHeight|innerWidth|tb_parseQuery|jpeg|replace|jpg|typeof|which|keyCode|event|tb_getPageSize|show|TB_overlayBG|TB_closeWindow|TB_overlayMacFFBGHack|TB_secondLine|TB_caption|blur|TB_Image|60|tb_pathToImage|mac|userAgent|navigator|of|documentElement|Prev|lt|version|msie|gt|ready|Next|marginLeft|trigger|fast|fadeOut|TB_imageOff|hidden||catch|getTime|Date|load|safari|get|TB_inline|marginTop|continue|scrollTop|TB_modal|class|TB_|45|440|40|630|input|188|190|substr|try|area|firefox'.split('|'),0,{}))
\ No newline at end of file
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/lib/thickbox.css	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,163 @@
+/* ----------------------------------------------------------------------------------------------------------------*/
+/* ---------->>> global settings needed for thickbox <<<-----------------------------------------------------------*/
+/* ----------------------------------------------------------------------------------------------------------------*/
+*{padding: 0; margin: 0;}
+/* ----------------------------------------------------------------------------------------------------------------*/
+/* ---------->>> thickbox specific link and font settings <<<------------------------------------------------------*/
+/* ----------------------------------------------------------------------------------------------------------------*/
+#TB_window {
+	font: 12px Arial, Helvetica, sans-serif;
+	color: #333333;
+#TB_secondLine {
+	font: 10px Arial, Helvetica, sans-serif;
+	color:#666666;
+#TB_window a:link {color: #666666;}
+#TB_window a:visited {color: #666666;}
+#TB_window a:hover {color: #000;}
+#TB_window a:active {color: #666666;}
+#TB_window a:focus{color: #666666;}
+/* ----------------------------------------------------------------------------------------------------------------*/
+/* ---------->>> thickbox settings <<<-----------------------------------------------------------------------------*/
+/* ----------------------------------------------------------------------------------------------------------------*/
+#TB_overlay {
+	position: fixed;
+	z-index:100;
+	top: 0px;
+	left: 0px;
+	height:100%;
+	width:100%;
+.TB_overlayMacFFBGHack {background: url(macFFBgHack.png) repeat;}
+.TB_overlayBG {
+	background-color:#000;
+	filter:alpha(opacity=75);
+	-moz-opacity: 0.75;
+	opacity: 0.75;
+* html #TB_overlay { /* ie6 hack */
+     position: absolute;
+     height: expression(document.body.scrollHeight > document.body.offsetHeight ? document.body.scrollHeight : document.body.offsetHeight + 'px');
+#TB_window {
+	position: fixed;
+	background: #ffffff;
+	z-index: 102;
+	color:#000000;
+	display:none;
+	border: 4px solid #525252;
+	text-align:left;
+	top:50%;
+	left:50%;
+* html #TB_window { /* ie6 hack */
+position: absolute;
+margin-top: expression(0 - parseInt(this.offsetHeight / 2) + (TBWindowMargin = document.documentElement && document.documentElement.scrollTop || document.body.scrollTop) + 'px');
+#TB_window img#TB_Image {
+	display:block;
+	margin: 15px 0 0 15px;
+	border-right: 1px solid #ccc;
+	border-bottom: 1px solid #ccc;
+	border-top: 1px solid #666;
+	border-left: 1px solid #666;
+	height:25px;
+	padding:7px 30px 10px 25px;
+	float:left;
+	height:25px;
+	padding:11px 25px 10px 0;
+	float:right;
+	padding:7px 10px 5px 0;
+	margin-bottom:1px;
+	text-align:right;
+	float:right;
+	float:left;
+	padding:7px 0 5px 10px;
+	margin-bottom:1px;
+	background-color:#e8e8e8;
+	height:27px;
+	clear:both;
+	padding:2px 15px 15px 15px;
+	overflow:auto;
+	text-align:left;
+	line-height:1.4em;
+	padding:15px;
+#TB_ajaxContent p{
+	padding:5px 0px 5px 0px;
+	position: fixed;
+	display:none;
+	height:13px;
+	width:208px;
+	z-index:103;
+	top: 50%;
+	left: 50%;
+	margin: -6px 0 0 -104px; /* -height/2 0 0 -width/2 */
+* html #TB_load { /* ie6 hack */
+position: absolute;
+margin-top: expression(0 - parseInt(this.offsetHeight / 2) + (TBWindowMargin = document.documentElement && document.documentElement.scrollTop || document.body.scrollTop) + 'px');
+	z-index:99;
+	position:fixed;
+	top: 0;
+	left: 0;
+	background-color:#fff;
+	border:none;
+	filter:alpha(opacity=0);
+	-moz-opacity: 0;
+	opacity: 0;
+	height:100%;
+	width:100%;
+* html #TB_HideSelect { /* ie6 hack */
+     position: absolute;
+     height: expression(document.body.scrollHeight > document.body.offsetHeight ? document.body.scrollHeight : document.body.offsetHeight + 'px');
+	clear:both;
+	border:none;
+	margin-bottom:-1px;
+	margin-top:1px;
+	_margin-bottom:1px;
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-autocomplete/todo	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,166 @@
+- test formatItem implementation that returns (clickable) anchors
+- bug: handle del key; eg. type a letter, remove it using del, type same letter again: nothing happens
+- handle up/down keys in textarea (prevent default while select is open?)
+- docs: max:0 works, too, "removing" it(??)
+- fix ac_loading/options.loadingClass
+- support/enable request urls like foo/bar/10 instead of foo/q=10
+- urlencode request term before passing to $.ajax/data; evaluate why $.ajax doesn't handle that itself, if at all; try with umlauts, russian/danish/chinese characeters (see validate)
+- test what happens when an element gets focused programmatically (maybe even before then autcomplete is applied)
+- check if blur on selecting can be removed
+- fix keyhandling to ignore metakeys, eg. shift; especially important for chinese characters that need more then one key
+- enhance mustMatch: provide event/callback when a value gets deleted
+- handle tab key different then enter, eg. don't blur field or prevent default, just let it move on; in any case, no need to blur the field when selecting a value via tab, unlike return
+- prevent redundant requests on
+  - superstring returned no result, no need to query again for substring, eg. pete returned nothing, peter won't either
+  - previous query mustn't be requested again, eg. pete returns 10 lines, peter nothing, backspace to pete should get the 10 lines from cache (may need TimeToLive setting for cache to invalidate it)
+- incorporate improvements and suggestions by Hector: http://beta.winserver.com/public/test/MultiSuggestTest.wct
+- json support: An optional JSON format, that assumes a certain JSON format as default and just looks for a dataType "json" to be activated; [records], where each record is { id:String, label:String, moreOptionalValues... } 
+- accept callback as first argument to let users implement their own dynamic data (no caching) - consider async API
+- allow users to keep their incomplete value when pressing tab, just mimic the default-browser-autocomplete: tab doesn't select any proposed value -> tab closes the select and works normal otherwise
+- small bug in your autocomplete,  When setting autoFill:true I would expect formatResult to be called on autofill, it seems not to be the case.
+- add a callback to allow decoding the response
+- allow modification of not-last value in multiple-fields
[email protected] Number size Limit the number of items to show at once. Default: 
[email protected] Function parse - TEST AND DOCUMENT ME
+- add option to display selectbox on focus
+$input.bind("show", function() {
+	if ( !select.visible() ) {
+		onChange(0, true);
+	}
+- reference: http://capxous.com/
+  - add "try ..." hints to demo
+  - check out demos
+- reference: http://createwebapp.com/demo/
+- add option to hide selectbox when no match is found - see comment by Ian on plugin page (14. Juli 2007 04:31)
+- add example for reinitializing an autocomplete using unbind()
+- Add option to pass through additional arguments to $.ajax, like type to use POST instead of GET
+ - I found out that the problem with UTF-8 not being correctly sent can be solved on the server side by applying (PHP) rawurldecode() function, which decodes the Unicode characters sent by GET method and therefore URL-encoded.
+-> add that hint to docs and examples
+But I am trying this with these three values: “foo bar”, “foo foo”, and “foo far”, and if I enter “b” (or “ba”) nothing matches, if I enter “f” all three do match, and if I enter “fa” the last one matches.
+The problem seems to be that the cache is implemented with a first-character hashtable, so only after matching the first character, the latter ones are searched for.
+xml example:
+<script type="text/javascript">
+      function parseXML(data) {
+        var results = [];
+        var branches = $(data).find('item');
+        $(branches).each(function() {
+          var text = $.trim($(this).find('text').text());
+          var value = $.trim($(this).find('value').text());
+          //console.log(text);
+          //console.log(value);
+          results[results.length] = {'data': this, 'result': value, 'value': text};
+        });
+        $(results).each(function() {
+          //console.log('value', this.value);
+          //console.log('text', this.text);
+        });
+        //console.log(results);
+        return results;
+      };
+    $(YourOojHere).autocomplete(SERVER_AJAX_URL, {parse: parseXML});
+  </script>
+<?xml version="1.0"?>
+  <item>
+    <text>
+      <![CDATA[<b>FreeNode:</b> irc.freenode.net:6667]]>
+    </text>
+    <value><![CDATA[irc.freenode.net:6667]]></value>
+  </item><item>
+    <text>
+      <![CDATA[<b>irc.oftc.net</b>:6667]]>
+    </text>
+    <value><![CDATA[irc.oftc.net:6667]]></value>
+  </item><item>
+    <text>
+      <![CDATA[<b>irc.undernet.org</b>:6667]]>
+    </text>
+    <value><![CDATA[irc.undernet.org:6667]]></value>
+  </item>
+Hi all,
+I use Autocomplete 1.0 Alpha mostly for form inputs bound to foreign
+key columns. For instance I have a user_position table with two
+columns: user_id and position_id. On new appointment form I have two
+autocomplete text inputs with the following code:
+   <input type="text" id="user_id" class="ac_input"  tabindex="1" />
+   <input type="text" id="position_id" class="ac_input" tabindex="2" />
+As you can see the inputs do not have a name attribute, and when the
+form is submitted their values are not sent, which is all right since
+they will contain strings like:
+   'John Doe'
+   'Sales Manager'
+whereas our backend expects something like:
+   23
+   14
+which are the user_id for John Doe and position_id for Sales Manager.
+To send these values I have two hidden inputs in the form like this:
+   <input type="hidden" name="user_id" value="">
+   <input type="hidden" name="position_id" value="">
+Also I have the following code in the $().ready function:
+   $("#user_id").result(function(event, data, formatted) {
+     $("input[@name=user_id]").val(data[1]);
+   });
+   $("#position_id").result(function(event, data, formatted) {
+     $("input[@name=position_id]").val(data[1]);
+   });
+As could be seen these functions stuff user_id and position_id values
+(in our example 23 and 14) into the hidden inputs, and when the form
+is submitted these values are sent:
+   user_id = 23
+   position_id = 14
+The backend script then takes care of adding a record to our
+user_position table containing those values.
+I wonder how could the plugin code be modified to simplify the setup
+by taking care of adding hidden inputs and updating the value of
+hidden inputs as default behavior. I have successfully attempted a
+simpler solution - writing a wrapper to perform these additional tasks
+and invoke autocomplete as well. I hope my intention is clear enough,
+if not, this is exactly the expected outcome:
+   <script type="text/javascript"
+   src="jquery.autocomplete-modified.js"></script>
+   <input type="text" name="user_id" class="ac_input" tabindex="1" />
+   <input type="text" id="user_id" class="ac_input" tabindex="1" />
+   <input type="hidden" name="user_id" value="23">
+Last word, I know this looks like a tall order, and I do not hope
+someone will make a complete working mod for me, but rather would very
+much appreciate helpful  advise and directions.
+Many thanks in advance
--- /dev/null	Thu Jan 01 00:00:00 1970 +0000
+++ b/src/main/resources/a_js/jquery-ui-1.8.16.custom.min.js	Tue Jan 03 16:58:07 2012 +0100
@@ -0,0 +1,791 @@
+ * jQuery UI 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16",
+keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=
+this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,
+"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":
+"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,
+outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,
+"tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&
+a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&
+ * jQuery UI Widget 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)try{b(d).triggerHandler("remove")}catch(e){}k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(d){}});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=
+function(h){return!!b.data(h,a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):
+d;if(e&&d.charAt(0)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=
+b.extend(true,{},this.options,this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+
+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",
+c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
+ * jQuery UI Mouse 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ *	jquery.ui.widget.js
+ */
+(function(b){var d=false;b(document).mouseup(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+
+this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"&&a.target.nodeName?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=
+this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&&
+!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
+false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+ * jQuery UI Position 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+ * jQuery UI Draggable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;
+this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true},
+_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=
+false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,
+10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||
+!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&
+a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=
+this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),
+10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),
+10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,
+(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!=
+10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+
+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&
+!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left;
+526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,
+c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.16"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert});
+h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=
+false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);
+this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;
+c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&
+this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=
+a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!=
+"x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<
+c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-
+c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,
+width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&&
+o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t=
+(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),
+10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
+ * jQuery UI Droppable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.16"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=
+i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parents(":not(body,html)").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);
+if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parents(":not(body,html)").unbind("scroll.droppable");
+ * jQuery UI Resizable 1.8.16
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.mouse.js
+ *	jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();
+var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=
+false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});
+this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff=
+{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];
+if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},
+_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,
+{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight:
+b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&&
+a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=
+null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||
+0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+
+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+
+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);
+b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),
+10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-
+f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?
+e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=
+e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,
+step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=
+e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;
+var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: